소스 검색

Merge branch 'master' into power-pref

Alexander Rose 2 년 전
부모
커밋
211d339ce0
34개의 변경된 파일1314개의 추가작업 그리고 359개의 파일을 삭제
  1. 4 0
      CHANGELOG.md
  2. 344 203
      package-lock.json
  3. 20 19
      package.json
  4. 5 3
      src/apps/docking-viewer/viewport.tsx
  5. 7 4
      src/examples/lighting/index.ts
  6. 9 0
      src/extensions/cellpack/model.ts
  7. 200 27
      src/extensions/rcsb/graphql/types.ts
  8. 3 3
      src/mol-canvas3d/passes/draw.ts
  9. 140 8
      src/mol-canvas3d/passes/postprocessing.ts
  10. 41 4
      src/mol-geo/geometry/texture-mesh/texture-mesh.ts
  11. 9 5
      src/mol-gl/renderer.ts
  12. 3 3
      src/mol-gl/shader/direct-volume.frag.ts
  13. 15 1
      src/mol-gl/shader/postprocessing.frag.ts
  14. 131 0
      src/mol-gl/shader/shadows.frag.ts
  15. 1 1
      src/mol-io/reader/cif/schema/bird.ts
  16. 1 1
      src/mol-io/reader/cif/schema/ccd.ts
  17. 1 1
      src/mol-io/reader/cif/schema/mmcif.ts
  18. 4 0
      src/mol-model/structure/model/types.ts
  19. 0 0
      src/mol-model/structure/model/types/saccharides.ts
  20. 15 6
      src/mol-plugin-state/helpers/structure-selection-query.ts
  21. 7 4
      src/mol-plugin-ui/controls/parameters.tsx
  22. 2 0
      src/mol-plugin-ui/structure/quick-styles.tsx
  23. 3 0
      src/mol-plugin-ui/viewport/simple-settings.tsx
  24. 4 4
      src/mol-repr/representation.ts
  25. 4 3
      src/mol-repr/structure/representation/molecular-surface.ts
  26. 2 0
      src/mol-repr/structure/visual/gaussian-surface-mesh.ts
  27. 71 2
      src/mol-repr/structure/visual/molecular-surface-mesh.ts
  28. 48 21
      src/mol-repr/structure/visual/util/common.ts
  29. 18 23
      src/mol-repr/structure/visual/util/gaussian.ts
  30. 34 7
      src/mol-repr/structure/visual/util/molecular-surface.ts
  31. 1 0
      src/mol-repr/volume/isosurface.ts
  32. 2 0
      src/mol-theme/color.ts
  33. 159 0
      src/mol-theme/color/external-volume.ts
  34. 6 6
      src/mol-util/param-definition.ts

+ 4 - 0
CHANGELOG.md

@@ -7,6 +7,10 @@ Note that since we don't clearly distinguish between a public and private interf
 ## [Unreleased]
 
 - Support for ``powerPreference`` webgl attribute. Add ``PluginConfig.General.PowerPreference`` and ``power-preference`` Viewer GET param.
+- Excluded common protein caps `NME` and `ACE` from the ligand selection query
+- Add screen-space shadow post-processing effect
+- Add "Structure Molecular Surface" visual
+- Add `external-volume` theme (coloring of arbitrary geometries by user-selected volume)
 
 ## [v3.25.1] - 2022-11-20
 

파일 크기가 너무 크기때문에 변경 상태를 표시하지 않습니다.
+ 344 - 203
package-lock.json


+ 20 - 19
package.json

@@ -92,57 +92,58 @@
     "Panagiotis Tourlas <panagiot_tourlov@hotmail.com>",
     "Adam Midlik <midlik@gmail.com>",
     "Koya Sakuma <koya.sakuma.work@gmail.com>",
-    "Gianluca Tomasello <giagitom@gmail.com>"
+    "Gianluca Tomasello <giagitom@gmail.com>",
+    "Jason Pattle <jpattle@exscientia.co.uk>"
   ],
   "license": "MIT",
   "devDependencies": {
     "@graphql-codegen/add": "^3.2.1",
-    "@graphql-codegen/cli": "^2.13.11",
+    "@graphql-codegen/cli": "^2.15.0",
     "@graphql-codegen/time": "^3.2.1",
-    "@graphql-codegen/typescript": "^2.8.1",
+    "@graphql-codegen/typescript": "^2.8.3",
     "@graphql-codegen/typescript-graphql-files-modules": "^2.2.1",
     "@graphql-codegen/typescript-graphql-request": "^4.5.8",
-    "@graphql-codegen/typescript-operations": "^2.5.6",
+    "@graphql-codegen/typescript-operations": "^2.5.8",
     "@types/cors": "^2.8.12",
-    "@types/gl": "^6.0.1",
-    "@types/jest": "^29.2.2",
-    "@types/react": "^18.0.25",
-    "@types/react-dom": "^18.0.8",
-    "@typescript-eslint/eslint-plugin": "^5.42.1",
-    "@typescript-eslint/parser": "^5.42.1",
+    "@types/gl": "^6.0.2",
+    "@types/jest": "^29.2.3",
+    "@types/react": "^18.0.26",
+    "@types/react-dom": "^18.0.9",
+    "@typescript-eslint/eslint-plugin": "^5.45.0",
+    "@typescript-eslint/parser": "^5.45.0",
     "benchmark": "^2.1.4",
-    "concurrently": "^7.5.0",
+    "concurrently": "^7.6.0",
     "cpx2": "^4.2.0",
     "crypto-browserify": "^3.12.0",
     "css-loader": "^6.7.2",
-    "eslint": "^8.27.0",
+    "eslint": "^8.29.0",
     "extra-watch-webpack-plugin": "^1.0.3",
     "file-loader": "^6.2.0",
-    "fs-extra": "^10.1.0",
+    "fs-extra": "^11.1.0",
     "graphql": "^16.6.0",
     "http-server": "^14.1.1",
     "jest": "^29.3.1",
-    "mini-css-extract-plugin": "^2.6.1",
+    "mini-css-extract-plugin": "^2.7.1",
     "path-browserify": "^1.0.1",
     "raw-loader": "^4.0.2",
     "react": "^18.2.0",
     "react-dom": "^18.2.0",
     "sass": "^1.56.1",
     "sass-loader": "^13.2.0",
-    "simple-git": "^3.15.0",
+    "simple-git": "^3.15.1",
     "stream-browserify": "^3.0.0",
     "style-loader": "^3.3.1",
     "ts-jest": "^29.0.3",
-    "typescript": "^4.8.4",
+    "typescript": "^4.9.3",
     "webpack": "^5.75.0",
-    "webpack-cli": "^4.10.0"
+    "webpack-cli": "^5.0.0"
   },
   "dependencies": {
     "@types/argparse": "^2.0.10",
     "@types/benchmark": "^2.1.2",
     "@types/compression": "1.7.2",
     "@types/express": "^4.17.14",
-    "@types/node": "^16.18.3",
+    "@types/node": "^16.18.4",
     "@types/node-fetch": "^2.6.2",
     "@types/swagger-ui-dist": "3.30.1",
     "argparse": "^2.0.1",
@@ -154,7 +155,7 @@
     "immer": "^9.0.16",
     "immutable": "^4.1.0",
     "node-fetch": "^2.6.7",
-    "rxjs": "^7.5.7",
+    "rxjs": "^7.6.0",
     "swagger-ui-dist": "^4.15.5",
     "tslib": "^2.4.1",
     "util.promisify": "^1.1.1",

+ 5 - 3
src/apps/docking-viewer/viewport.tsx

@@ -31,7 +31,8 @@ function shinyStyle(plugin: PluginContext) {
         postprocessing: {
             ...plugin.canvas3d!.props.postprocessing,
             occlusion: { name: 'off', params: {} },
-            outline: { name: 'off', params: {} }
+            shadow: { name: 'off', params: {} },
+            outline: { name: 'off', params: {} },
         }
     } });
 }
@@ -48,13 +49,14 @@ function occlusionStyle(plugin: PluginContext) {
                 blurKernelSize: 15,
                 radius: 5,
                 samples: 32,
-                resolutionScale: 1
+                resolutionScale: 1,
             } },
             outline: { name: 'on', params: {
                 scale: 1.0,
                 threshold: 0.33,
                 color: Color(0x0000),
-            } }
+            } },
+            shadow: { name: 'off', params: {} },
         }
     } });
 }

+ 7 - 4
src/examples/lighting/index.ts

@@ -1,5 +1,5 @@
 /**
- * Copyright (c) 2019-2021 mol* contributors, licensed under MIT, See LICENSE file for more info.
+ * Copyright (c) 2019-2022 mol* contributors, licensed under MIT, See LICENSE file for more info.
  *
  * @author Alexander Rose <alexander.rose@weirdbyte.de>
  */
@@ -25,7 +25,8 @@ const Canvas3DPresets = {
         canvas3d: <Preset>{
             postprocessing: {
                 occlusion: { name: 'on', params: { samples: 32, radius: 6, bias: 1.4, blurKernelSize: 15, resolutionScale: 1 } },
-                outline: { name: 'on', params: { scale: 1, threshold: 0.33, color: Color(0x000000) } }
+                outline: { name: 'on', params: { scale: 1, threshold: 0.33, color: Color(0x000000) } },
+                shadow: { name: 'off', params: {} },
             },
             renderer: {
                 ambientIntensity: 1.0,
@@ -37,7 +38,8 @@ const Canvas3DPresets = {
         canvas3d: <Preset>{
             postprocessing: {
                 occlusion: { name: 'on', params: { samples: 32, radius: 6, bias: 1.4, blurKernelSize: 15, resolutionScale: 1 } },
-                outline: { name: 'off', params: {} }
+                outline: { name: 'off', params: {} },
+                shadow: { name: 'off', params: {} },
             },
             renderer: {
                 ambientIntensity: 0.4,
@@ -50,7 +52,8 @@ const Canvas3DPresets = {
         canvas3d: <Preset>{
             postprocessing: {
                 occlusion: { name: 'off', params: {} },
-                outline: { name: 'off', params: {} }
+                outline: { name: 'off', params: {} },
+                shadow: { name: 'off', params: {} },
             },
             renderer: {
                 ambientIntensity: 0.4,

+ 9 - 0
src/extensions/cellpack/model.ts

@@ -606,6 +606,15 @@ export const LoadCellPackModel = StateAction.build({
                         resolutionScale: 1,
                     }
                 },
+                shadow: {
+                    name: 'on',
+                    params: {
+                        bias: 0.6,
+                        maxDistance: 80,
+                        steps: 3,
+                        tolerance: 1.0,
+                    }
+                },
                 outline: {
                     name: 'on',
                     params: {

+ 200 - 27
src/extensions/rcsb/graphql/types.ts

@@ -4,7 +4,7 @@ export type InputMaybe<T> = Maybe<T>;
 export type Exact<T extends { [key: string]: unknown }> = { [K in keyof T]: T[K] };
 export type MakeOptional<T, K extends keyof T> = Omit<T, K> & { [SubKey in K]?: Maybe<T[SubKey]> };
 export type MakeMaybe<T, K extends keyof T> = Omit<T, K> & { [SubKey in K]: Maybe<T[SubKey]> };
-// Generated on 2022-08-20T16:36:05-07:00
+// Generated on 2022-12-03T21:55:37-08:00
 
 /** All built-in and custom scalars, mapped to their actual values */
 export type Scalars = {
@@ -343,6 +343,14 @@ export type Citation = {
    *
    */
   readonly journal_abbrev?: Maybe<Scalars['String']>;
+  /**
+   * Full name of the cited journal; relevant for journal articles.
+   *
+   * Examples:
+   * Journal of Molecular Biology
+   *
+   */
+  readonly journal_full?: Maybe<Scalars['String']>;
   /**
    * The American Society for Testing and Materials (ASTM) code
    *  assigned to the journal cited (also referred to as the CODEN
@@ -550,6 +558,7 @@ export type CoreBranchedEntityInstance = {
   readonly rcsb_id: Scalars['String'];
   readonly rcsb_latest_revision?: Maybe<RcsbLatestRevision>;
   readonly rcsb_ligand_neighbors?: Maybe<ReadonlyArray<Maybe<RcsbLigandNeighbors>>>;
+  readonly struct_asym?: Maybe<StructAsym>;
 };
 
 export type CoreChemComp = {
@@ -661,6 +670,7 @@ export type CoreEntry = {
   readonly exptl?: Maybe<ReadonlyArray<Maybe<Exptl>>>;
   readonly exptl_crystal?: Maybe<ReadonlyArray<Maybe<ExptlCrystal>>>;
   readonly exptl_crystal_grow?: Maybe<ReadonlyArray<Maybe<ExptlCrystalGrow>>>;
+  readonly ma_data?: Maybe<ReadonlyArray<Maybe<MaData>>>;
   /** Get all non-polymer (non-solvent) entities for this PDB entry. */
   readonly nonpolymer_entities?: Maybe<ReadonlyArray<Maybe<CoreNonpolymerEntity>>>;
   readonly pdbx_SG_project?: Maybe<ReadonlyArray<Maybe<PdbxSgProject>>>;
@@ -701,6 +711,7 @@ export type CoreEntry = {
   /** The list of content types associated with this entry. */
   readonly rcsb_associated_holdings?: Maybe<CurrentEntry>;
   readonly rcsb_binding_affinity?: Maybe<ReadonlyArray<Maybe<RcsbBindingAffinity>>>;
+  readonly rcsb_comp_model_provenance?: Maybe<RcsbCompModelProvenance>;
   readonly rcsb_entry_container_identifiers: RcsbEntryContainerIdentifiers;
   readonly rcsb_entry_group_membership?: Maybe<ReadonlyArray<Maybe<RcsbEntryGroupMembership>>>;
   readonly rcsb_entry_info: RcsbEntryInfo;
@@ -713,6 +724,7 @@ export type CoreEntry = {
    *
    */
   readonly rcsb_id: Scalars['String'];
+  readonly rcsb_ma_qa_metric_global?: Maybe<ReadonlyArray<Maybe<RcsbMaQaMetricGlobal>>>;
   readonly rcsb_primary_citation?: Maybe<RcsbPrimaryCitation>;
   readonly refine?: Maybe<ReadonlyArray<Maybe<Refine>>>;
   readonly refine_analyze?: Maybe<ReadonlyArray<Maybe<RefineAnalyze>>>;
@@ -786,6 +798,7 @@ export type CoreNonpolymerEntityInstance = {
   readonly rcsb_nonpolymer_instance_validation_score?: Maybe<ReadonlyArray<Maybe<RcsbNonpolymerInstanceValidationScore>>>;
   readonly rcsb_nonpolymer_struct_conn?: Maybe<ReadonlyArray<Maybe<RcsbNonpolymerStructConn>>>;
   readonly rcsb_target_neighbors?: Maybe<ReadonlyArray<Maybe<RcsbTargetNeighbors>>>;
+  readonly struct_asym?: Maybe<StructAsym>;
 };
 
 export type CorePfam = {
@@ -919,6 +932,7 @@ export type CorePolymerEntityInstance = {
   readonly rcsb_polymer_instance_feature?: Maybe<ReadonlyArray<Maybe<RcsbPolymerInstanceFeature>>>;
   readonly rcsb_polymer_instance_feature_summary?: Maybe<ReadonlyArray<Maybe<RcsbPolymerInstanceFeatureSummary>>>;
   readonly rcsb_polymer_struct_conn?: Maybe<ReadonlyArray<Maybe<RcsbPolymerStructConn>>>;
+  readonly struct_asym?: Maybe<StructAsym>;
 };
 
 export type CorePubmed = {
@@ -1284,9 +1298,9 @@ export type Em2dCrystalEntity = {
   readonly id: Scalars['String'];
   /** pointer to _em_image_processing.id in the EM_IMAGE_PROCESSING category. */
   readonly image_processing_id: Scalars['String'];
-  /** Unit-cell length a in Angstroms. */
+  /** Unit-cell length a in angstroms. */
   readonly length_a?: Maybe<Scalars['Float']>;
-  /** Unit-cell length b in Angstroms. */
+  /** Unit-cell length b in angstroms. */
   readonly length_b?: Maybe<Scalars['Float']>;
   /** Thickness of 2D crystal */
   readonly length_c?: Maybe<Scalars['Float']>;
@@ -1317,11 +1331,11 @@ export type Em3dCrystalEntity = {
   readonly id: Scalars['String'];
   /** pointer to _em_image_processing.id in the EM_IMAGE_PROCESSING category. */
   readonly image_processing_id: Scalars['String'];
-  /** Unit-cell length a in Angstroms. */
+  /** Unit-cell length a in angstroms. */
   readonly length_a?: Maybe<Scalars['Float']>;
-  /** Unit-cell length b in Angstroms. */
+  /** Unit-cell length b in angstroms. */
   readonly length_b?: Maybe<Scalars['Float']>;
-  /** Unit-cell length c in Angstroms. */
+  /** Unit-cell length c in angstroms. */
   readonly length_c?: Maybe<Scalars['Float']>;
   /**
    * Space group name.
@@ -1482,7 +1496,7 @@ export type Em3dReconstruction = {
    */
   readonly refinement_type?: Maybe<Scalars['String']>;
   /**
-   * The final resolution (in Angstroms)of the 3D reconstruction.
+   * The final resolution (in angstroms)of the 3D reconstruction.
    *
    * Examples:
    * null, null
@@ -1558,7 +1572,7 @@ export type EmDiffractionShell = {
    */
   readonly fourier_space_coverage?: Maybe<Scalars['Float']>;
   /**
-   * High resolution limit for this shell (Angstroms)
+   * High resolution limit for this shell (angstroms)
    *
    * Examples:
    * null
@@ -1568,7 +1582,7 @@ export type EmDiffractionShell = {
   /** Unique identifier for the category em_diffraction_shell */
   readonly id: Scalars['String'];
   /**
-   * Low resolution limit for this shell (Angstroms)
+   * Low resolution limit for this shell (angstroms)
    *
    * Examples:
    * null
@@ -1614,7 +1628,7 @@ export type EmDiffractionStats = {
    */
   readonly fourier_space_coverage?: Maybe<Scalars['Float']>;
   /**
-   * High resolution limit of the structure factor data, in Angstroms
+   * High resolution limit of the structure factor data, in angstroms
    *
    * Examples:
    * null
@@ -1998,12 +2012,12 @@ export type EmImaging = {
   /** The magnification indicated by the microscope readout. */
   readonly nominal_magnification?: Maybe<Scalars['Int']>;
   /**
-   * The specimen temperature maximum (degrees Kelvin) for the duration
+   * The specimen temperature maximum (kelvin) for the duration
    *  of imaging.
    */
   readonly recording_temperature_maximum?: Maybe<Scalars['Float']>;
   /**
-   * The specimen temperature minimum (degrees Kelvin) for the duration
+   * The specimen temperature minimum (kelvin) for the duration
    *  of imaging.
    */
   readonly recording_temperature_minimum?: Maybe<Scalars['Float']>;
@@ -2028,7 +2042,7 @@ export type EmImaging = {
   /** Foreign key to the EM_SPECIMEN category */
   readonly specimen_id?: Maybe<Scalars['String']>;
   /**
-   * The mean specimen stage temperature (degrees Kelvin) during imaging
+   * The mean specimen stage temperature (in kelvin) during imaging
    *  in the microscope.
    */
   readonly temperature?: Maybe<Scalars['Float']>;
@@ -2215,7 +2229,7 @@ export type EmStaining = {
 };
 
 export type EmVitrification = {
-  /** The temperature (in degrees Kelvin) of the sample just prior to vitrification. */
+  /** The temperature (in kelvin) of the sample just prior to vitrification. */
   readonly chamber_temperature?: Maybe<Scalars['Float']>;
   /**
    * This is the name of the cryogen.
@@ -2259,7 +2273,7 @@ export type EmVitrification = {
   /** This data item is a pointer to _em_specimen.id */
   readonly specimen_id: Scalars['String'];
   /**
-   * The vitrification temperature (in degrees Kelvin), e.g.,
+   * The vitrification temperature (in kelvin), e.g.,
    *   temperature of the plunge instrument cryogen bath.
    */
   readonly temp?: Maybe<Scalars['Float']>;
@@ -2364,6 +2378,14 @@ export type EntityPoly = {
    *
    */
   readonly pdbx_seq_one_letter_code_can?: Maybe<Scalars['String']>;
+  /**
+   * Evidence for the assignment of the polymer sequence.
+   *
+   * Allowable values:
+   * depositor provided, derived from coordinates
+   *
+   */
+  readonly pdbx_sequence_evidence_code?: Maybe<Scalars['String']>;
   /**
    * The PDB strand/chain id(s) corresponding to this polymer entity.
    *
@@ -3005,6 +3027,8 @@ export type Entry = {
    *  identifier.
    */
   readonly id: Scalars['String'];
+  /** An identifier for the model collection associated with the entry. */
+  readonly ma_collection_id?: Maybe<Scalars['String']>;
 };
 
 export type Exptl = {
@@ -3263,6 +3287,29 @@ export type InterfacePartnerFeatureFeaturePositions = {
   readonly values?: Maybe<ReadonlyArray<Maybe<Scalars['Float']>>>;
 };
 
+export type MaData = {
+  /**
+   * The type of data held in the dataset.
+   *
+   * Allowable values:
+   * coevolution MSA, input structure, model coordinates, other, polymeric template library, spatial restraints, target, target-template alignment, template structure
+   *
+   */
+  readonly content_type?: Maybe<Scalars['String']>;
+  /** Details for other content types. */
+  readonly content_type_other_details?: Maybe<Scalars['String']>;
+  /** A unique identifier for the data. */
+  readonly id: Scalars['Int'];
+  /**
+   * An author-given name for the content held in the dataset.
+   *
+   * Examples:
+   * NMR NOE Distances, Target Template Alignment, Coevolution Data
+   *
+   */
+  readonly name?: Maybe<Scalars['String']>;
+};
+
 export type MethodDetails = {
   /** A description of special aspects of the clustering process */
   readonly description?: Maybe<Scalars['String']>;
@@ -4199,7 +4246,7 @@ export type PdbxNmrExptlSampleConditions = {
    */
   readonly pressure_units?: Maybe<Scalars['String']>;
   /**
-   * The temperature (in Kelvin) at which NMR data were
+   * The temperature (in kelvin) at which NMR data were
    *  collected.
    */
   readonly temperature?: Maybe<Scalars['String']>;
@@ -4453,7 +4500,7 @@ export type PdbxPrdAudit = {
    * An identifier for the wwPDB site creating or modifying the molecule.
    *
    * Allowable values:
-   * BMRB, PDBC, PDBJ, PDBe, RCSB
+   * BMRB, PDBC, PDBE, PDBJ, RCSB
    *
    */
   readonly processing_site?: Maybe<Scalars['String']>;
@@ -6817,7 +6864,7 @@ export type Query = {
   readonly assemblies?: Maybe<ReadonlyArray<Maybe<CoreAssembly>>>;
   /** Get an assembly given the PDB ID and ASSEMBLY ID. Here ASSEMBLY ID is '1', '2', '3', etc. or 'deposited' for deposited coordinates. */
   readonly assembly?: Maybe<CoreAssembly>;
-  /** Get a list of PDB branched entities given a list of ENTITY IDs. Here ENTITY ID is a compound identifier that includes entry_id and entity_id separated by '_', e.g. 1XXX_1. */
+  /** Get a list of PDB branched entities given a list of ENTITY IDs. Here ENTITY ID is a compound identifier that includes entry_id and entity_id separated by '_', e.g. 1XXX_1. Note that the ENTRY ID part must be upper case. */
   readonly branched_entities?: Maybe<ReadonlyArray<Maybe<CoreBranchedEntity>>>;
   /** Get a PDB branched entity, given the PDB ID and ENTITY ID. Here ENTITY ID is a '1', '2', '3', etc. */
   readonly branched_entity?: Maybe<CoreBranchedEntity>;
@@ -6841,9 +6888,9 @@ export type Query = {
   readonly group_provenance?: Maybe<GroupProvenance>;
   /** Get a pairwise polymeric interface given the PDB ID, ASSEMBLY ID and INTERFACE ID. */
   readonly interface?: Maybe<CoreInterface>;
-  /** Get a list of pairwise polymeric interfaces given a list of INTERFACE IDs. Here INTERFACE ID is a compound identifier that includes entry_id, assembly_id and interface_id e.g. 1XXX-1.1. */
+  /** Get a list of pairwise polymeric interfaces given a list of INTERFACE IDs. Here INTERFACE ID is a compound identifier that includes entry_id, assembly_id and interface_id e.g. 1XXX-1.1. Note that the ENTRY ID part must be upper case. */
   readonly interfaces?: Maybe<ReadonlyArray<Maybe<CoreInterface>>>;
-  /** Get a list of PDB non-polymer entities given a list of ENTITY IDs. Here ENTITY ID is a compound identifier that includes entry_id and entity_id separated by '_', e.g. 1XXX_1. */
+  /** Get a list of PDB non-polymer entities given a list of ENTITY IDs. Here ENTITY ID is a compound identifier that includes entry_id and entity_id separated by '_', e.g. 1XXX_1. Note that the ENTRY ID part must be upper case. */
   readonly nonpolymer_entities?: Maybe<ReadonlyArray<Maybe<CoreNonpolymerEntity>>>;
   /** Get a PDB non-polymer entity, given the PDB ID and ENTITY ID. Here ENTITY ID is a '1', '2', '3', etc. */
   readonly nonpolymer_entity?: Maybe<CoreNonpolymerEntity>;
@@ -6851,7 +6898,7 @@ export type Query = {
   readonly nonpolymer_entity_instance?: Maybe<CoreNonpolymerEntityInstance>;
   /** Get a list of PDB non-polymer entity instances (chains), given the list of ENTITY INSTANCE IDs. Here ENTITY INSTANCE ID identifies structural element in the asymmetric unit, e.g. 'A', 'B', etc. */
   readonly nonpolymer_entity_instances?: Maybe<ReadonlyArray<Maybe<CoreNonpolymerEntityInstance>>>;
-  /** Get a list of PDB polymer entities given a list of ENTITY IDs. Here ENTITY ID is a compound identifier that includes entry_id and entity_id separated by '_', e.g. 1XXX_1. */
+  /** Get a list of PDB polymer entities given a list of ENTITY IDs. Here ENTITY ID is a compound identifier that includes entry_id and entity_id separated by '_', e.g. 1XXX_1. Note that the ENTRY ID part must be upper case. */
   readonly polymer_entities?: Maybe<ReadonlyArray<Maybe<CorePolymerEntity>>>;
   /** Get a PDB polymer entity, given the PDB ID and ENTITY ID. Here ENTITY ID is a '1', '2', '3', etc. */
   readonly polymer_entity?: Maybe<CorePolymerEntity>;
@@ -8421,6 +8468,29 @@ export type RcsbClusterMembership = {
   readonly identity?: Maybe<Scalars['Int']>;
 };
 
+export type RcsbCompModelProvenance = {
+  /**
+   * Entry identifier corresponding to the computed structure model.
+   *
+   * Examples:
+   * AF-P60325-F1, ma-bak-cepc-0019
+   *
+   */
+  readonly entry_id: Scalars['String'];
+  /**
+   * Source database for the computed structure model.
+   *
+   * Allowable values:
+   * AlphaFoldDB, ModelArchive
+   *
+   */
+  readonly source_db?: Maybe<Scalars['String']>;
+  /** Source filename for the computed structure model. */
+  readonly source_filename?: Maybe<Scalars['String']>;
+  /** Source URL for computed structure model file. */
+  readonly source_url?: Maybe<Scalars['String']>;
+};
+
 export type RcsbEntityHostOrganism = {
   /**
    * The beginning polymer sequence position for the polymer section corresponding
@@ -8657,7 +8727,7 @@ export type RcsbEntitySourceOrganism = {
    * A code indicating the provenance of the source organism details for the entity
    *
    * Allowable values:
-   * PDB Primary Data
+   * PDB Primary Data, UniProt
    *
    */
   readonly provenance_source?: Maybe<Scalars['String']>;
@@ -8731,7 +8801,7 @@ export type RcsbEntryContainerIdentifiers = {
    * Entry identifier for the container.
    *
    * Examples:
-   * 1KIP, 4HHB
+   * 4HHB, AF_AFP60325F1, MA_MABAKCEPC0019
    *
    */
   readonly entry_id: Scalars['String'];
@@ -8879,6 +8949,15 @@ export type RcsbEntryInfo = {
    *
    */
   readonly na_polymer_entity_types?: Maybe<Scalars['String']>;
+  /**
+   * This data item identifies secondary structure
+   *  features of nucleic acids in the entry.
+   *
+   * Allowable values:
+   * a-form double helix, b-form double helix, bulge loop, double helix, four-way junction, hairpin loop, internal loop, mismatched base pair, other right-handed double helix, parallel strands, quadruple helix, tetraloop, three-way junction, triple helix, two-way junction, z-form double helix
+   *
+   */
+  readonly ndb_struct_conf_na_feature_combined?: Maybe<ReadonlyArray<Maybe<Scalars['String']>>>;
   /** Bound nonpolymer components in this entry. */
   readonly nonpolymer_bound_components?: Maybe<ReadonlyArray<Maybe<Scalars['String']>>>;
   /** The number of distinct non-polymer entities in the structure entry exclusive of solvent. */
@@ -8955,6 +9034,21 @@ export type RcsbEntryInfo = {
   readonly software_programs_combined?: Maybe<ReadonlyArray<Maybe<Scalars['String']>>>;
   /** The number of distinct solvent entities per deposited structure model. */
   readonly solvent_entity_count?: Maybe<Scalars['Int']>;
+  /**
+   * Indicates if the structure was determined using experimental or computational methods.
+   *
+   * Allowable values:
+   * computational, experimental
+   *
+   */
+  readonly structure_determination_methodology: Scalars['String'];
+  /**
+   * Indicates the priority of the value in _rcsb_entry_info.structure_determination_methodology.
+   *  The lower the number the higher the priority.
+   *  Priority values for "experimental" structures is currently set to 10 and
+   *  the values for "computational" structures is set to 100.
+   */
+  readonly structure_determination_methodology_priority?: Maybe<Scalars['Int']>;
 };
 
 export type RcsbEntryInfoDiffrnResolutionHigh = {
@@ -9294,6 +9388,49 @@ export type RcsbLigandNeighbors = {
   readonly seq_id?: Maybe<Scalars['Int']>;
 };
 
+export type RcsbMaQaMetricGlobal = {
+  readonly ma_qa_metric_global?: Maybe<ReadonlyArray<Maybe<RcsbMaQaMetricGlobalMaQaMetricGlobal>>>;
+  /** The model identifier. */
+  readonly model_id: Scalars['Int'];
+};
+
+export type RcsbMaQaMetricGlobalMaQaMetricGlobal = {
+  /**
+   * Description of the global QA metric.
+   *
+   * Examples:
+   * confidence score predicting accuracy according to the CA-only Local Distance Difference Test (lDDT-CA) in [0,100]
+   *
+   */
+  readonly description?: Maybe<Scalars['String']>;
+  /**
+   * Name of the global QA metric.
+   *
+   * Examples:
+   * pLDDT
+   *
+   */
+  readonly name: Scalars['String'];
+  /**
+   * The type of global QA metric.
+   *
+   * Allowable values:
+   * PAE, contact probability, distance, energy, ipTM, normalized score, other, pLDDT, pLDDT all-atom, pLDDT all-atom in [0,1], pLDDT in [0,1], pTM, zscore
+   *
+   */
+  readonly type: Scalars['String'];
+  /** Details for other type of global QA metric. */
+  readonly type_other_details?: Maybe<Scalars['String']>;
+  /**
+   * Value of the global QA metric.
+   *
+   * Examples:
+   * null
+   *
+   */
+  readonly value: Scalars['Float'];
+};
+
 export type RcsbMembraneLineage = {
   /** Hierarchy depth. */
   readonly depth?: Maybe<Scalars['Int']>;
@@ -10332,7 +10469,7 @@ export type RcsbPolymerEntityContainerIdentifiersReferenceSequenceIdentifiers =
    * Source of the reference database assignment
    *
    * Allowable values:
-   * PDB, RCSB, SIFTS
+   * PDB, RCSB, SIFTS, UniProt
    *
    */
   readonly provenance_source?: Maybe<Scalars['String']>;
@@ -10737,7 +10874,7 @@ export type RcsbPolymerInstanceFeature = {
    * A type or category of the feature.
    *
    * Allowable values:
-   * ANGLE_OUTLIER, BINDING_SITE, BOND_OUTLIER, C-MANNOSYLATION_SITE, CATH, CIS-PEPTIDE, ECOD, HELIX_P, MEMBRANE_SEGMENT, MOGUL_ANGLE_OUTLIER, MOGUL_BOND_OUTLIER, N-GLYCOSYLATION_SITE, O-GLYCOSYLATION_SITE, RAMACHANDRAN_OUTLIER, ROTAMER_OUTLIER, RSCC_OUTLIER, RSRZ_OUTLIER, S-GLYCOSYLATION_SITE, SABDAB_ANTIBODY_HEAVY_CHAIN_SUBCLASS, SABDAB_ANTIBODY_LIGHT_CHAIN_SUBCLASS, SABDAB_ANTIBODY_LIGHT_CHAIN_TYPE, SCOP, SCOP2B_SUPERFAMILY, SCOP2_FAMILY, SCOP2_SUPERFAMILY, SHEET, STEREO_OUTLIER, UNASSIGNED_SEC_STRUCT, UNOBSERVED_ATOM_XYZ, UNOBSERVED_RESIDUE_XYZ, ZERO_OCCUPANCY_ATOM_XYZ, ZERO_OCCUPANCY_RESIDUE_XYZ, ASA
+   * ANGLE_OUTLIER, BEND, BINDING_SITE, BOND_OUTLIER, C-MANNOSYLATION_SITE, CATH, CIS-PEPTIDE, ECOD, HELIX_P, HELX_LH_PP_P, HELX_RH_3T_P, HELX_RH_AL_P, HELX_RH_PI_P, MA_QA_METRIC_LOCAL_TYPE_CONTACT_PROBABILITY, MA_QA_METRIC_LOCAL_TYPE_DISTANCE, MA_QA_METRIC_LOCAL_TYPE_ENERGY, MA_QA_METRIC_LOCAL_TYPE_IPTM, MA_QA_METRIC_LOCAL_TYPE_NORMALIZED_SCORE, MA_QA_METRIC_LOCAL_TYPE_OTHER, MA_QA_METRIC_LOCAL_TYPE_PAE, MA_QA_METRIC_LOCAL_TYPE_PLDDT, MA_QA_METRIC_LOCAL_TYPE_PLDDT_ALL-ATOM, MA_QA_METRIC_LOCAL_TYPE_PLDDT_ALL-ATOM_[0,1], MA_QA_METRIC_LOCAL_TYPE_PLDDT_[0,1], MA_QA_METRIC_LOCAL_TYPE_PTM, MA_QA_METRIC_LOCAL_TYPE_ZSCORE, MEMBRANE_SEGMENT, MOGUL_ANGLE_OUTLIER, MOGUL_BOND_OUTLIER, N-GLYCOSYLATION_SITE, O-GLYCOSYLATION_SITE, RAMACHANDRAN_OUTLIER, ROTAMER_OUTLIER, RSCC_OUTLIER, RSRZ_OUTLIER, S-GLYCOSYLATION_SITE, SABDAB_ANTIBODY_HEAVY_CHAIN_SUBCLASS, SABDAB_ANTIBODY_LIGHT_CHAIN_SUBCLASS, SABDAB_ANTIBODY_LIGHT_CHAIN_TYPE, SCOP, SCOP2B_SUPERFAMILY, SCOP2_FAMILY, SCOP2_SUPERFAMILY, SHEET, STEREO_OUTLIER, STRN, TURN_TY1_P, UNASSIGNED_SEC_STRUCT, UNOBSERVED_ATOM_XYZ, UNOBSERVED_RESIDUE_XYZ, ZERO_OCCUPANCY_ATOM_XYZ, ZERO_OCCUPANCY_RESIDUE_XYZ, ASA
    *
    */
   readonly type?: Maybe<Scalars['String']>;
@@ -10748,7 +10885,7 @@ export type RcsbPolymerInstanceFeatureAdditionalProperties = {
    * The additional property name.
    *
    * Allowable values:
-   * CATH_DOMAIN_ID, CATH_NAME, ECOD_DOMAIN_ID, ECOD_FAMILY_NAME, OMEGA_ANGLE, PARTNER_ASYM_ID, PARTNER_BOND_DISTANCE, PARTNER_COMP_ID, SCOP2_DOMAIN_ID, SCOP2_FAMILY_ID, SCOP2_FAMILY_NAME, SCOP2_SUPERFAMILY_ID, SCOP2_SUPERFAMILY_NAME, SCOP_DOMAIN_ID, SCOP_NAME, SCOP_SUN_ID, SHEET_SENSE
+   * CATH_DOMAIN_ID, CATH_NAME, ECOD_DOMAIN_ID, ECOD_FAMILY_NAME, MODELCIF_MODEL_ID, OMEGA_ANGLE, PARTNER_ASYM_ID, PARTNER_BOND_DISTANCE, PARTNER_COMP_ID, SCOP2_DOMAIN_ID, SCOP2_FAMILY_ID, SCOP2_FAMILY_NAME, SCOP2_SUPERFAMILY_ID, SCOP2_SUPERFAMILY_NAME, SCOP_DOMAIN_ID, SCOP_NAME, SCOP_SUN_ID, SHEET_SENSE
    *
    */
   readonly name?: Maybe<Scalars['String']>;
@@ -10818,7 +10955,7 @@ export type RcsbPolymerInstanceFeatureSummary = {
    * Type or category of the feature.
    *
    * Allowable values:
-   * ANGLE_OUTLIER, BINDING_SITE, BOND_OUTLIER, C-MANNOSYLATION_SITE, CATH, CIS-PEPTIDE, ECOD, HELIX_P, MEMBRANE_SEGMENT, MOGUL_ANGLE_OUTLIER, MOGUL_BOND_OUTLIER, N-GLYCOSYLATION_SITE, O-GLYCOSYLATION_SITE, RAMACHANDRAN_OUTLIER, ROTAMER_OUTLIER, RSCC_OUTLIER, RSRZ_OUTLIER, S-GLYCOSYLATION_SITE, SABDAB_ANTIBODY_HEAVY_CHAIN_SUBCLASS, SABDAB_ANTIBODY_LIGHT_CHAIN_SUBCLASS, SABDAB_ANTIBODY_LIGHT_CHAIN_TYPE, SAbDab Antibody Heavy Chain Subclass, SAbDab Antibody Light Chain Subclass, SAbDab Antibody Light Chain Type, SCOP, SCOP2 Family, SCOP2 Superfamily, SCOP2B Superfamily, SCOP2B_SUPERFAMILY, SCOP2_FAMILY, SCOP2_SUPERFAMILY, SHEET, STEREO_OUTLIER, UNASSIGNED_SEC_STRUCT, UNOBSERVED_ATOM_XYZ, UNOBSERVED_RESIDUE_XYZ, ZERO_OCCUPANCY_ATOM_XYZ, ZERO_OCCUPANCY_RESIDUE_XYZ
+   * ANGLE_OUTLIER, BEND, BINDING_SITE, BOND_OUTLIER, C-MANNOSYLATION_SITE, CATH, CIS-PEPTIDE, ECOD, HELIX_P, HELX_LH_PP_P, HELX_RH_3T_P, HELX_RH_AL_P, HELX_RH_PI_P, MA_QA_METRIC_LOCAL_TYPE_CONTACT_PROBABILITY, MA_QA_METRIC_LOCAL_TYPE_DISTANCE, MA_QA_METRIC_LOCAL_TYPE_ENERGY, MA_QA_METRIC_LOCAL_TYPE_IPTM, MA_QA_METRIC_LOCAL_TYPE_NORMALIZED_SCORE, MA_QA_METRIC_LOCAL_TYPE_OTHER, MA_QA_METRIC_LOCAL_TYPE_PAE, MA_QA_METRIC_LOCAL_TYPE_PLDDT, MA_QA_METRIC_LOCAL_TYPE_PLDDT_ALL-ATOM, MA_QA_METRIC_LOCAL_TYPE_PLDDT_ALL-ATOM_[0,1], MA_QA_METRIC_LOCAL_TYPE_PLDDT_[0,1], MA_QA_METRIC_LOCAL_TYPE_PTM, MA_QA_METRIC_LOCAL_TYPE_ZSCORE, MEMBRANE_SEGMENT, MOGUL_ANGLE_OUTLIER, MOGUL_BOND_OUTLIER, N-GLYCOSYLATION_SITE, O-GLYCOSYLATION_SITE, RAMACHANDRAN_OUTLIER, ROTAMER_OUTLIER, RSCC_OUTLIER, RSRZ_OUTLIER, S-GLYCOSYLATION_SITE, SABDAB_ANTIBODY_HEAVY_CHAIN_SUBCLASS, SABDAB_ANTIBODY_LIGHT_CHAIN_SUBCLASS, SABDAB_ANTIBODY_LIGHT_CHAIN_TYPE, SCOP, SCOP2B_SUPERFAMILY, SCOP2_FAMILY, SCOP2_SUPERFAMILY, SHEET, STEREO_OUTLIER, STRN, TURN_TY1_P, UNASSIGNED_SEC_STRUCT, UNOBSERVED_ATOM_XYZ, UNOBSERVED_RESIDUE_XYZ, ZERO_OCCUPANCY_ATOM_XYZ, ZERO_OCCUPANCY_RESIDUE_XYZ
    *
    */
   readonly type?: Maybe<Scalars['String']>;
@@ -13377,6 +13514,11 @@ export type ReflnsShell = {
 };
 
 export type Software = {
+  /**
+   * This data item is a pointer to _citation.id in the CITATION
+   *  category.
+   */
+  readonly citation_id?: Maybe<Scalars['String']>;
   /**
    * The classification of the program according to its
    *  major function.
@@ -13527,6 +13669,37 @@ export type Struct = {
   readonly title?: Maybe<Scalars['String']>;
 };
 
+export type StructAsym = {
+  /**
+   * This data item is a pointer to _atom_site.pdbx_PDB_strand_id the
+   *  ATOM_SITE category.
+   *
+   * Examples:
+   * 1ABC
+   *
+   */
+  readonly pdbx_PDB_id?: Maybe<Scalars['String']>;
+  /**
+   * This data item is a pointer to _atom_site.ndb_alias_strand_id the
+   *  ATOM_SITE category.
+   */
+  readonly pdbx_alt_id?: Maybe<Scalars['String']>;
+  /**
+   * This data item gives the order of the structural elements in the
+   *  ATOM_SITE category.
+   */
+  readonly pdbx_order?: Maybe<Scalars['Int']>;
+  /**
+   * This data item describes the general type of the structural elements
+   *  in the ATOM_SITE category.
+   *
+   * Allowable values:
+   * ATOMN, ATOMP, ATOMS, HETAC, HETAD, HETAI, HETAIN, HETAS, HETIC
+   *
+   */
+  readonly pdbx_type?: Maybe<Scalars['String']>;
+};
+
 export type StructKeywords = {
   /**
    * Terms characterizing the macromolecular structure.

+ 3 - 3
src/mol-canvas3d/passes/draw.ts

@@ -150,7 +150,7 @@ export class DrawPass {
                 }
             }
 
-            this.postprocessing.render(camera, false, transparentBackground, renderer.props.backgroundColor, postprocessingProps);
+            this.postprocessing.render(camera, false, transparentBackground, renderer.props.backgroundColor, postprocessingProps, renderer.light);
         }
 
         this.depthTextureOpaque.detachFramebuffer(this.colorTarget.framebuffer, 'depth');
@@ -204,7 +204,7 @@ export class DrawPass {
                 }
             }
 
-            this.postprocessing.render(camera, false, transparentBackground, renderer.props.backgroundColor, postprocessingProps);
+            this.postprocessing.render(camera, false, transparentBackground, renderer.props.backgroundColor, postprocessingProps, renderer.light);
         }
 
         // render transparent primitives and volumes
@@ -268,7 +268,7 @@ export class DrawPass {
                     }
                 }
 
-                this.postprocessing.render(camera, false, transparentBackground, renderer.props.backgroundColor, postprocessingProps);
+                this.postprocessing.render(camera, false, transparentBackground, renderer.props.backgroundColor, postprocessingProps, renderer.light);
 
                 if (!this.packedDepth) {
                     this.depthTextureOpaque.attachFramebuffer(this.postprocessing.target.framebuffer, 'depth');

+ 140 - 8
src/mol-canvas3d/passes/postprocessing.ts

@@ -3,6 +3,7 @@
  *
  * @author Alexander Rose <alexander.rose@weirdbyte.de>
  * @author Áron Samuel Kovács <aron.kovacs@mail.muni.cz>
+ * @author Ludovic Autin <ludovic.autin@gmail.com>
  */
 
 import { CopyRenderable, createCopyRenderable, QuadSchema, QuadValues } from '../../mol-gl/compute/util';
@@ -30,6 +31,8 @@ import { SmaaParams, SmaaPass } from './smaa';
 import { isTimingMode } from '../../mol-util/debug';
 import { BackgroundParams, BackgroundPass } from './background';
 import { AssetManager } from '../../mol-util/assets';
+import { Light } from '../../mol-gl/renderer';
+import { shadows_frag } from '../../mol-gl/shader/shadows.frag';
 
 const OutlinesSchema = {
     ...QuadSchema,
@@ -69,6 +72,64 @@ function getOutlinesRenderable(ctx: WebGLContext, depthTextureOpaque: Texture, d
     return createComputeRenderable(renderItem, values);
 }
 
+const ShadowsSchema = {
+    ...QuadSchema,
+    tDepth: TextureSpec('texture', 'rgba', 'ubyte', 'nearest'),
+    uTexSize: UniformSpec('v2'),
+
+    uProjection: UniformSpec('m4'),
+    uInvProjection: UniformSpec('m4'),
+    uBounds: UniformSpec('v4'),
+
+    dOrthographic: DefineSpec('number'),
+    uNear: UniformSpec('f'),
+    uFar: UniformSpec('f'),
+
+    dSteps: DefineSpec('number'),
+    uMaxDistance: UniformSpec('f'),
+    uTolerance: UniformSpec('f'),
+    uBias: UniformSpec('f'),
+
+    uLightDirection: UniformSpec('v3[]'),
+    uLightColor: UniformSpec('v3[]'),
+    dLightCount: DefineSpec('number'),
+};
+type ShadowsRenderable = ComputeRenderable<Values<typeof ShadowsSchema>>
+
+function getShadowsRenderable(ctx: WebGLContext, depthTexture: Texture): ShadowsRenderable {
+    const width = depthTexture.getWidth();
+    const height = depthTexture.getHeight();
+
+    const values: Values<typeof ShadowsSchema> = {
+        ...QuadValues,
+        tDepth: ValueCell.create(depthTexture),
+        uTexSize: ValueCell.create(Vec2.create(width, height)),
+
+        uProjection: ValueCell.create(Mat4.identity()),
+        uInvProjection: ValueCell.create(Mat4.identity()),
+        uBounds: ValueCell.create(Vec4()),
+
+        dOrthographic: ValueCell.create(0),
+        uNear: ValueCell.create(1),
+        uFar: ValueCell.create(10000),
+
+        dSteps: ValueCell.create(1),
+        uMaxDistance: ValueCell.create(3.0),
+        uTolerance: ValueCell.create(1.0),
+        uBias: ValueCell.create(0.6),
+
+        uLightDirection: ValueCell.create([]),
+        uLightColor: ValueCell.create([]),
+        dLightCount: ValueCell.create(0),
+    };
+
+    const schema = { ...ShadowsSchema };
+    const shaderCode = ShaderCode('shadows', quad_vert, shadows_frag);
+    const renderItem = createComputeRenderItem(ctx, 'triangles', shaderCode, schema, values);
+
+    return createComputeRenderable(renderItem, values);
+}
+
 const SsaoSchema = {
     ...QuadSchema,
     tDepth: TextureSpec('texture', 'rgba', 'ubyte', 'nearest'),
@@ -204,6 +265,7 @@ const PostprocessingSchema = {
     tColor: TextureSpec('texture', 'rgba', 'ubyte', 'nearest'),
     tDepthOpaque: TextureSpec('texture', 'rgba', 'ubyte', 'nearest'),
     tDepthTransparent: TextureSpec('texture', 'rgba', 'ubyte', 'nearest'),
+    tShadows: TextureSpec('texture', 'rgba', 'ubyte', 'nearest'),
     tOutlines: TextureSpec('texture', 'rgba', 'ubyte', 'nearest'),
     uTexSize: UniformSpec('v2'),
 
@@ -221,19 +283,22 @@ const PostprocessingSchema = {
     dOcclusionEnable: DefineSpec('boolean'),
     uOcclusionOffset: UniformSpec('v2'),
 
+    dShadowEnable: DefineSpec('boolean'),
+
     dOutlineEnable: DefineSpec('boolean'),
     dOutlineScale: DefineSpec('number'),
     uOutlineThreshold: UniformSpec('f'),
 };
 type PostprocessingRenderable = ComputeRenderable<Values<typeof PostprocessingSchema>>
 
-function getPostprocessingRenderable(ctx: WebGLContext, colorTexture: Texture, depthTextureOpaque: Texture, depthTextureTransparent: Texture, outlinesTexture: Texture, ssaoDepthTexture: Texture): PostprocessingRenderable {
+function getPostprocessingRenderable(ctx: WebGLContext, colorTexture: Texture, depthTextureOpaque: Texture, depthTextureTransparent: Texture, shadowsTexture: Texture, outlinesTexture: Texture, ssaoDepthTexture: Texture): PostprocessingRenderable {
     const values: Values<typeof PostprocessingSchema> = {
         ...QuadValues,
         tSsaoDepth: ValueCell.create(ssaoDepthTexture),
         tColor: ValueCell.create(colorTexture),
         tDepthOpaque: ValueCell.create(depthTextureOpaque),
         tDepthTransparent: ValueCell.create(depthTextureTransparent),
+        tShadows: ValueCell.create(shadowsTexture),
         tOutlines: ValueCell.create(outlinesTexture),
         uTexSize: ValueCell.create(Vec2.create(colorTexture.getWidth(), colorTexture.getHeight())),
 
@@ -251,6 +316,8 @@ function getPostprocessingRenderable(ctx: WebGLContext, colorTexture: Texture, d
         dOcclusionEnable: ValueCell.create(true),
         uOcclusionOffset: ValueCell.create(Vec2.create(0, 0)),
 
+        dShadowEnable: ValueCell.create(false),
+
         dOutlineEnable: ValueCell.create(false),
         dOutlineScale: ValueCell.create(1),
         uOutlineThreshold: ValueCell.create(0.33),
@@ -274,6 +341,15 @@ export const PostprocessingParams = {
         }),
         off: PD.Group({})
     }, { cycle: true, description: 'Darken occluded crevices with the ambient occlusion effect' }),
+    shadow: PD.MappedStatic('off', {
+        on: PD.Group({
+            steps: PD.Numeric(1, { min: 1, max: 64, step: 1 }),
+            bias: PD.Numeric(0.6, { min: 0.0, max: 1.0, step: 0.01 }),
+            maxDistance: PD.Numeric(3, { min: 0, max: 256, step: 1 }),
+            tolerance: PD.Numeric(1.0, { min: 0.0, max: 10.0, step: 0.1 }),
+        }),
+        off: PD.Group({})
+    }, { cycle: true, description: 'Simplistic shadows' }),
     outline: PD.MappedStatic('off', {
         on: PD.Group({
             scale: PD.Numeric(1, { min: 1, max: 5, step: 1 }),
@@ -289,11 +365,12 @@ export const PostprocessingParams = {
     }, { options: [['fxaa', 'FXAA'], ['smaa', 'SMAA'], ['off', 'Off']], description: 'Smooth pixel edges' }),
     background: PD.Group(BackgroundParams, { isFlat: true }),
 };
+
 export type PostprocessingProps = PD.Values<typeof PostprocessingParams>
 
 export class PostprocessingPass {
     static isEnabled(props: PostprocessingProps) {
-        return props.occlusion.name === 'on' || props.outline.name === 'on' || props.background.variant.name !== 'off';
+        return props.occlusion.name === 'on' || props.shadow.name === 'on' || props.outline.name === 'on' || props.background.variant.name !== 'off';
     }
 
     static isOutlineEnabled(props: PostprocessingProps) {
@@ -305,6 +382,9 @@ export class PostprocessingPass {
     private readonly outlinesTarget: RenderTarget;
     private readonly outlinesRenderable: OutlinesRenderable;
 
+    private readonly shadowsTarget: RenderTarget;
+    private readonly shadowsRenderable: ShadowsRenderable;
+
     private readonly ssaoFramebuffer: Framebuffer;
     private readonly ssaoBlurFirstPassFramebuffer: Framebuffer;
     private readonly ssaoBlurSecondPassFramebuffer: Framebuffer;
@@ -350,6 +430,9 @@ export class PostprocessingPass {
         this.outlinesTarget = webgl.createRenderTarget(width, height, false);
         this.outlinesRenderable = getOutlinesRenderable(webgl, depthTextureOpaque, depthTextureTransparent);
 
+        this.shadowsTarget = webgl.createRenderTarget(width, height, false);
+        this.shadowsRenderable = getShadowsRenderable(webgl, depthTextureOpaque);
+
         this.ssaoFramebuffer = webgl.resources.framebuffer();
         this.ssaoBlurFirstPassFramebuffer = webgl.resources.framebuffer();
         this.ssaoBlurSecondPassFramebuffer = webgl.resources.framebuffer();
@@ -373,7 +456,7 @@ export class PostprocessingPass {
         this.ssaoRenderable = getSsaoRenderable(webgl, this.downsampleFactor === 1 ? depthTextureOpaque : this.downsampledDepthTarget.texture);
         this.ssaoBlurFirstPassRenderable = getSsaoBlurRenderable(webgl, this.ssaoDepthTexture, 'horizontal');
         this.ssaoBlurSecondPassRenderable = getSsaoBlurRenderable(webgl, this.ssaoDepthBlurProxyTexture, 'vertical');
-        this.renderable = getPostprocessingRenderable(webgl, colorTarget.texture, depthTextureOpaque, depthTextureTransparent, this.outlinesTarget.texture, this.ssaoDepthTexture);
+        this.renderable = getPostprocessingRenderable(webgl, colorTarget.texture, depthTextureOpaque, depthTextureTransparent, this.shadowsTarget.texture, this.outlinesTarget.texture, this.ssaoDepthTexture);
 
         this.background = new BackgroundPass(webgl, assetManager, width, height);
     }
@@ -389,12 +472,14 @@ export class PostprocessingPass {
             const sh = Math.floor(height * this.ssaoScale);
             this.target.setSize(width, height);
             this.outlinesTarget.setSize(width, height);
+            this.shadowsTarget.setSize(width, height);
             this.downsampledDepthTarget.setSize(sw, sh);
             this.ssaoDepthTexture.define(sw, sh);
             this.ssaoDepthBlurProxyTexture.define(sw, sh);
 
             ValueCell.update(this.renderable.values.uTexSize, Vec2.set(this.renderable.values.uTexSize.ref.value, width, height));
             ValueCell.update(this.outlinesRenderable.values.uTexSize, Vec2.set(this.outlinesRenderable.values.uTexSize.ref.value, width, height));
+            ValueCell.update(this.shadowsRenderable.values.uTexSize, Vec2.set(this.shadowsRenderable.values.uTexSize.ref.value, width, height));
             ValueCell.update(this.downsampleDepthRenderable.values.uTexSize, Vec2.set(this.downsampleDepthRenderable.values.uTexSize.ref.value, sw, sh));
             ValueCell.update(this.ssaoRenderable.values.uTexSize, Vec2.set(this.ssaoRenderable.values.uTexSize.ref.value, sw, sh));
             ValueCell.update(this.ssaoBlurFirstPassRenderable.values.uTexSize, Vec2.set(this.ssaoBlurFirstPassRenderable.values.uTexSize.ref.value, sw, sh));
@@ -404,25 +489,28 @@ export class PostprocessingPass {
         }
     }
 
-    private updateState(camera: ICamera, transparentBackground: boolean, backgroundColor: Color, props: PostprocessingProps) {
+    private updateState(camera: ICamera, transparentBackground: boolean, backgroundColor: Color, props: PostprocessingProps, light: Light) {
+        let needsUpdateShadows = false;
         let needsUpdateMain = false;
         let needsUpdateSsao = false;
         let needsUpdateSsaoBlur = false;
 
         const orthographic = camera.state.mode === 'orthographic' ? 1 : 0;
         const outlinesEnabled = props.outline.name === 'on';
+        const shadowsEnabled = props.shadow.name === 'on';
         const occlusionEnabled = props.occlusion.name === 'on';
 
         const invProjection = Mat4.identity();
         Mat4.invert(invProjection, camera.projection);
 
+        const [w, h] = this.renderable.values.uTexSize.ref.value;
+        const v = camera.viewport;
+
         if (props.occlusion.name === 'on') {
             ValueCell.update(this.ssaoRenderable.values.uProjection, camera.projection);
             ValueCell.update(this.ssaoRenderable.values.uInvProjection, invProjection);
 
-            const [w, h] = this.renderable.values.uTexSize.ref.value;
             const b = this.ssaoRenderable.values.uBounds;
-            const v = camera.viewport;
             const s = this.ssaoScale;
             Vec4.set(b.ref.value,
                 Math.floor(v.x * s) / (w * s),
@@ -494,6 +582,38 @@ export class PostprocessingPass {
             }
         }
 
+        if (props.shadow.name === 'on') {
+            ValueCell.update(this.shadowsRenderable.values.uProjection, camera.projection);
+            ValueCell.update(this.shadowsRenderable.values.uInvProjection, invProjection);
+
+            Vec4.set(this.shadowsRenderable.values.uBounds.ref.value,
+                v.x / w,
+                v.y / h,
+                (v.x + v.width) / w,
+                (v.y + v.height) / h
+            );
+            ValueCell.update(this.shadowsRenderable.values.uBounds, this.shadowsRenderable.values.uBounds.ref.value);
+
+            ValueCell.updateIfChanged(this.shadowsRenderable.values.uNear, camera.near);
+            ValueCell.updateIfChanged(this.shadowsRenderable.values.uFar, camera.far);
+            ValueCell.updateIfChanged(this.shadowsRenderable.values.dOrthographic, orthographic);
+
+            ValueCell.updateIfChanged(this.shadowsRenderable.values.uMaxDistance, props.shadow.params.maxDistance);
+            ValueCell.updateIfChanged(this.shadowsRenderable.values.uTolerance, props.shadow.params.tolerance);
+            ValueCell.updateIfChanged(this.shadowsRenderable.values.uBias, props.shadow.params.bias);
+            if (this.shadowsRenderable.values.dSteps.ref.value !== props.shadow.params.steps) {
+                ValueCell.update(this.shadowsRenderable.values.dSteps, props.shadow.params.steps);
+                needsUpdateShadows = true;
+            }
+
+            ValueCell.update(this.shadowsRenderable.values.uLightDirection, light.direction);
+            ValueCell.update(this.shadowsRenderable.values.uLightColor, light.color);
+            if (this.shadowsRenderable.values.dLightCount.ref.value !== light.count) {
+                ValueCell.update(this.shadowsRenderable.values.dLightCount, light.count);
+                needsUpdateShadows = true;
+            }
+        }
+
         if (props.outline.name === 'on') {
             let { threshold } = props.outline.params;
             // orthographic needs lower threshold
@@ -522,11 +642,18 @@ export class PostprocessingPass {
         ValueCell.updateIfChanged(this.renderable.values.uTransparentBackground, transparentBackground);
         if (this.renderable.values.dOrthographic.ref.value !== orthographic) { needsUpdateMain = true; }
         ValueCell.updateIfChanged(this.renderable.values.dOrthographic, orthographic);
+
         if (this.renderable.values.dOutlineEnable.ref.value !== outlinesEnabled) { needsUpdateMain = true; }
         ValueCell.updateIfChanged(this.renderable.values.dOutlineEnable, outlinesEnabled);
+        if (this.renderable.values.dShadowEnable.ref.value !== shadowsEnabled) { needsUpdateMain = true; }
+        ValueCell.updateIfChanged(this.renderable.values.dShadowEnable, shadowsEnabled);
         if (this.renderable.values.dOcclusionEnable.ref.value !== occlusionEnabled) { needsUpdateMain = true; }
         ValueCell.updateIfChanged(this.renderable.values.dOcclusionEnable, occlusionEnabled);
 
+        if (needsUpdateShadows) {
+            this.shadowsRenderable.update();
+        }
+
         if (needsUpdateSsao) {
             this.ssaoRenderable.update();
         }
@@ -564,15 +691,20 @@ export class PostprocessingPass {
         this.transparentBackground = value;
     }
 
-    render(camera: ICamera, toDrawingBuffer: boolean, transparentBackground: boolean, backgroundColor: Color, props: PostprocessingProps) {
+    render(camera: ICamera, toDrawingBuffer: boolean, transparentBackground: boolean, backgroundColor: Color, props: PostprocessingProps, light: Light) {
         if (isTimingMode) this.webgl.timer.mark('PostprocessingPass.render');
-        this.updateState(camera, transparentBackground, backgroundColor, props);
+        this.updateState(camera, transparentBackground, backgroundColor, props, light);
 
         if (props.outline.name === 'on') {
             this.outlinesTarget.bind();
             this.outlinesRenderable.render();
         }
 
+        if (props.shadow.name === 'on') {
+            this.shadowsTarget.bind();
+            this.shadowsRenderable.render();
+        }
+
         // don't render occlusion if offset is given,
         // which will reuse the existing occlusion
         if (props.occlusion.name === 'on' && this.occlusionOffset[0] === 0 && this.occlusionOffset[1] === 0) {

+ 41 - 4
src/mol-geo/geometry/texture-mesh/texture-mesh.ts

@@ -7,7 +7,7 @@
 import { ValueCell } from '../../../mol-util';
 import { Sphere3D } from '../../../mol-math/geometry';
 import { ParamDefinition as PD } from '../../../mol-util/param-definition';
-import { LocationIterator } from '../../../mol-geo/util/location-iterator';
+import { LocationIterator, PositionLocation } from '../../../mol-geo/util/location-iterator';
 import { TransformData } from '../transform-data';
 import { createColors } from '../color-data';
 import { createMarkers } from '../marker-data';
@@ -20,11 +20,12 @@ import { createEmptyTransparency } from '../transparency-data';
 import { TextureMeshValues } from '../../../mol-gl/renderable/texture-mesh';
 import { calculateTransformBoundingSphere } from '../../../mol-gl/renderable/util';
 import { createNullTexture, Texture } from '../../../mol-gl/webgl/texture';
-import { Vec2, Vec4 } from '../../../mol-math/linear-algebra';
+import { Vec2, Vec3, Vec4 } from '../../../mol-math/linear-algebra';
 import { createEmptyClipping } from '../clipping-data';
 import { NullLocation } from '../../../mol-model/location';
 import { createEmptySubstance } from '../substance-data';
 import { RenderableState } from '../../../mol-gl/renderable';
+import { WebGLContext } from '../../../mol-gl/webgl/context';
 
 export interface TextureMesh {
     readonly kind: 'texture-mesh',
@@ -43,7 +44,10 @@ export interface TextureMesh {
 
     readonly boundingSphere: Sphere3D
 
-    readonly meta: { [k: string]: unknown }
+    readonly meta: {
+        webgl?: WebGLContext
+        [k: string]: unknown
+    }
 }
 
 export namespace TextureMesh {
@@ -131,9 +135,42 @@ export namespace TextureMesh {
         updateBoundingSphere,
         createRenderableState,
         updateRenderableState,
-        createPositionIterator: () => LocationIterator(1, 1, 1, () => NullLocation)
+        createPositionIterator,
     };
 
+    const TextureMeshName = 'texture-mesh';
+
+    function createPositionIterator(textureMesh: TextureMesh, transform: TransformData): LocationIterator {
+        const webgl = textureMesh.meta.webgl;
+        if (!webgl) return LocationIterator(1, 1, 1, () => NullLocation);
+
+        if (!webgl.namedFramebuffers[TextureMeshName]) {
+            webgl.namedFramebuffers[TextureMeshName] = webgl.resources.framebuffer();
+        }
+        const framebuffer = webgl.namedFramebuffers[TextureMeshName];
+        const [width, height] = textureMesh.geoTextureDim.ref.value;
+        const vertices = new Float32Array(width * height * 4);
+        framebuffer.bind();
+        textureMesh.vertexTexture.ref.value.attachFramebuffer(framebuffer, 0);
+        webgl.readPixels(0, 0, width, height, vertices);
+
+        const groupCount = textureMesh.vertexCount;
+        const instanceCount = transform.instanceCount.ref.value;
+        const location = PositionLocation();
+        const p = location.position;
+        const v = vertices;
+        const m = transform.aTransform.ref.value;
+        const getLocation = (groupIndex: number, instanceIndex: number) => {
+            if (instanceIndex < 0) {
+                Vec3.fromArray(p, v, groupIndex * 4);
+            } else {
+                Vec3.transformMat4Offset(p, v, m, 0, groupIndex * 4, instanceIndex * 16);
+            }
+            return location;
+        };
+        return LocationIterator(groupCount, instanceCount, 1, getLocation);
+    }
+
     function createValues(textureMesh: TextureMesh, transform: TransformData, locationIt: LocationIterator, theme: Theme, props: PD.Values<Params>): TextureMeshValues {
         const { instanceCount, groupCount } = locationIt;
         const positionIt = Utils.createPositionIterator(textureMesh, transform);

+ 9 - 5
src/mol-gl/renderer.ts

@@ -54,6 +54,7 @@ export const enum MarkingType {
 interface Renderer {
     readonly stats: RendererStats
     readonly props: Readonly<RendererProps>
+    readonly light: Readonly<Light>
 
     clear: (toBackgroundColor: boolean, ignoreTransparentBackground?: boolean) => void
     clearDepth: (packed?: boolean) => void
@@ -103,13 +104,13 @@ export const RendererParams = {
     xrayEdgeFalloff: PD.Numeric(1, { min: 0.0, max: 3.0, step: 0.1 }),
 
     light: PD.ObjectList({
-        inclination: PD.Numeric(180, { min: 0, max: 180, step: 1 }),
-        azimuth: PD.Numeric(0, { min: 0, max: 360, step: 1 }),
+        inclination: PD.Numeric(150, { min: 0, max: 180, step: 1 }),
+        azimuth: PD.Numeric(320, { min: 0, max: 360, step: 1 }),
         color: PD.Color(Color.fromNormalizedRgb(1.0, 1.0, 1.0)),
         intensity: PD.Numeric(0.6, { min: 0.0, max: 1.0, step: 0.01 }),
     }, o => Color.toHexString(o.color), { defaultValue: [{
-        inclination: 180,
-        azimuth: 0,
+        inclination: 150,
+        azimuth: 320,
         color: Color.fromNormalizedRgb(1.0, 1.0, 1.0),
         intensity: 0.6
     }] }),
@@ -118,7 +119,7 @@ export const RendererParams = {
 };
 export type RendererProps = PD.Values<typeof RendererParams>
 
-type Light = {
+export type Light = {
     count: number
     direction: number[]
     color: number[]
@@ -827,6 +828,9 @@ namespace Renderer {
                     instancedDrawCount: stats.instancedDrawCount,
                 };
             },
+            get light(): Light {
+                return light;
+            },
             dispose: () => {
                 // TODO
             }

+ 3 - 3
src/mol-gl/shader/direct-volume.frag.ts

@@ -270,16 +270,16 @@ vec4 raymarch(vec3 startLoc, vec3 step, vec3 rayDir) {
         #elif defined(dColorType_groupInstance)
             material.rgb = readFromTexture(tColor, vInstance * float(uGroupCount) + group, uColorTexDim).rgb;
         #elif defined(dColorType_vertex)
-            material.rgb = texture3dFrom1dTrilinear(tColor, isoPos, uGridDim, uColorTexDim, 0.0).rgb;
+            material.rgb = texture3dFrom1dTrilinear(tColor, unitPos, uGridDim, uColorTexDim, 0.0).rgb;
         #elif defined(dColorType_vertexInstance)
-            material.rgb = texture3dFrom1dTrilinear(tColor, isoPos, uGridDim, uColorTexDim, vInstance * float(uVertexCount)).rgb;
+            material.rgb = texture3dFrom1dTrilinear(tColor, unitPos, uGridDim, uColorTexDim, vInstance * float(uVertexCount)).rgb;
         #endif
 
         #ifdef dOverpaint
             #if defined(dOverpaintType_groupInstance)
                 overpaint = readFromTexture(tOverpaint, vInstance * float(uGroupCount) + group, uOverpaintTexDim);
             #elif defined(dOverpaintType_vertexInstance)
-                overpaint = texture3dFrom1dTrilinear(tOverpaint, isoPos, uGridDim, uOverpaintTexDim, vInstance * float(uVertexCount));
+                overpaint = texture3dFrom1dTrilinear(tOverpaint, unitPos, uGridDim, uOverpaintTexDim, vInstance * float(uVertexCount));
             #endif
 
             material.rgb = mix(material.rgb, overpaint.rgb, overpaint.a);

+ 15 - 1
src/mol-gl/shader/postprocessing.frag.ts

@@ -14,6 +14,7 @@ uniform sampler2D tSsaoDepth;
 uniform sampler2D tColor;
 uniform sampler2D tDepthOpaque;
 uniform sampler2D tDepthTransparent;
+uniform sampler2D tShadows;
 uniform sampler2D tOutlines;
 uniform vec2 uTexSize;
 
@@ -120,7 +121,20 @@ void main(void) {
         }
     #endif
 
-    // outline needs to be handled after occlusion to keep them clean
+    #ifdef dShadowEnable
+        if (!isBackground(opaqueDepth)) {
+            viewDist = abs(getViewZ(opaqueDepth));
+            fogFactor = smoothstep(uFogNear, uFogFar, viewDist);
+            vec4 shadow = texture2D(tShadows, coords);
+            if (!uTransparentBackground) {
+                color.rgb = mix(mix(vec3(0), uFogColor, fogFactor), color.rgb, shadow.a);
+            } else {
+                color.rgb = mix(vec3(0) * (1.0 - fogFactor), color.rgb, shadow.a);
+            }
+        }
+    #endif
+
+    // outline needs to be handled after occlusion and shadow to keep them clean
     #ifdef dOutlineEnable
         float closestTexel;
         float outline = getOutline(coords, opaqueDepth, closestTexel);

+ 131 - 0
src/mol-gl/shader/shadows.frag.ts

@@ -0,0 +1,131 @@
+/**
+ * Copyright (c) 2022 mol* contributors, licensed under MIT, See LICENSE file for more info.
+ *
+ * @author Ludovic Autin <ludovic.autin@gmail.com>
+ * @author Alexander Rose <alexander.rose@weirdbyte.de>
+ */
+
+export const shadows_frag = `
+precision highp float;
+precision highp int;
+precision highp sampler2D;
+
+#include common
+
+uniform sampler2D tDepth;
+uniform vec2 uTexSize;
+uniform vec4 uBounds;
+
+uniform float uNear;
+uniform float uFar;
+
+#if dLightCount != 0
+    uniform vec3 uLightDirection[dLightCount];
+    uniform vec3 uLightColor[dLightCount];
+#endif
+
+uniform mat4 uProjection;
+uniform mat4 uInvProjection;
+
+uniform float uMaxDistance;
+uniform float uTolerance;
+uniform float uBias;
+
+bool isBackground(const in float depth) {
+    return depth == 1.0;
+}
+
+bool outsideBounds(const in vec2 p) {
+    return p.x < uBounds.x || p.y < uBounds.y || p.x > uBounds.z || p.y > uBounds.w;
+}
+
+float getViewZ(const in float depth) {
+    #if dOrthographic == 1
+        return orthographicDepthToViewZ(depth, uNear, uFar);
+    #else
+        return perspectiveDepthToViewZ(depth, uNear, uFar);
+    #endif
+}
+
+float getDepth(const in vec2 coords) {
+    #ifdef depthTextureSupport
+        return texture2D(tDepth, coords).r;
+    #else
+        return unpackRGBAToDepth(texture2D(tDepth, coords));
+    #endif
+}
+
+float screenFade(const in vec2 coords) {
+    vec2 c = (coords - uBounds.xy) / (uBounds.zw - uBounds.xy);
+    vec2 fade = max(12.0 * abs(c - 0.5) - 5.0, vec2(0.0));
+    return saturate(1.0 - dot(fade, fade));
+}
+
+// based on https://panoskarabelas.com/posts/screen_space_shadows/
+float screenSpaceShadow(const in vec3 position, const in vec3 lightDirection, const in float stepLength) {
+    // Ray position and direction (in view-space)
+    vec3 rayPos = position;
+    vec3 rayDir = -lightDirection;
+
+    // Compute ray step
+    vec3 rayStep = rayDir * stepLength;
+
+    // Ray march towards the light
+    float occlusion = 0.0;
+    vec4 rayCoords = vec4(0.0);
+    for (int i = 0; i < dSteps; ++i) {
+        // Step the ray
+        rayPos += rayStep;
+
+        rayCoords = uProjection * vec4(rayPos, 1.0);
+        rayCoords.xyz = (rayCoords.xyz / rayCoords.w) * 0.5 + 0.5;
+
+        if (outsideBounds(rayCoords.xy))
+            return 1.0;
+
+        // Compute the difference between the ray's and the camera's depth
+        float depth = getDepth(rayCoords.xy);
+        float viewZ = getViewZ(depth);
+        float zDelta = rayPos.z - viewZ;
+
+        if (zDelta < uTolerance) {
+            occlusion = 1.0;
+
+            // Fade out as we approach the edges of the screen
+            occlusion *= screenFade(rayCoords.xy);
+
+            break;
+        }
+    }
+
+    return 1.0 - (uBias * occlusion);
+}
+
+void main(void) {
+    vec2 invTexSize = 1.0 / uTexSize;
+    vec2 selfCoords = gl_FragCoord.xy * invTexSize;
+
+    float selfDepth = getDepth(selfCoords);
+
+    if (isBackground(selfDepth)) {
+        gl_FragColor = vec4(0.0);
+        return;
+    }
+
+    vec3 selfViewPos = screenSpaceToViewSpace(vec3(selfCoords, selfDepth), uInvProjection);
+    float stepLength = uMaxDistance / float(dSteps);
+
+    float o = 1.0;
+    #if dLightCount != 0
+        float sh[dLightCount];
+        #pragma unroll_loop_start
+        for (int i = 0; i < dLightCount; ++i) {
+            sh[i] = screenSpaceShadow(selfViewPos, uLightDirection[i], stepLength);
+            o = min(o, sh[i]);
+        }
+        #pragma unroll_loop_end
+    #endif
+
+    gl_FragColor = vec4(o);
+}
+`;

+ 1 - 1
src/mol-io/reader/cif/schema/bird.ts

@@ -1,7 +1,7 @@
 /**
  * Copyright (c) 2017-2022 mol* contributors, licensed under MIT, See LICENSE file for more info.
  *
- * Code-generated 'BIRD' schema file. Dictionary versions: mmCIF 5.362, IHM 1.17, MA 1.4.3.
+ * Code-generated 'BIRD' schema file. Dictionary versions: mmCIF 5.363, IHM 1.17, MA 1.4.3.
  *
  * @author molstar/ciftools package
  */

+ 1 - 1
src/mol-io/reader/cif/schema/ccd.ts

@@ -1,7 +1,7 @@
 /**
  * Copyright (c) 2017-2022 mol* contributors, licensed under MIT, See LICENSE file for more info.
  *
- * Code-generated 'CCD' schema file. Dictionary versions: mmCIF 5.362, IHM 1.17, MA 1.4.3.
+ * Code-generated 'CCD' schema file. Dictionary versions: mmCIF 5.363, IHM 1.17, MA 1.4.3.
  *
  * @author molstar/ciftools package
  */

+ 1 - 1
src/mol-io/reader/cif/schema/mmcif.ts

@@ -1,7 +1,7 @@
 /**
  * Copyright (c) 2017-2022 mol* contributors, licensed under MIT, See LICENSE file for more info.
  *
- * Code-generated 'mmCIF' schema file. Dictionary versions: mmCIF 5.362, IHM 1.17, MA 1.4.3.
+ * Code-generated 'mmCIF' schema file. Dictionary versions: mmCIF 5.363, IHM 1.17, MA 1.4.3.
  *
  * @author molstar/ciftools package
  */

+ 4 - 0
src/mol-model/structure/model/types.ts

@@ -285,6 +285,10 @@ export const AminoAcidNamesD = new Set([
 ]);
 export const AminoAcidNames = SetUtils.unionMany(AminoAcidNamesL, AminoAcidNamesD);
 
+export const CommonProteinCaps = new Set([
+    'NME', 'ACE'
+]);
+
 export const RnaBaseNames = new Set([
     'A', 'C', 'T', 'G', 'I', 'U',
     'N' // unknown RNA base from CCD

파일 크기가 너무 크기때문에 변경 상태를 표시하지 않습니다.
+ 0 - 0
src/mol-model/structure/model/types/saccharides.ts


+ 15 - 6
src/mol-plugin-state/helpers/structure-selection-query.ts

@@ -7,7 +7,7 @@
 
 import { CustomProperty } from '../../mol-model-props/common/custom-property';
 import { QueryContext, Structure, StructureQuery, StructureSelection, StructureProperties, StructureElement } from '../../mol-model/structure';
-import { BondType, NucleicBackboneAtoms, ProteinBackboneAtoms, SecondaryStructureType, AminoAcidNamesL, RnaBaseNames, DnaBaseNames, WaterNames, ElementSymbol, PolymerNames } from '../../mol-model/structure/model/types';
+import { BondType, NucleicBackboneAtoms, ProteinBackboneAtoms, SecondaryStructureType, AminoAcidNamesL, RnaBaseNames, DnaBaseNames, WaterNames, ElementSymbol, PolymerNames, CommonProteinCaps } from '../../mol-model/structure/model/types';
 import { PluginContext } from '../../mol-plugin/context';
 import { MolScriptBuilder as MS } from '../../mol-script/language/builder';
 import { Expression } from '../../mol-script/language/expression';
@@ -350,14 +350,23 @@ const ligand = StructureSelectionQuery('Ligand', MS.struct.modifier.union([
                 ])
             ]),
         ]),
-        by: MS.struct.modifier.union([
+        by: MS.struct.combinator.merge([
+            MS.struct.modifier.union([
+                MS.struct.generator.atomGroups({
+                    'entity-test': MS.core.rel.eq([MS.ammp('entityType'), 'polymer']),
+                    'chain-test': MS.core.rel.eq([MS.ammp('objectPrimitive'), 'atomistic']),
+                    'residue-test': MS.core.set.has([
+                        MS.set(...SetUtils.toArray(PolymerNames)), MS.ammp('label_comp_id')
+                    ])
+                }),
+            ]),
             MS.struct.generator.atomGroups({
-                'entity-test': MS.core.rel.eq([MS.ammp('entityType'), 'polymer']),
                 'chain-test': MS.core.rel.eq([MS.ammp('objectPrimitive'), 'atomistic']),
                 'residue-test': MS.core.set.has([
-                    MS.set(...SetUtils.toArray(PolymerNames)), MS.ammp('label_comp_id')
-                ])
-            })
+                    MS.set(...SetUtils.toArray(CommonProteinCaps)),
+                    MS.ammp('label_comp_id'),
+                ]),
+            }),
         ])
     })
 ]), { category: StructureSelectionCategory.Type });

+ 7 - 4
src/mol-plugin-ui/controls/parameters.tsx

@@ -18,7 +18,7 @@ import { getPrecision } from '../../mol-util/number';
 import { ParamDefinition as PD } from '../../mol-util/param-definition';
 import { ParamMapping } from '../../mol-util/param-mapping';
 import { camelCaseToWords } from '../../mol-util/string';
-import { PluginUIComponent } from '../base';
+import { PluginReactContext, PluginUIComponent } from '../base';
 import { PluginUIContext } from '../context';
 import { ActionMenu } from './action-menu';
 import { ColorOptions, ColorValueOption, CombinedColorControl } from './color';
@@ -505,10 +505,12 @@ export class ValueRefControl extends React.PureComponent<ParamProps<PD.ValueRef<
 
     toggle = () => this.setState({ showOptions: !this.state.showOptions });
 
-    items = memoizeLatest((param: PD.ValueRef) => ActionMenu.createItemsFromSelectOptions(param.getOptions()));
+    private get items() {
+        return ActionMenu.createItemsFromSelectOptions(this.props.param.getOptions(this.context));
+    }
 
     renderControl() {
-        const items = this.items(this.props.param);
+        const items = this.items;
         const current = this.props.value.ref ? ActionMenu.findItem(items, this.props.value.ref) : void 0;
         const label = current
             ? current.label
@@ -521,7 +523,7 @@ export class ValueRefControl extends React.PureComponent<ParamProps<PD.ValueRef<
     renderAddOn() {
         if (!this.state.showOptions) return null;
 
-        const items = this.items(this.props.param);
+        const items = this.items;
         const current = ActionMenu.findItem(items, this.props.value.ref);
 
         return <ActionMenu items={items} current={current} onSelect={this.onSelect} />;
@@ -539,6 +541,7 @@ export class ValueRefControl extends React.PureComponent<ParamProps<PD.ValueRef<
         });
     }
 }
+ValueRefControl.contextType = PluginReactContext;
 
 export class IntervalControl extends React.PureComponent<ParamProps<PD.Interval>, { isExpanded: boolean }> {
     state = { isExpanded: false };

+ 2 - 0
src/mol-plugin-ui/structure/quick-styles.tsx

@@ -62,6 +62,7 @@ export class QuickStyles extends PurePluginUIComponent {
                         name: 'on',
                         params: { bias: 0.8, blurKernelSize: 15, radius: 5, samples: 32, resolutionScale: 1 }
                     },
+                    shadow: { name: 'off', params: {} },
                 }
             });
         }
@@ -86,6 +87,7 @@ export class QuickStyles extends PurePluginUIComponent {
                             ? pp.occlusion.params
                             : { bias: 0.8, blurKernelSize: 15, radius: 5, samples: 32, resolutionScale: 1 }
                     },
+                    shadow: { name: 'off', params: {} },
                 }
             });
         }

+ 3 - 0
src/mol-plugin-ui/viewport/simple-settings.tsx

@@ -59,6 +59,7 @@ const SimpleSettingsParams = {
     }, { pivot: 'color' }),
     lighting: PD.Group({
         occlusion: Canvas3DParams.postprocessing.params.occlusion,
+        shadow: Canvas3DParams.postprocessing.params.shadow,
         outline: Canvas3DParams.postprocessing.params.outline,
         fog: Canvas3DParams.cameraFog,
     }, { isFlat: true }),
@@ -114,6 +115,7 @@ const SimpleSettingsMapping = ParamMapping({
             },
             lighting: {
                 occlusion: canvas.postprocessing.occlusion,
+                shadow: canvas.postprocessing.shadow,
                 outline: canvas.postprocessing.outline,
                 fog: canvas.cameraFog,
             },
@@ -129,6 +131,7 @@ const SimpleSettingsMapping = ParamMapping({
         canvas.transparentBackground = s.background.transparent;
         canvas.renderer.backgroundColor = s.background.color;
         canvas.postprocessing.occlusion = s.lighting.occlusion;
+        canvas.postprocessing.shadow = s.lighting.shadow;
         canvas.postprocessing.outline = s.lighting.outline;
         canvas.postprocessing.background = s.background.style;
         canvas.cameraFog = s.lighting.fog;

+ 4 - 4
src/mol-repr/representation.ts

@@ -140,7 +140,7 @@ export class RepresentationRegistry<D, S extends Representation.State> {
 //
 
 export { Representation };
-interface Representation<D, P extends PD.Params = {}, S extends Representation.State = Representation.State> {
+interface Representation<D, P extends PD.Params = PD.Params, S extends Representation.State = Representation.State> {
     readonly label: string
     readonly updated: Subject<number>
     /** Number of addressable groups in all visuals of the representation */
@@ -236,7 +236,7 @@ namespace Representation {
     }
     export const StateBuilder: StateBuilder<State> = { create: createState, update: updateState };
 
-    export type Any = Representation<any, any, any>
+    export type Any<P extends PD.Params = PD.Params, S extends State = State> = Representation<any, P, S>
     export const Empty: Any = {
         label: '', groupCount: 0, renderObjects: [], geometryVersion: -1, props: {}, params: {}, updated: new Subject(), state: createState(), theme: Theme.createEmpty(),
         createOrUpdate: () => Task.constant('', undefined),
@@ -248,7 +248,7 @@ namespace Representation {
         destroy: () => {}
     };
 
-    export type Def<D, P extends PD.Params = {}, S extends State = State> = { [k: string]: RepresentationFactory<D, P, S> }
+    export type Def<D, P extends PD.Params = PD.Params, S extends State = State> = { [k: string]: RepresentationFactory<D, P, S> }
 
     export class GeometryState {
         private curr = new Set<number>();
@@ -272,7 +272,7 @@ namespace Representation {
         }
     }
 
-    export function createMulti<D, P extends PD.Params = {}, S extends State = State>(label: string, ctx: RepresentationContext, getParams: RepresentationParamsGetter<D, P>, stateBuilder: StateBuilder<S>, reprDefs: Def<D, P>): Representation<D, P, S> {
+    export function createMulti<D, P extends PD.Params = PD.Params, S extends State = State>(label: string, ctx: RepresentationContext, getParams: RepresentationParamsGetter<D, P>, stateBuilder: StateBuilder<S>, reprDefs: Def<D, P>): Representation<D, P, S> {
         let version = 0;
         const updated = new Subject<number>();
         const geometryState = new GeometryState();

+ 4 - 3
src/mol-repr/structure/representation/molecular-surface.ts

@@ -1,13 +1,13 @@
 /**
- * Copyright (c) 2018-2019 mol* contributors, licensed under MIT, See LICENSE file for more info.
+ * Copyright (c) 2018-2022 mol* contributors, licensed under MIT, See LICENSE file for more info.
  *
  * @author Alexander Rose <alexander.rose@weirdbyte.de>
  */
 
-import { MolecularSurfaceMeshVisual, MolecularSurfaceMeshParams } from '../visual/molecular-surface-mesh';
+import { MolecularSurfaceMeshVisual, MolecularSurfaceMeshParams, StructureMolecularSurfaceMeshVisual } from '../visual/molecular-surface-mesh';
 import { UnitsRepresentation } from '../units-representation';
 import { ParamDefinition as PD } from '../../../mol-util/param-definition';
-import { StructureRepresentation, StructureRepresentationProvider, StructureRepresentationStateBuilder } from '../representation';
+import { ComplexRepresentation, StructureRepresentation, StructureRepresentationProvider, StructureRepresentationStateBuilder } from '../representation';
 import { Representation, RepresentationParamsGetter, RepresentationContext } from '../../../mol-repr/representation';
 import { ThemeRegistryContext } from '../../../mol-theme/theme';
 import { Structure } from '../../../mol-model/structure';
@@ -16,6 +16,7 @@ import { BaseGeometry } from '../../../mol-geo/geometry/base';
 
 const MolecularSurfaceVisuals = {
     'molecular-surface-mesh': (ctx: RepresentationContext, getParams: RepresentationParamsGetter<Structure, MolecularSurfaceMeshParams>) => UnitsRepresentation('Molecular surface mesh', ctx, getParams, MolecularSurfaceMeshVisual),
+    'structure-molecular-surface-mesh': (ctx: RepresentationContext, getParams: RepresentationParamsGetter<Structure, MolecularSurfaceMeshParams>) => ComplexRepresentation('Structure Molecular surface mesh', ctx, getParams, StructureMolecularSurfaceMeshVisual),
     'molecular-surface-wireframe': (ctx: RepresentationContext, getParams: RepresentationParamsGetter<Structure, MolecularSurfaceWireframeParams>) => UnitsRepresentation('Molecular surface wireframe', ctx, getParams, MolecularSurfaceWireframeVisual),
 };
 

+ 2 - 0
src/mol-repr/structure/visual/gaussian-surface-mesh.ts

@@ -247,6 +247,7 @@ async function createGaussianSurfaceTextureMesh(ctx: VisualContext, unit: Unit,
     const boundingSphere = Sphere3D.expand(Sphere3D(), unit.boundary.sphere, densityTextureData.maxRadius);
     const surface = TextureMesh.create(gv.vertexCount, groupCount, gv.vertexTexture, gv.groupTexture, gv.normalTexture, boundingSphere, textureMesh);
     (surface.meta as GaussianSurfaceMeta).resolution = densityTextureData.resolution;
+    surface.meta.webgl = ctx.webgl;
 
     return surface;
 }
@@ -321,6 +322,7 @@ async function createStructureGaussianSurfaceTextureMesh(ctx: VisualContext, str
     const boundingSphere = Sphere3D.expand(Sphere3D(), structure.boundary.sphere, densityTextureData.maxRadius);
     const surface = TextureMesh.create(gv.vertexCount, groupCount, gv.vertexTexture, gv.groupTexture, gv.normalTexture, boundingSphere, textureMesh);
     (surface.meta as GaussianSurfaceMeta).resolution = densityTextureData.resolution;
+    surface.meta.webgl = ctx.webgl;
 
     return surface;
 }

+ 71 - 2
src/mol-repr/structure/visual/molecular-surface-mesh.ts

@@ -11,9 +11,9 @@ import { VisualContext } from '../../visual';
 import { Unit, Structure } from '../../../mol-model/structure';
 import { Theme } from '../../../mol-theme/theme';
 import { Mesh } from '../../../mol-geo/geometry/mesh/mesh';
-import { computeUnitMolecularSurface } from './util/molecular-surface';
+import { computeStructureMolecularSurface, computeUnitMolecularSurface } from './util/molecular-surface';
 import { computeMarchingCubesMesh } from '../../../mol-geo/util/marching-cubes/algorithm';
-import { ElementIterator, getElementLoci, eachElement } from './util/element';
+import { ElementIterator, getElementLoci, eachElement, getSerialElementLoci, eachSerialElement } from './util/element';
 import { VisualUpdateState } from '../../util';
 import { CommonSurfaceParams } from './util/common';
 import { Sphere3D } from '../../../mol-math/geometry';
@@ -23,6 +23,7 @@ import { WebGLContext } from '../../../mol-gl/webgl/context';
 import { applyMeshColorSmoothing } from '../../../mol-geo/geometry/mesh/color-smoothing';
 import { ColorSmoothingParams, getColorSmoothingProps } from '../../../mol-geo/geometry/base';
 import { ValueCell } from '../../../mol-util';
+import { ComplexMeshVisual, ComplexVisual } from '../complex-visual';
 
 export const MolecularSurfaceMeshParams = {
     ...UnitsMeshParams,
@@ -104,4 +105,72 @@ export function MolecularSurfaceMeshVisual(materialId: number): UnitsVisual<Mole
             (geometry.meta as MolecularSurfaceMeta).colorTexture?.destroy();
         }
     }, materialId);
+}
+
+//
+
+async function createStructureMolecularSurfaceMesh(ctx: VisualContext, structure: Structure, theme: Theme, props: MolecularSurfaceMeshProps, mesh?: Mesh): Promise<Mesh> {
+    const { transform, field, idField, resolution, maxRadius } = await computeStructureMolecularSurface(structure, theme.size, props).runInContext(ctx.runtime);
+
+    const params = {
+        isoLevel: props.probeRadius,
+        scalarField: field,
+        idField
+    };
+    const surface = await computeMarchingCubesMesh(params, mesh).runAsChild(ctx.runtime);
+
+    if (props.includeParent) {
+        const iterations = Math.ceil(2 / props.resolution);
+        Mesh.smoothEdges(surface, { iterations, maxNewEdgeLength: Math.sqrt(2) });
+    }
+
+    Mesh.transform(surface, transform);
+    if (ctx.webgl && !ctx.webgl.isWebGL2) {
+        Mesh.uniformTriangleGroup(surface);
+        ValueCell.updateIfChanged(surface.varyingGroup, false);
+    } else {
+        ValueCell.updateIfChanged(surface.varyingGroup, true);
+    }
+
+    const sphere = Sphere3D.expand(Sphere3D(), structure.boundary.sphere, maxRadius);
+    surface.setBoundingSphere(sphere);
+    (surface.meta as MolecularSurfaceMeta).resolution = resolution;
+
+    return surface;
+}
+
+export function StructureMolecularSurfaceMeshVisual(materialId: number): ComplexVisual<MolecularSurfaceMeshParams> {
+    return ComplexMeshVisual<MolecularSurfaceMeshParams>({
+        defaultProps: PD.getDefaultValues(MolecularSurfaceMeshParams),
+        createGeometry: createStructureMolecularSurfaceMesh,
+        createLocationIterator: ElementIterator.fromStructure,
+        getLoci: getSerialElementLoci,
+        eachLocation: eachSerialElement,
+        setUpdateState: (state: VisualUpdateState, newProps: PD.Values<MolecularSurfaceMeshParams>, currentProps: PD.Values<MolecularSurfaceMeshParams>) => {
+            if (newProps.resolution !== currentProps.resolution) state.createGeometry = true;
+            if (newProps.probeRadius !== currentProps.probeRadius) state.createGeometry = true;
+            if (newProps.probePositions !== currentProps.probePositions) state.createGeometry = true;
+            if (newProps.ignoreHydrogens !== currentProps.ignoreHydrogens) state.createGeometry = true;
+            if (newProps.traceOnly !== currentProps.traceOnly) state.createGeometry = true;
+            if (newProps.includeParent !== currentProps.includeParent) state.createGeometry = true;
+
+            if (newProps.smoothColors.name !== currentProps.smoothColors.name) {
+                state.updateColor = true;
+            } else if (newProps.smoothColors.name === 'on' && currentProps.smoothColors.name === 'on') {
+                if (newProps.smoothColors.params.resolutionFactor !== currentProps.smoothColors.params.resolutionFactor) state.updateColor = true;
+                if (newProps.smoothColors.params.sampleStride !== currentProps.smoothColors.params.sampleStride) state.updateColor = true;
+            }
+        },
+        processValues: (values: MeshValues, geometry: Mesh, props: PD.Values<MolecularSurfaceMeshParams>, theme: Theme, webgl?: WebGLContext) => {
+            const { resolution, colorTexture } = geometry.meta as MolecularSurfaceMeta;
+            const csp = getColorSmoothingProps(props.smoothColors, theme.color.preferSmoothing, resolution);
+            if (csp) {
+                applyMeshColorSmoothing(values, csp.resolution, csp.stride, webgl, colorTexture);
+                (geometry.meta as MolecularSurfaceMeta).colorTexture = values.tColorGrid.ref.value;
+            }
+        },
+        dispose: (geometry: Mesh) => {
+            (geometry.meta as MolecularSurfaceMeta).colorTexture?.destroy();
+        }
+    }, materialId);
 }

+ 48 - 21
src/mol-repr/structure/visual/util/common.ts

@@ -151,7 +151,7 @@ function squaredDistance(x: number, y: number, z: number, center: Vec3) {
 }
 
 /** marks `indices` for filtering/ignoring in `id` when not in `elements` */
-function filterId(id: AssignableArrayLike<number>, elements: SortedArray, indices: SortedArray) {
+function filterUnitId(id: AssignableArrayLike<number>, elements: SortedArray, indices: SortedArray) {
     let start = 0;
     const end = elements.length;
     for (let i = 0, il = indices.length; i < il; ++i) {
@@ -168,24 +168,25 @@ function filterId(id: AssignableArrayLike<number>, elements: SortedArray, indice
 export function getUnitConformationAndRadius(structure: Structure, unit: Unit, sizeTheme: SizeTheme<any>, props: CommonSurfaceProps) {
     const { ignoreHydrogens, traceOnly, includeParent } = props;
     const rootUnit = includeParent ? structure.root.unitMap.get(unit.id) : unit;
+    const differentRoot = includeParent && rootUnit !== unit;
 
     const { x, y, z } = getConformation(rootUnit);
     const { elements } = rootUnit;
     const { center, radius: sphereRadius } = unit.boundary.sphere;
-    const extraRadius = (2 + 1.5) * 2; // TODO should be twice (the max vdW/sphere radius plus the probe radius)
+    const extraRadius = (4 + 1.5) * 2; // TODO should be twice (the max vdW/sphere radius plus the probe radius)
     const radiusSq = (sphereRadius + extraRadius) * (sphereRadius + extraRadius);
 
     let indices: SortedArray<ElementIndex>;
     let id: AssignableArrayLike<number>;
 
-    if (ignoreHydrogens || traceOnly || (includeParent && rootUnit !== unit)) {
-        const _indices = [];
-        const _id = [];
+    if (ignoreHydrogens || traceOnly || differentRoot) {
+        const _indices: number[] = [];
+        const _id: number[] = [];
         for (let i = 0, il = elements.length; i < il; ++i) {
             const eI = elements[i];
             if (ignoreHydrogens && isHydrogen(rootUnit, eI)) continue;
             if (traceOnly && !isTrace(rootUnit, eI)) continue;
-            if (includeParent && squaredDistance(x[eI], y[eI], z[eI], center) > radiusSq) continue;
+            if (differentRoot && squaredDistance(x[eI], y[eI], z[eI], center) > radiusSq) continue;
 
             _indices.push(eI);
             _id.push(i);
@@ -198,11 +199,11 @@ export function getUnitConformationAndRadius(structure: Structure, unit: Unit, s
     }
 
     if (includeParent && rootUnit !== unit) {
-        filterId(id, unit.elements, indices);
+        filterUnitId(id, unit.elements, indices);
     }
 
     const position = { indices, x, y, z, id };
-    const boundary = unit === rootUnit ? unit.boundary : getBoundary(position);
+    const boundary = differentRoot ? getBoundary(position) : unit.boundary;
 
     const l = StructureElement.Location.create(structure, rootUnit);
     const radius = (index: number) => {
@@ -213,25 +214,36 @@ export function getUnitConformationAndRadius(structure: Structure, unit: Unit, s
     return { position, boundary, radius };
 }
 
-export function getStructureConformationAndRadius(structure: Structure, sizeTheme: SizeTheme<any>, ignoreHydrogens: boolean, traceOnly: boolean) {
-    const l = StructureElement.Location.create(structure);
+export function getStructureConformationAndRadius(structure: Structure, sizeTheme: SizeTheme<any>, props: CommonSurfaceProps) {
+    const { ignoreHydrogens, traceOnly, includeParent } = props;
+    const differentRoot = includeParent && !!structure.parent;
+    const l = StructureElement.Location.create(structure.root);
+
+    const { center, radius: sphereRadius } = structure.boundary.sphere;
+    const extraRadius = (4 + 1.5) * 2; // TODO should be twice (the max vdW/sphere radius plus the probe radius)
+    const radiusSq = (sphereRadius + extraRadius) * (sphereRadius + extraRadius);
 
     let xs: ArrayLike<number>;
     let ys: ArrayLike<number>;
     let zs: ArrayLike<number>;
     let rs: ArrayLike<number>;
-    let id: ArrayLike<number>;
+    let id: AssignableArrayLike<number>;
+    let indices: OrderedSet<number>;
+
+    if (ignoreHydrogens || traceOnly || differentRoot) {
+        const { getSerialIndex } = structure.serialMapping;
+        const units = differentRoot ? structure.root.units : structure.units;
 
-    if (ignoreHydrogens || traceOnly) {
         const _xs: number[] = [];
         const _ys: number[] = [];
         const _zs: number[] = [];
         const _rs: number[] = [];
         const _id: number[] = [];
-        for (let i = 0, m = 0, il = structure.units.length; i < il; ++i) {
-            const unit = structure.units[i];
+        for (let i = 0, il = units.length; i < il; ++i) {
+            const unit = units[i];
             const { elements } = unit;
             const { x, y, z } = unit.conformation;
+            const childUnit = structure.unitMap.get(unit.id);
 
             l.unit = unit;
             for (let j = 0, jl = elements.length; j < jl; ++j) {
@@ -239,17 +251,30 @@ export function getStructureConformationAndRadius(structure: Structure, sizeThem
                 if (ignoreHydrogens && isHydrogen(unit, eI)) continue;
                 if (traceOnly && !isTrace(unit, eI)) continue;
 
-                _xs.push(x(eI));
-                _ys.push(y(eI));
-                _zs.push(z(eI));
+                const _x = x(eI), _y = y(eI), _z = z(eI);
+                if (differentRoot && squaredDistance(_x, _y, _z, center) > radiusSq) continue;
+
+                _xs.push(_x);
+                _ys.push(_y);
+                _zs.push(_z);
                 l.element = eI;
                 _rs.push(sizeTheme.size(l));
-                _id.push(m + j);
+
+                if (differentRoot) {
+                    const idx = childUnit ? SortedArray.indexOf(childUnit.elements, eI) : -1;
+                    if (idx === -1) {
+                        _id.push(-2); // mark for filtering/ignoring when not in `elements`
+                    } else {
+                        _id.push(getSerialIndex(childUnit, eI));
+                    }
+                } else {
+                    _id.push(getSerialIndex(unit, eI));
+                }
             }
-            m += elements.length;
         }
         xs = _xs, ys = _ys, zs = _zs, rs = _rs;
         id = _id;
+        indices = OrderedSet.ofRange(0, id.length);
     } else {
         const { elementCount } = structure;
         const _xs = new Float32Array(elementCount);
@@ -275,12 +300,14 @@ export function getStructureConformationAndRadius(structure: Structure, sizeThem
         }
         xs = _xs, ys = _ys, zs = _zs, rs = _rs;
         id = fillSerial(new Uint32Array(elementCount));
+        indices = OrderedSet.ofRange(0, id.length);
     }
 
-    const position = { indices: OrderedSet.ofRange(0, id.length), x: xs, y: ys, z: zs, id };
+    const position = { indices, x: xs, y: ys, z: zs, id };
+    const boundary = differentRoot ? getBoundary(position) : structure.boundary;
     const radius = (index: number) => rs[index];
 
-    return { position, radius };
+    return { position, boundary, radius };
 }
 
 const _H = AtomicNumbers['H'];

+ 18 - 23
src/mol-repr/structure/visual/util/gaussian.ts

@@ -1,5 +1,5 @@
 /**
- * Copyright (c) 2018-2021 mol* contributors, licensed under MIT, See LICENSE file for more info.
+ * Copyright (c) 2018-2022 mol* contributors, licensed under MIT, See LICENSE file for more info.
  *
  * @author Alexander Rose <alexander.rose@weirdbyte.de>
  */
@@ -34,56 +34,51 @@ export function getTextureMaxCells(webgl: WebGLContext, structure?: Structure) {
 //
 
 export function computeUnitGaussianDensity(structure: Structure, unit: Unit, sizeTheme: SizeTheme<any>, props: GaussianDensityProps) {
-    const { box } = unit.lookup3d.boundary;
-    const p = ensureReasonableResolution(box, props);
-    const { position, radius } = getUnitConformationAndRadius(structure, unit, sizeTheme, p);
+    const { position, boundary, radius } = getUnitConformationAndRadius(structure, unit, sizeTheme, props);
+    const p = ensureReasonableResolution(boundary.box, props);
     return Task.create('Gaussian Density', async ctx => {
-        return await GaussianDensityCPU(ctx, position, box, radius, p);
+        return await GaussianDensityCPU(ctx, position, boundary.box, radius, p);
     });
 }
 
 export function computeUnitGaussianDensityTexture(structure: Structure, unit: Unit, sizeTheme: SizeTheme<any>, props: GaussianDensityProps, webgl: WebGLContext, texture?: Texture) {
-    const { box } = unit.lookup3d.boundary;
-    const p = ensureReasonableResolution(box, props, getTextureMaxCells(webgl, structure));
-    const { position, radius } = getUnitConformationAndRadius(structure, unit, sizeTheme, p);
+    const { position, boundary, radius } = getUnitConformationAndRadius(structure, unit, sizeTheme, props);
+    const p = ensureReasonableResolution(boundary.box, props, getTextureMaxCells(webgl, structure));
     return Task.create('Gaussian Density', async ctx => {
-        return GaussianDensityTexture(webgl, position, box, radius, p, texture);
+        return GaussianDensityTexture(webgl, position, boundary.box, radius, p, texture);
     });
 }
 
 export function computeUnitGaussianDensityTexture2d(structure: Structure, unit: Unit, sizeTheme: SizeTheme<any>, powerOfTwo: boolean, props: GaussianDensityProps, webgl: WebGLContext, texture?: Texture) {
-    const { box } = unit.lookup3d.boundary;
-    const p = ensureReasonableResolution(box, props, getTextureMaxCells(webgl, structure));
-    const { position, radius } = getUnitConformationAndRadius(structure, unit, sizeTheme, p);
+    const { position, boundary, radius } = getUnitConformationAndRadius(structure, unit, sizeTheme, props);
+    const p = ensureReasonableResolution(boundary.box, props, getTextureMaxCells(webgl, structure));
     return Task.create('Gaussian Density', async ctx => {
-        return GaussianDensityTexture2d(webgl, position, box, radius, powerOfTwo, p, texture);
+        return GaussianDensityTexture2d(webgl, position, boundary.box, radius, powerOfTwo, p, texture);
     });
 }
 
 //
 
 export function computeStructureGaussianDensity(structure: Structure, sizeTheme: SizeTheme<any>, props: GaussianDensityProps) {
-    const { box } = structure.lookup3d.boundary;
-    const p = ensureReasonableResolution(box, props);
-    const { position, radius } = getStructureConformationAndRadius(structure, sizeTheme, props.ignoreHydrogens, props.traceOnly);
+    const { position, boundary, radius } = getStructureConformationAndRadius(structure, sizeTheme, props);
+    const p = ensureReasonableResolution(boundary.box, props);
     return Task.create('Gaussian Density', async ctx => {
-        return await GaussianDensityCPU(ctx, position, box, radius, p);
+        return await GaussianDensityCPU(ctx, position, boundary.box, radius, p);
     });
 }
 
 export function computeStructureGaussianDensityTexture(structure: Structure, sizeTheme: SizeTheme<any>, props: GaussianDensityProps, webgl: WebGLContext, texture?: Texture) {
-    const { box } = structure.lookup3d.boundary;
-    const p = ensureReasonableResolution(box, props, getTextureMaxCells(webgl));
-    const { position, radius } = getStructureConformationAndRadius(structure, sizeTheme, props.ignoreHydrogens, props.traceOnly);
+    const { position, boundary, radius } = getStructureConformationAndRadius(structure, sizeTheme, props);
+    const p = ensureReasonableResolution(boundary.box, props);
     return Task.create('Gaussian Density', async ctx => {
-        return GaussianDensityTexture(webgl, position, box, radius, p, texture);
+        return GaussianDensityTexture(webgl, position, boundary.box, radius, p, texture);
     });
 }
 
 export function computeStructureGaussianDensityTexture2d(structure: Structure, sizeTheme: SizeTheme<any>, powerOfTwo: boolean, props: GaussianDensityProps, webgl: WebGLContext, texture?: Texture) {
     const { box } = structure.lookup3d.boundary;
-    const p = ensureReasonableResolution(box, props, getTextureMaxCells(webgl));
-    const { position, radius } = getStructureConformationAndRadius(structure, sizeTheme, props.ignoreHydrogens, props.traceOnly);
+    const { position, boundary, radius } = getStructureConformationAndRadius(structure, sizeTheme, props);
+    const p = ensureReasonableResolution(boundary.box, props);
     return Task.create('Gaussian Density', async ctx => {
         return GaussianDensityTexture2d(webgl, position, box, radius, powerOfTwo, p, texture);
     });

+ 34 - 7
src/mol-repr/structure/visual/util/molecular-surface.ts

@@ -1,12 +1,12 @@
 /**
- * Copyright (c) 2019-2020 mol* contributors, licensed under MIT, See LICENSE file for more info.
+ * Copyright (c) 2019-2022 mol* contributors, licensed under MIT, See LICENSE file for more info.
  *
  * @author Alexander Rose <alexander.rose@weirdbyte.de>
  */
 
 import { Unit, Structure } from '../../../../mol-model/structure';
 import { Task, RuntimeContext } from '../../../../mol-task';
-import { getUnitConformationAndRadius, CommonSurfaceProps, ensureReasonableResolution } from './common';
+import { getUnitConformationAndRadius, CommonSurfaceProps, ensureReasonableResolution, getStructureConformationAndRadius } from './common';
 import { PositionData, DensityData, Box3D } from '../../../../mol-math/geometry';
 import { MolecularSurfaceCalculationProps, calcMolecularSurface } from '../../../../mol-math/geometry/molecular-surface';
 import { OrderedSet } from '../../../../mol-data/int';
@@ -15,7 +15,7 @@ import { SizeTheme } from '../../../../mol-theme/size';
 
 export type MolecularSurfaceProps = MolecularSurfaceCalculationProps & CommonSurfaceProps
 
-function getPositionDataAndMaxRadius(structure: Structure, unit: Unit, sizeTheme: SizeTheme<any>, props: MolecularSurfaceProps) {
+function getUnitPositionDataAndMaxRadius(structure: Structure, unit: Unit, sizeTheme: SizeTheme<any>, props: MolecularSurfaceProps) {
     const { probeRadius } = props;
     const { position, boundary, radius } = getUnitConformationAndRadius(structure, unit, sizeTheme, props);
     const { indices } = position;
@@ -34,11 +34,38 @@ function getPositionDataAndMaxRadius(structure: Structure, unit: Unit, sizeTheme
 }
 
 export function computeUnitMolecularSurface(structure: Structure, unit: Unit, sizeTheme: SizeTheme<any>, props: MolecularSurfaceProps) {
-    const { box } = unit.lookup3d.boundary;
-    const p = ensureReasonableResolution(box, props);
-    const { position, boundary, maxRadius } = getPositionDataAndMaxRadius(structure, unit, sizeTheme, p);
+    const { position, boundary, maxRadius } = getUnitPositionDataAndMaxRadius(structure, unit, sizeTheme, props);
+    const p = ensureReasonableResolution(boundary.box, props);
     return Task.create('Molecular Surface', async ctx => {
-        return await MolecularSurface(ctx, position, boundary, maxRadius, box, p);
+        return await MolecularSurface(ctx, position, boundary, maxRadius, boundary.box, p);
+    });
+}
+
+//
+
+function getStructurePositionDataAndMaxRadius(structure: Structure, sizeTheme: SizeTheme<any>, props: MolecularSurfaceProps) {
+    const { probeRadius } = props;
+    const { position, boundary, radius } = getStructureConformationAndRadius(structure, sizeTheme, props);
+    const { indices } = position;
+    const n = OrderedSet.size(indices);
+    const radii = new Float32Array(OrderedSet.end(indices));
+
+    let maxRadius = 0;
+    for (let i = 0; i < n; ++i) {
+        const j = OrderedSet.getAt(indices, i);
+        const r = radius(j);
+        if (maxRadius < r) maxRadius = r;
+        radii[j] = r + probeRadius;
+    }
+
+    return { position: { ...position, radius: radii }, boundary, maxRadius };
+}
+
+export function computeStructureMolecularSurface(structure: Structure, sizeTheme: SizeTheme<any>, props: MolecularSurfaceProps) {
+    const { position, boundary, maxRadius } = getStructurePositionDataAndMaxRadius(structure, sizeTheme, props);
+    const p = ensureReasonableResolution(boundary.box, props);
+    return Task.create('Molecular Surface', async ctx => {
+        return await MolecularSurface(ctx, position, boundary, maxRadius, boundary.box, p);
     });
 }
 

+ 1 - 0
src/mol-repr/volume/isosurface.ts

@@ -201,6 +201,7 @@ async function createVolumeIsosurfaceTextureMesh(ctx: VisualContext, volume: Vol
 
     const groupCount = volume.grid.cells.data.length;
     const surface = TextureMesh.create(gv.vertexCount, groupCount, gv.vertexTexture, gv.groupTexture, gv.normalTexture, Volume.getBoundingSphere(volume), textureMesh);
+    surface.meta.webgl = ctx.webgl;
 
     return surface;
 }

+ 2 - 0
src/mol-theme/color.ts

@@ -40,6 +40,7 @@ import { VolumeValueColorThemeProvider } from './color/volume-value';
 import { Vec3, Vec4 } from '../mol-math/linear-algebra';
 import { ModelIndexColorThemeProvider } from './color/model-index';
 import { StructureIndexColorThemeProvider } from './color/structure-index';
+import { ExternalVolumeColorThemeProvider } from './color/external-volume';
 
 export type LocationColor = (location: Location, isSecondary: boolean) => Color
 
@@ -152,6 +153,7 @@ namespace ColorTheme {
         'unit-index': UnitIndexColorThemeProvider,
         'uniform': UniformColorThemeProvider,
         'volume-value': VolumeValueColorThemeProvider,
+        'external-volume': ExternalVolumeColorThemeProvider,
     };
     type _BuiltIn = typeof BuiltIn
     export type BuiltIn = keyof _BuiltIn

+ 159 - 0
src/mol-theme/color/external-volume.ts

@@ -0,0 +1,159 @@
+/**
+ * Copyright (c) 2022 mol* contributors, licensed under MIT, See LICENSE file for more info.
+ *
+ * @author David Sehnal <david.sehnal@gmail.com>
+ */
+
+import { Color, ColorScale } from '../../mol-util/color';
+import { Location } from '../../mol-model/location';
+import { ColorTheme } from '../color';
+import { ParamDefinition as PD } from '../../mol-util/param-definition';
+import { ThemeDataContext } from '../theme';
+import { Grid, Volume } from '../../mol-model/volume';
+import { type PluginContext } from '../../mol-plugin/context';
+import { isPositionLocation } from '../../mol-geo/util/location-iterator';
+import { Mat4, Vec3 } from '../../mol-math/linear-algebra';
+import { lerp } from '../../mol-math/interpolate';
+
+const Description = `Assigns a color based volume value at a given vertex.`;
+
+export const ExternalVolumeColorThemeParams = {
+    volume: PD.ValueRef<Volume>(
+        (ctx: PluginContext) => {
+            const volumes = ctx.state.data.selectQ(q => q.root.subtree().filter(c => Volume.is(c.obj?.data)));
+            return volumes.map(v => [v.transform.ref, v.obj?.label ?? '<unknown>'] as [string, string]);
+        },
+        (ref, getData) => getData(ref),
+    ),
+    coloring: PD.MappedStatic('absolute-value', {
+        'absolute-value': PD.Group({
+            domain: PD.MappedStatic('auto', {
+                custom: PD.Interval([-1, 1]),
+                auto: PD.Group({
+                    symmetric: PD.Boolean(false, { description: 'If true the automatic range is determined as [-|max|, |max|].' })
+                })
+            }),
+            list: PD.ColorList('red-white-blue', { presetKind: 'scale' })
+        }),
+        'relative-value': PD.Group({
+            domain: PD.MappedStatic('auto', {
+                custom: PD.Interval([-1, 1]),
+                auto: PD.Group({
+                    symmetric: PD.Boolean(false, { description: 'If true the automatic range is determined as [-|max|, |max|].' })
+                })
+            }),
+            list: PD.ColorList('red-white-blue', { presetKind: 'scale' })
+        })
+    }),
+    defaultColor: PD.Color(Color(0xcccccc)),
+};
+export type ExternalVolumeColorThemeParams = typeof ExternalVolumeColorThemeParams
+
+export function ExternalVolumeColorTheme(ctx: ThemeDataContext, props: PD.Values<ExternalVolumeColorThemeParams>): ColorTheme<ExternalVolumeColorThemeParams> {
+    let volume: Volume | undefined;
+    try {
+        volume = props.volume.getValue();
+    } catch {
+        // .getValue() is resolved during state reconciliation => would throw from UI
+    }
+
+    // NOTE: this will currently be slow for with GPU/texture meshes due to slow iteration
+    // TODO: create texture to be able to do the sampling on the GPU
+
+    let color;
+    if (volume) {
+        const coloring = props.coloring.params;
+        const { stats } = volume.grid;
+        const domain: [number, number] = coloring.domain.name === 'custom' ? coloring.domain.params : [stats.min, stats.max];
+
+        const isRelative = props.coloring.name === 'relative-value';
+        if (coloring.domain.name === 'auto' && isRelative) {
+            domain[0] = (domain[0] - stats.mean) / stats.sigma;
+            domain[1] = (domain[1] - stats.mean) / stats.sigma;
+        }
+
+        if (props.coloring.params.domain.name === 'auto' && props.coloring.params.domain.params.symmetric) {
+            const max = Math.max(Math.abs(domain[0]), Math.abs(domain[1]));
+            domain[0] = -max;
+            domain[1] = max;
+        }
+
+        const scale = ColorScale.create({ domain, listOrName: coloring.list.colors });
+
+        const cartnToGrid = Grid.getGridToCartesianTransform(volume.grid);
+        Mat4.invert(cartnToGrid, cartnToGrid);
+        const gridCoords = Vec3();
+
+        const { dimensions, get } = volume.grid.cells.space;
+        const data = volume.grid.cells.data;
+
+        const [mi, mj, mk] = dimensions;
+
+        color = (location: Location): Color => {
+            if (!isPositionLocation(location)) {
+                return props.defaultColor;
+            }
+
+            Vec3.copy(gridCoords, location.position);
+            Vec3.transformMat4(gridCoords, gridCoords, cartnToGrid);
+
+            const i = Math.floor(gridCoords[0]);
+            const j = Math.floor(gridCoords[1]);
+            const k = Math.floor(gridCoords[2]);
+
+            if (i < 0 || i >= mi || j < 0 || j >= mj || k < 0 || k >= mk) {
+                return props.defaultColor;
+            }
+
+            const u = gridCoords[0] - i;
+            const v = gridCoords[1] - j;
+            const w = gridCoords[2] - k;
+
+            // Tri-linear interpolation for the value
+            const ii = Math.min(i + 1, mi - 1);
+            const jj = Math.min(j + 1, mj - 1);
+            const kk = Math.min(k + 1, mk - 1);
+
+            let a = get(data, i, j, k);
+            let b = get(data, ii, j, k);
+            let c = get(data, i, jj, k);
+            let d = get(data, ii, jj, k);
+            const x = lerp(lerp(a, b, u), lerp(c, d, u), v);
+
+            a = get(data, i, j, kk);
+            b = get(data, ii, j, kk);
+            c = get(data, i, jj, kk);
+            d = get(data, ii, jj, kk);
+            const y = lerp(lerp(a, b, u), lerp(c, d, u), v);
+
+            let value = lerp(x, y, w);
+            if (isRelative) {
+                value = (value - stats.mean) / stats.sigma;
+            }
+
+            return scale.color(value);
+        };
+    } else {
+        color = () => props.defaultColor;
+    }
+
+    return {
+        factory: ExternalVolumeColorTheme,
+        granularity: 'vertex',
+        preferSmoothing: true,
+        color,
+        props,
+        description: Description,
+        // TODO: figure out how to do legend for this
+    };
+}
+
+export const ExternalVolumeColorThemeProvider: ColorTheme.Provider<ExternalVolumeColorThemeParams, 'external-volume'> = {
+    name: 'external-volume',
+    label: 'External Volume',
+    category: ColorTheme.Category.Misc,
+    factory: ExternalVolumeColorTheme,
+    getParams: () => ExternalVolumeColorThemeParams,
+    defaultValues: PD.getDefaultValues(ExternalVolumeColorThemeParams),
+    isApplicable: (ctx: ThemeDataContext) => true,
+};

+ 6 - 6
src/mol-util/param-definition.ts

@@ -290,9 +290,9 @@ export namespace ParamDefinition {
     // getValue needs to be assigned by a runtime because it might not be serializable
     export interface ValueRef<T = any> extends Base<{ ref: string, getValue: () => T }> {
         type: 'value-ref',
-        resolveRef: (ref: string) => T,
+        resolveRef: (ref: string, getData: (ref: string) => any) => T,
         // a provider because the list changes over time
-        getOptions: () => Select<string>['options'],
+        getOptions: (ctx: any) => Select<string>['options'],
     }
     export function ValueRef<T>(getOptions: ValueRef['getOptions'], resolveRef: ValueRef<T>['resolveRef'], info?: Info & { defaultRef?: string }) {
         return setInfo<ValueRef<T>>({ type: 'value-ref', defaultValue: { ref: info?.defaultRef ?? '', getValue: unsetGetValue as any }, getOptions, resolveRef }, info);
@@ -365,8 +365,8 @@ export namespace ParamDefinition {
         return d as Values<T>;
     }
 
-    function _resolveRef(resolve: (ref: string) => any, ref: string) {
-        return () => resolve(ref);
+    function _resolveRef(resolve: (ref: string, getData: (ref: string) => any) => any, ref: string, getData: (ref: string) => any) {
+        return () => resolve(ref, getData);
     }
 
     function resolveRefValue(p: Any, value: any, getData: (ref: string) => any) {
@@ -375,11 +375,11 @@ export namespace ParamDefinition {
         if (p.type === 'value-ref') {
             const v = value as ValueRef['defaultValue'];
             if (!v.ref) v.getValue = () => { throw new Error('Unset ref in ValueRef value.'); };
-            else v.getValue = _resolveRef(p.resolveRef, v.ref);
+            else v.getValue = _resolveRef(p.resolveRef, v.ref, getData);
         } else if (p.type === 'data-ref') {
             const v = value as ValueRef['defaultValue'];
             if (!v.ref) v.getValue = () => { throw new Error('Unset ref in ValueRef value.'); };
-            else v.getValue = _resolveRef(getData, v.ref);
+            else v.getValue = _resolveRef(getData, v.ref, getData);
         } else if (p.type === 'group') {
             resolveRefs(p.params, value, getData);
         } else if (p.type === 'mapped') {

이 변경점에서 너무 많은 파일들이 변경되어 몇몇 파일들은 표시되지 않았습니다.