Merge branch 'master' of https://github.com/molstar/molstar into export-extension

CHANGELOG.md

@@ -6,13 +6,32 @@ Note that since we don't clearly distinguish between a public and private interf
 
 ## [Unreleased]
 
-- Add PDBj as a pdb-provider option
 - Assembly handling tweaks:
     - Do not include suffix for "identity assembly operators"
     - Do not include assembly-related categories to export if the structure was composed from an assembly
     - Special case for ``structAsymMap`` if Mol* asym id operator mapping is present
 - Support for opening ZIP files with multiple entries
 - Add Model Export extension
+- Fix ``getOperatorsForIndex``
+- Pass animation info (current frame & count) to state animations
+    - Fix camera stutter for "camera spin" animation
+- Add partial charge parsing support for MOL/SDF files (thanks @ptourlas)
+- [Breaking] Cleaner looking ``MembraneOrientationVisuals`` defaults
+- Add support for custom colors to "molecule-type" theme
+- [Breaking] Add style parameter to "illustrative" color theme
+    - Defaults to "entity-id" style instead of "chain-id"
+- Add "illustrative" representation preset
+
+## [v3.0.0-dev.9] - 2022-01-09
+
+- Add PDBj as a ``pdb-provider`` option
+- Move Viewer APP to a separate file to allow use without importing light theme & index.html
+- Add symmetry support for mol2 files (only spacegroup setting 1)
+- Fix mol2 files element symbol assignment
+- Improve bond assignment from ``IndexPairBonds``
+    - Add ``key`` field for mapping to source data
+    - Fix assignment of bonds with unphysical length
+- Fix label/stats of single atom selection in multi-chain units
 
 ## [v3.0.0-dev.8] - 2021-12-31
 

package.json

@@ -1,6 +1,6 @@
 {
   "name": "molstar",
-  "version": "3.0.0-dev.8",
+  "version": "3.0.0-dev.9",
   "description": "A comprehensive macromolecular library.",
   "homepage": "https://github.com/molstar/molstar#readme",
   "repository": {
@@ -86,45 +86,46 @@
     "Áron Samuel Kovács <aron.kovacs@mail.muni.cz>",
     "Ludovic Autin <autin@scripps.edu>",
     "Michal Malý <michal.maly@ibt.cas.cz>",
-    "Jiří Černý <jiri.cerny@ibt.cas.cz>"
+    "Jiří Černý <jiri.cerny@ibt.cas.cz>",
+    "Panagiotis Tourlas <panagiot_tourlov@hotmail.com>"
   ],
   "license": "MIT",
   "devDependencies": {
-    "@graphql-codegen/add": "^3.1.0",
-    "@graphql-codegen/cli": "^2.3.0",
-    "@graphql-codegen/time": "^3.1.0",
-    "@graphql-codegen/typescript": "^2.4.1",
-    "@graphql-codegen/typescript-graphql-files-modules": "^2.1.0",
-    "@graphql-codegen/typescript-graphql-request": "^4.3.1",
-    "@graphql-codegen/typescript-operations": "^2.2.1",
+    "@graphql-codegen/add": "^3.1.1",
+    "@graphql-codegen/cli": "^2.3.1",
+    "@graphql-codegen/time": "^3.1.1",
+    "@graphql-codegen/typescript": "^2.4.2",
+    "@graphql-codegen/typescript-graphql-files-modules": "^2.1.1",
+    "@graphql-codegen/typescript-graphql-request": "^4.3.3",
+    "@graphql-codegen/typescript-operations": "^2.2.2",
     "@types/cors": "^2.8.12",
     "@types/gl": "^4.1.0",
-    "@types/jest": "^27.0.3",
-    "@typescript-eslint/eslint-plugin": "^5.5.0",
-    "@typescript-eslint/parser": "^5.5.0",
+    "@types/jest": "^27.4.0",
+    "@typescript-eslint/eslint-plugin": "^5.9.1",
+    "@typescript-eslint/parser": "^5.9.1",
     "benchmark": "^2.1.4",
-    "concurrently": "^6.4.0",
-    "cpx2": "^4.0.0",
+    "concurrently": "^7.0.0",
+    "cpx2": "^4.1.2",
     "crypto-browserify": "^3.12.0",
     "css-loader": "^6.5.1",
-    "eslint": "^8.3.0",
+    "eslint": "^8.7.0",
     "extra-watch-webpack-plugin": "^1.0.3",
     "file-loader": "^6.2.0",
     "fs-extra": "^10.0.0",
-    "graphql": "^15.7.2",
-    "http-server": "^14.0.0",
-    "jest": "^27.3.1",
-    "mini-css-extract-plugin": "^2.4.5",
+    "graphql": "^16.2.0",
+    "http-server": "^14.1.0",
+    "jest": "^27.4.7",
+    "mini-css-extract-plugin": "~2.4.7",
     "path-browserify": "^1.0.1",
     "raw-loader": "^4.0.2",
-    "sass": "^1.43.5",
-    "sass-loader": "^12.3.0",
-    "simple-git": "^2.47.0",
+    "sass": "^1.48.0",
+    "sass-loader": "^12.4.0",
+    "simple-git": "^2.48.0",
     "stream-browserify": "^3.0.0",
     "style-loader": "^3.3.1",
-    "ts-jest": "^27.0.7",
-    "typescript": "^4.5.2",
-    "webpack": "^5.64.4",
+    "ts-jest": "^27.1.3",
+    "typescript": "^4.5.4",
+    "webpack": "^5.66.0",
     "webpack-cli": "^4.9.1"
   },
   "dependencies": {
@@ -132,22 +133,22 @@
     "@types/benchmark": "^2.1.1",
     "@types/compression": "1.7.2",
     "@types/express": "^4.17.13",
-    "@types/node": "^16.11.10",
+    "@types/node": "^16.11.19",
     "@types/node-fetch": "^2.5.12",
-    "@types/react": "^17.0.37",
+    "@types/react": "^17.0.38",
     "@types/react-dom": "^17.0.11",
     "@types/swagger-ui-dist": "3.30.1",
     "argparse": "^2.0.1",
-    "body-parser": "^1.19.0",
+    "body-parser": "^1.19.1",
     "compression": "^1.7.4",
     "cors": "^2.8.5",
-    "express": "^4.17.1",
+    "express": "^4.17.2",
     "h264-mp4-encoder": "^1.0.12",
-    "immer": "^9.0.7",
+    "immer": "^9.0.12",
     "immutable": "^3.8.2",
     "node-fetch": "^2.6.2",
-    "rxjs": "^7.4.0",
-    "swagger-ui-dist": "^4.1.1",
+    "rxjs": "^7.5.2",
+    "swagger-ui-dist": "^4.1.3",
     "tslib": "^2.3.1",
     "util.promisify": "^1.1.1",
     "xhr2": "^0.2.1"
@@ -157,6 +158,6 @@
     "react-dom": "^17.0.2"
   },
   "optionalDependencies": {
-    "gl": "^4.9.2"
+    "gl": "^5.0.0"
   }
 }

src/apps/viewer/app.ts

@@ -0,0 +1,479 @@
+/**
+ * Copyright (c) 2018-2022 mol* contributors, licensed under MIT, See LICENSE file for more info.
+ *
+ * @author David Sehnal <david.sehnal@gmail.com>
+ * @author Alexander Rose <alexander.rose@weirdbyte.de>
+ */
+
+import { ANVILMembraneOrientation } from '../../extensions/anvil/behavior';
+import { CellPack } from '../../extensions/cellpack';
+import { DnatcoConfalPyramids } from '../../extensions/dnatco';
+import { G3DFormat, G3dProvider } from '../../extensions/g3d/format';
+import { GeometryExport } from '../../extensions/geo-export';
+import { MAQualityAssessment } from '../../extensions/model-archive/quality-assessment/behavior';
+import { QualityAssessmentPLDDTPreset, QualityAssessmentQmeanPreset } from '../../extensions/model-archive/quality-assessment/behavior';
+import { QualityAssessment } from '../../extensions/model-archive/quality-assessment/prop';
+import { Mp4Export } from '../../extensions/mp4-export';
+import { PDBeStructureQualityReport } from '../../extensions/pdbe';
+import { RCSBAssemblySymmetry, RCSBValidationReport } from '../../extensions/rcsb';
+import { DownloadStructure, PdbDownloadProvider } from '../../mol-plugin-state/actions/structure';
+import { DownloadDensity } from '../../mol-plugin-state/actions/volume';
+import { PresetTrajectoryHierarchy } from '../../mol-plugin-state/builder/structure/hierarchy-preset';
+import { PresetStructureRepresentations, StructureRepresentationPresetProvider } from '../../mol-plugin-state/builder/structure/representation-preset';
+import { DataFormatProvider } from '../../mol-plugin-state/formats/provider';
+import { BuildInStructureFormat } from '../../mol-plugin-state/formats/structure';
+import { BuiltInTrajectoryFormat } from '../../mol-plugin-state/formats/trajectory';
+import { BuildInVolumeFormat } from '../../mol-plugin-state/formats/volume';
+import { createVolumeRepresentationParams } from '../../mol-plugin-state/helpers/volume-representation-params';
+import { PluginStateObject } from '../../mol-plugin-state/objects';
+import { StateTransforms } from '../../mol-plugin-state/transforms';
+import { TrajectoryFromModelAndCoordinates } from '../../mol-plugin-state/transforms/model';
+import { createPluginUI } from '../../mol-plugin-ui';
+import { PluginUIContext } from '../../mol-plugin-ui/context';
+import { DefaultPluginUISpec, PluginUISpec } from '../../mol-plugin-ui/spec';
+import { PluginCommands } from '../../mol-plugin/commands';
+import { PluginConfig } from '../../mol-plugin/config';
+import { PluginLayoutControlsDisplay } from '../../mol-plugin/layout';
+import { PluginSpec } from '../../mol-plugin/spec';
+import { PluginState } from '../../mol-plugin/state';
+import { StateObjectRef, StateObjectSelector } from '../../mol-state';
+import { Asset } from '../../mol-util/assets';
+import { Color } from '../../mol-util/color';
+import '../../mol-util/polyfill';
+import { ObjectKeys } from '../../mol-util/type-helpers';
+
+export { PLUGIN_VERSION as version } from '../../mol-plugin/version';
+export { setDebugMode, setProductionMode } from '../../mol-util/debug';
+
+const CustomFormats = [
+    ['g3d', G3dProvider] as const
+];
+
+const Extensions = {
+    'cellpack': PluginSpec.Behavior(CellPack),
+    'dnatco-confal-pyramids': PluginSpec.Behavior(DnatcoConfalPyramids),
+    'pdbe-structure-quality-report': PluginSpec.Behavior(PDBeStructureQualityReport),
+    'rcsb-assembly-symmetry': PluginSpec.Behavior(RCSBAssemblySymmetry),
+    'rcsb-validation-report': PluginSpec.Behavior(RCSBValidationReport),
+    'anvil-membrane-orientation': PluginSpec.Behavior(ANVILMembraneOrientation),
+    'g3d': PluginSpec.Behavior(G3DFormat),
+    'mp4-export': PluginSpec.Behavior(Mp4Export),
+    'geo-export': PluginSpec.Behavior(GeometryExport),
+    'ma-quality-assessment': PluginSpec.Behavior(MAQualityAssessment),
+};
+
+const DefaultViewerOptions = {
+    customFormats: CustomFormats as [string, DataFormatProvider][],
+    extensions: ObjectKeys(Extensions),
+    layoutIsExpanded: true,
+    layoutShowControls: true,
+    layoutShowRemoteState: true,
+    layoutControlsDisplay: 'reactive' as PluginLayoutControlsDisplay,
+    layoutShowSequence: true,
+    layoutShowLog: true,
+    layoutShowLeftPanel: true,
+    collapseLeftPanel: false,
+    collapseRightPanel: false,
+    disableAntialiasing: PluginConfig.General.DisableAntialiasing.defaultValue,
+    pixelScale: PluginConfig.General.PixelScale.defaultValue,
+    pickScale: PluginConfig.General.PickScale.defaultValue,
+    pickPadding: PluginConfig.General.PickPadding.defaultValue,
+    enableWboit: PluginConfig.General.EnableWboit.defaultValue,
+    preferWebgl1: PluginConfig.General.PreferWebGl1.defaultValue,
+
+    viewportShowExpand: PluginConfig.Viewport.ShowExpand.defaultValue,
+    viewportShowControls: PluginConfig.Viewport.ShowControls.defaultValue,
+    viewportShowSettings: PluginConfig.Viewport.ShowSettings.defaultValue,
+    viewportShowSelectionMode: PluginConfig.Viewport.ShowSelectionMode.defaultValue,
+    viewportShowAnimation: PluginConfig.Viewport.ShowAnimation.defaultValue,
+    pluginStateServer: PluginConfig.State.DefaultServer.defaultValue,
+    volumeStreamingServer: PluginConfig.VolumeStreaming.DefaultServer.defaultValue,
+    volumeStreamingDisabled: !PluginConfig.VolumeStreaming.Enabled.defaultValue,
+    pdbProvider: PluginConfig.Download.DefaultPdbProvider.defaultValue,
+    emdbProvider: PluginConfig.Download.DefaultEmdbProvider.defaultValue,
+};
+type ViewerOptions = typeof DefaultViewerOptions;
+
+export class Viewer {
+    constructor(public plugin: PluginUIContext) {
+    }
+
+    static async create(elementOrId: string | HTMLElement, options: Partial<ViewerOptions> = {}) {
+        const o = { ...DefaultViewerOptions, ...options };
+        const defaultSpec = DefaultPluginUISpec();
+
+        const spec: PluginUISpec = {
+            actions: defaultSpec.actions,
+            behaviors: [
+                ...defaultSpec.behaviors,
+                ...o.extensions.map(e => Extensions[e]),
+            ],
+            animations: [...defaultSpec.animations || []],
+            customParamEditors: defaultSpec.customParamEditors,
+            customFormats: o?.customFormats,
+            layout: {
+                initial: {
+                    isExpanded: o.layoutIsExpanded,
+                    showControls: o.layoutShowControls,
+                    controlsDisplay: o.layoutControlsDisplay,
+                    regionState: {
+                        bottom: 'full',
+                        left: o.collapseLeftPanel ? 'collapsed' : 'full',
+                        right: o.collapseRightPanel ? 'hidden' : 'full',
+                        top: 'full',
+                    }
+                },
+            },
+            components: {
+                ...defaultSpec.components,
+                controls: {
+                    ...defaultSpec.components?.controls,
+                    top: o.layoutShowSequence ? undefined : 'none',
+                    bottom: o.layoutShowLog ? undefined : 'none',
+                    left: o.layoutShowLeftPanel ? undefined : 'none',
+                },
+                remoteState: o.layoutShowRemoteState ? 'default' : 'none',
+            },
+            config: [
+                [PluginConfig.General.DisableAntialiasing, o.disableAntialiasing],
+                [PluginConfig.General.PixelScale, o.pixelScale],
+                [PluginConfig.General.PickScale, o.pickScale],
+                [PluginConfig.General.PickPadding, o.pickPadding],
+                [PluginConfig.General.EnableWboit, o.enableWboit],
+                [PluginConfig.General.PreferWebGl1, o.preferWebgl1],
+                [PluginConfig.Viewport.ShowExpand, o.viewportShowExpand],
+                [PluginConfig.Viewport.ShowControls, o.viewportShowControls],
+                [PluginConfig.Viewport.ShowSettings, o.viewportShowSettings],
+                [PluginConfig.Viewport.ShowSelectionMode, o.viewportShowSelectionMode],
+                [PluginConfig.Viewport.ShowAnimation, o.viewportShowAnimation],
+                [PluginConfig.State.DefaultServer, o.pluginStateServer],
+                [PluginConfig.State.CurrentServer, o.pluginStateServer],
+                [PluginConfig.VolumeStreaming.DefaultServer, o.volumeStreamingServer],
+                [PluginConfig.VolumeStreaming.Enabled, !o.volumeStreamingDisabled],
+                [PluginConfig.Download.DefaultPdbProvider, o.pdbProvider],
+                [PluginConfig.Download.DefaultEmdbProvider, o.emdbProvider],
+                [PluginConfig.Structure.DefaultRepresentationPreset, ViewerAutoPreset.id],
+            ]
+        };
+
+        const element = typeof elementOrId === 'string'
+            ? document.getElementById(elementOrId)
+            : elementOrId;
+        if (!element) throw new Error(`Could not get element with id '${elementOrId}'`);
+        const plugin = await createPluginUI(element, spec, {
+            onBeforeUIRender: plugin => {
+                // the preset needs to be added before the UI renders otherwise
+                // "Download Structure" wont be able to pick it up
+                plugin.builders.structure.representation.registerPreset(ViewerAutoPreset);
+            }
+        });
+        return new Viewer(plugin);
+    }
+
+    setRemoteSnapshot(id: string) {
+        const url = `${this.plugin.config.get(PluginConfig.State.CurrentServer)}/get/${id}`;
+        return PluginCommands.State.Snapshots.Fetch(this.plugin, { url });
+    }
+
+    loadSnapshotFromUrl(url: string, type: PluginState.SnapshotType) {
+        return PluginCommands.State.Snapshots.OpenUrl(this.plugin, { url, type });
+    }
+
+    loadStructureFromUrl(url: string, format: BuiltInTrajectoryFormat = 'mmcif', isBinary = false, options?: LoadStructureOptions) {
+        const params = DownloadStructure.createDefaultParams(this.plugin.state.data.root.obj!, this.plugin);
+        return this.plugin.runTask(this.plugin.state.data.applyAction(DownloadStructure, {
+            source: {
+                name: 'url',
+                params: {
+                    url: Asset.Url(url),
+                    format: format as any,
+                    isBinary,
+                    options: { ...params.source.params.options, representationParams: options?.representationParams as any },
+                }
+            }
+        }));
+    }
+
+    async loadAllModelsOrAssemblyFromUrl(url: string, format: BuiltInTrajectoryFormat = 'mmcif', isBinary = false, options?: LoadStructureOptions) {
+        const plugin = this.plugin;
+
+        const data = await plugin.builders.data.download({ url, isBinary }, { state: { isGhost: true } });
+        const trajectory = await plugin.builders.structure.parseTrajectory(data, format);
+
+        await this.plugin.builders.structure.hierarchy.applyPreset(trajectory, 'all-models', { useDefaultIfSingleModel: true, representationPresetParams: options?.representationParams });
+    }
+
+    async loadStructureFromData(data: string | number[], format: BuiltInTrajectoryFormat, options?: { dataLabel?: string }) {
+        const _data = await this.plugin.builders.data.rawData({ data, label: options?.dataLabel });
+        const trajectory = await this.plugin.builders.structure.parseTrajectory(_data, format);
+        await this.plugin.builders.structure.hierarchy.applyPreset(trajectory, 'default');
+    }
+
+    loadPdb(pdb: string, options?: LoadStructureOptions) {
+        const params = DownloadStructure.createDefaultParams(this.plugin.state.data.root.obj!, this.plugin);
+        const provider = this.plugin.config.get(PluginConfig.Download.DefaultPdbProvider)!;
+        return this.plugin.runTask(this.plugin.state.data.applyAction(DownloadStructure, {
+            source: {
+                name: 'pdb' as const,
+                params: {
+                    provider: {
+                        id: pdb,
+                        server: {
+                            name: provider,
+                            params: PdbDownloadProvider[provider].defaultValue as any
+                        }
+                    },
+                    options: { ...params.source.params.options, representationParams: options?.representationParams as any },
+                }
+            }
+        }));
+    }
+
+    loadPdbDev(pdbDev: string) {
+        const params = DownloadStructure.createDefaultParams(this.plugin.state.data.root.obj!, this.plugin);
+        return this.plugin.runTask(this.plugin.state.data.applyAction(DownloadStructure, {
+            source: {
+                name: 'pdb-dev' as const,
+                params: {
+                    provider: {
+                        id: pdbDev,
+                        encoding: 'bcif',
+                    },
+                    options: params.source.params.options,
+                }
+            }
+        }));
+    }
+
+    loadEmdb(emdb: string, options?: { detail?: number }) {
+        const provider = this.plugin.config.get(PluginConfig.Download.DefaultEmdbProvider)!;
+        return this.plugin.runTask(this.plugin.state.data.applyAction(DownloadDensity, {
+            source: {
+                name: 'pdb-emd-ds' as const,
+                params: {
+                    provider: {
+                        id: emdb,
+                        server: provider,
+                    },
+                    detail: options?.detail ?? 3,
+                }
+            }
+        }));
+    }
+
+    loadAlphaFoldDb(afdb: string) {
+        const params = DownloadStructure.createDefaultParams(this.plugin.state.data.root.obj!, this.plugin);
+        return this.plugin.runTask(this.plugin.state.data.applyAction(DownloadStructure, {
+            source: {
+                name: 'alphafolddb' as const,
+                params: {
+                    id: afdb,
+                    options: {
+                        ...params.source.params.options,
+                        representation: 'preset-structure-representation-ma-quality-assessment-plddt'
+                    },
+                }
+            }
+        }));
+    }
+
+    loadModelArchive(id: string) {
+        const params = DownloadStructure.createDefaultParams(this.plugin.state.data.root.obj!, this.plugin);
+        return this.plugin.runTask(this.plugin.state.data.applyAction(DownloadStructure, {
+            source: {
+                name: 'modelarchive' as const,
+                params: {
+                    id,
+                    options: params.source.params.options,
+                }
+            }
+        }));
+    }
+
+    /**
+     * @example Load X-ray density from volume server
+        viewer.loadVolumeFromUrl({
+            url: 'https://www.ebi.ac.uk/pdbe/densities/x-ray/1tqn/cell?detail=3',
+            format: 'dscif',
+            isBinary: true
+        }, [{
+            type: 'relative',
+            value: 1.5,
+            color: 0x3362B2
+        }, {
+            type: 'relative',
+            value: 3,
+            color: 0x33BB33,
+            volumeIndex: 1
+        }, {
+            type: 'relative',
+            value: -3,
+            color: 0xBB3333,
+            volumeIndex: 1
+        }], {
+            entryId: ['2FO-FC', 'FO-FC'],
+            isLazy: true
+        });
+     * *********************
+     * @example Load EM density from volume server
+        viewer.loadVolumeFromUrl({
+            url: 'https://maps.rcsb.org/em/emd-30210/cell?detail=6',
+            format: 'dscif',
+            isBinary: true
+        }, [{
+            type: 'relative',
+            value: 1,
+            color: 0x3377aa
+        }], {
+            entryId: 'EMD-30210',
+            isLazy: true
+        });
+     */
+    async loadVolumeFromUrl({ url, format, isBinary }: { url: string, format: BuildInVolumeFormat, isBinary: boolean }, isovalues: VolumeIsovalueInfo[], options?: { entryId?: string | string[], isLazy?: boolean }) {
+        const plugin = this.plugin;
+
+        if (!plugin.dataFormats.get(format)) {
+            throw new Error(`Unknown density format: ${format}`);
+        }
+
+        if (options?.isLazy) {
+            const update = this.plugin.build();
+            update.toRoot().apply(StateTransforms.Data.LazyVolume, {
+                url,
+                format,
+                entryId: options?.entryId,
+                isBinary,
+                isovalues: isovalues.map(v => ({ alpha: 1, volumeIndex: 0, ...v }))
+            });
+            return update.commit();
+        }
+
+        return plugin.dataTransaction(async () => {
+            const data = await plugin.builders.data.download({ url, isBinary }, { state: { isGhost: true } });
+
+            const parsed = await plugin.dataFormats.get(format)!.parse(plugin, data, { entryId: options?.entryId });
+            const firstVolume = (parsed.volume || parsed.volumes[0]) as StateObjectSelector<PluginStateObject.Volume.Data>;
+            if (!firstVolume?.isOk) throw new Error('Failed to parse any volume.');
+
+            const repr = plugin.build();
+            for (const iso of isovalues) {
+                repr
+                    .to(parsed.volumes?.[iso.volumeIndex ?? 0] ?? parsed.volume)
+                    .apply(StateTransforms.Representation.VolumeRepresentation3D, createVolumeRepresentationParams(this.plugin, firstVolume.data!, {
+                        type: 'isosurface',
+                        typeParams: { alpha: iso.alpha ?? 1, isoValue: iso.type === 'absolute' ? { kind: 'absolute', absoluteValue: iso.value } : { kind: 'relative', relativeValue: iso.value } },
+                        color: 'uniform',
+                        colorParams: { value: iso.color }
+                    }));
+            }
+
+            await repr.commit();
+        });
+    }
+
+    /**
+     * @example
+     *  viewer.loadTrajectory({
+     *      model: { kind: 'model-url', url: 'villin.gro', format: 'gro' },
+     *      coordinates: { kind: 'coordinates-url', url: 'villin.xtc', format: 'xtc', isBinary: true },
+     *      preset: 'all-models' // or 'default'
+     *  });
+     */
+    async loadTrajectory(params: LoadTrajectoryParams) {
+        const plugin = this.plugin;
+
+        let model: StateObjectSelector, coords: StateObjectSelector;
+
+        if (params.model.kind === 'model-data' || params.model.kind === 'model-url') {
+            const data = params.model.kind === 'model-data'
+                ? await plugin.builders.data.rawData({ data: params.model.data, label: params.modelLabel })
+                : await plugin.builders.data.download({ url: params.model.url, isBinary: params.model.isBinary, label: params.modelLabel });
+
+            const trajectory = await plugin.builders.structure.parseTrajectory(data, params.model.format ?? 'mmcif');
+            model = await plugin.builders.structure.createModel(trajectory);
+        } else {
+            const data = params.model.kind === 'topology-data'
+                ? await plugin.builders.data.rawData({ data: params.model.data, label: params.modelLabel })
+                : await plugin.builders.data.download({ url: params.model.url, isBinary: params.model.isBinary, label: params.modelLabel });
+
+            const provider = plugin.dataFormats.get(params.model.format);
+            model = await provider!.parse(plugin, data);
+        }
+
+        {
+            const data = params.coordinates.kind === 'coordinates-data'
+                ? await plugin.builders.data.rawData({ data: params.coordinates.data, label: params.coordinatesLabel })
+                : await plugin.builders.data.download({ url: params.coordinates.url, isBinary: params.coordinates.isBinary, label: params.coordinatesLabel });
+
+            const provider = plugin.dataFormats.get(params.coordinates.format);
+            coords = await provider!.parse(plugin, data);
+        }
+
+        const trajectory = await plugin.build().toRoot()
+            .apply(TrajectoryFromModelAndCoordinates, {
+                modelRef: model.ref,
+                coordinatesRef: coords.ref
+            }, { dependsOn: [model.ref, coords.ref] })
+            .commit();
+
+        const preset = await plugin.builders.structure.hierarchy.applyPreset(trajectory, params.preset ?? 'default');
+
+        return { model, coords, preset };
+    }
+
+    handleResize() {
+        this.plugin.layout.events.updated.next(void 0);
+    }
+}
+
+export interface LoadStructureOptions {
+    representationParams?: StructureRepresentationPresetProvider.CommonParams
+}
+
+export interface VolumeIsovalueInfo {
+    type: 'absolute' | 'relative',
+    value: number,
+    color: Color,
+    alpha?: number,
+    volumeIndex?: number
+}
+
+export interface LoadTrajectoryParams {
+    model: { kind: 'model-url', url: string, format?: BuiltInTrajectoryFormat /* mmcif */, isBinary?: boolean }
+    | { kind: 'model-data', data: string | number[] | ArrayBuffer | Uint8Array, format?: BuiltInTrajectoryFormat /* mmcif */ }
+    | { kind: 'topology-url', url: string, format: BuildInStructureFormat, isBinary?: boolean }
+    | { kind: 'topology-data', data: string | number[] | ArrayBuffer | Uint8Array, format: BuildInStructureFormat },
+    modelLabel?: string,
+    coordinates: { kind: 'coordinates-url', url: string, format: BuildInStructureFormat, isBinary?: boolean }
+    | { kind: 'coordinates-data', data: string | number[] | ArrayBuffer | Uint8Array, format: BuildInStructureFormat },
+    coordinatesLabel?: string,
+    preset?: keyof PresetTrajectoryHierarchy
+}
+
+export const ViewerAutoPreset = StructureRepresentationPresetProvider({
+    id: 'preset-structure-representation-viewer-auto',
+    display: {
+        name: 'Automatic (w/ Annotation)', group: 'Annotation',
+        description: 'Show standard automatic representation but colored by quality assessment (if available in the model).'
+    },
+    isApplicable(a) {
+        return (
+            !!a.data.models.some(m => QualityAssessment.isApplicable(m, 'pLDDT')) ||
+            !!a.data.models.some(m => QualityAssessment.isApplicable(m, 'qmean'))
+        );
+    },
+    params: () => StructureRepresentationPresetProvider.CommonParams,
+    async apply(ref, params, plugin) {
+        const structureCell = StateObjectRef.resolveAndCheck(plugin.state.data, ref);
+        const structure = structureCell?.obj?.data;
+        if (!structureCell || !structure) return {};
+
+        if (!!structure.models.some(m => QualityAssessment.isApplicable(m, 'pLDDT'))) {
+            return await QualityAssessmentPLDDTPreset.apply(ref, params, plugin);
+        } else if (!!structure.models.some(m => QualityAssessment.isApplicable(m, 'qmean'))) {
+            return await QualityAssessmentQmeanPreset.apply(ref, params, plugin);
+        } else {
+            return await PresetStructureRepresentations.auto.apply(ref, params, plugin);
+        }
+    }
+});

src/apps/viewer/index.ts

@@ -1,486 +1,12 @@
 /**
- * Copyright (c) 2018-2021 mol* contributors, licensed under MIT, See LICENSE file for more info.
+ * Copyright (c) 2018-2022 mol* contributors, licensed under MIT, See LICENSE file for more info.
  *
  * @author David Sehnal <david.sehnal@gmail.com>
  * @author Alexander Rose <alexander.rose@weirdbyte.de>
  */
 
-import { ANVILMembraneOrientation } from '../../extensions/anvil/behavior';
-import { CellPack } from '../../extensions/cellpack';
-import { DnatcoConfalPyramids } from '../../extensions/dnatco';
-import { G3DFormat, G3dProvider } from '../../extensions/g3d/format';
-import { GeometryExport } from '../../extensions/geo-export';
-import { MAQualityAssessment } from '../../extensions/model-archive/quality-assessment/behavior';
-import { QualityAssessmentPLDDTPreset, QualityAssessmentQmeanPreset } from '../../extensions/model-archive/quality-assessment/behavior';
-import { QualityAssessment } from '../../extensions/model-archive/quality-assessment/prop';
-import { Mp4Export } from '../../extensions/mp4-export';
-import { ModelExport } from '../../extensions/model-export';
-import { PDBeStructureQualityReport } from '../../extensions/pdbe';
-import { RCSBAssemblySymmetry, RCSBValidationReport } from '../../extensions/rcsb';
-import { DownloadStructure, PdbDownloadProvider } from '../../mol-plugin-state/actions/structure';
-import { DownloadDensity } from '../../mol-plugin-state/actions/volume';
-import { PresetTrajectoryHierarchy } from '../../mol-plugin-state/builder/structure/hierarchy-preset';
-import { PresetStructureRepresentations, StructureRepresentationPresetProvider } from '../../mol-plugin-state/builder/structure/representation-preset';
-import { DataFormatProvider } from '../../mol-plugin-state/formats/provider';
-import { BuildInStructureFormat } from '../../mol-plugin-state/formats/structure';
-import { BuiltInTrajectoryFormat } from '../../mol-plugin-state/formats/trajectory';
-import { BuildInVolumeFormat } from '../../mol-plugin-state/formats/volume';
-import { createVolumeRepresentationParams } from '../../mol-plugin-state/helpers/volume-representation-params';
-import { PluginStateObject } from '../../mol-plugin-state/objects';
-import { StateTransforms } from '../../mol-plugin-state/transforms';
-import { TrajectoryFromModelAndCoordinates } from '../../mol-plugin-state/transforms/model';
-import { createPluginUI } from '../../mol-plugin-ui';
-import { PluginUIContext } from '../../mol-plugin-ui/context';
-import { DefaultPluginUISpec, PluginUISpec } from '../../mol-plugin-ui/spec';
-import { PluginCommands } from '../../mol-plugin/commands';
-import { PluginConfig } from '../../mol-plugin/config';
-import { PluginLayoutControlsDisplay } from '../../mol-plugin/layout';
-import { PluginSpec } from '../../mol-plugin/spec';
-import { PluginState } from '../../mol-plugin/state';
-import { StateObjectRef, StateObjectSelector } from '../../mol-state';
-import { Asset } from '../../mol-util/assets';
-import { Color } from '../../mol-util/color';
-import '../../mol-util/polyfill';
-import { ObjectKeys } from '../../mol-util/type-helpers';
 import './embedded.html';
 import './favicon.ico';
 import './index.html';
-
 require('mol-plugin-ui/skin/light.scss');
-
-export { PLUGIN_VERSION as version } from '../../mol-plugin/version';
-export { setDebugMode, setProductionMode } from '../../mol-util/debug';
-
-const CustomFormats = [
-    ['g3d', G3dProvider] as const
-];
-
-const Extensions = {
-    'cellpack': PluginSpec.Behavior(CellPack),
-    'dnatco-confal-pyramids': PluginSpec.Behavior(DnatcoConfalPyramids),
-    'pdbe-structure-quality-report': PluginSpec.Behavior(PDBeStructureQualityReport),
-    'rcsb-assembly-symmetry': PluginSpec.Behavior(RCSBAssemblySymmetry),
-    'rcsb-validation-report': PluginSpec.Behavior(RCSBValidationReport),
-    'anvil-membrane-orientation': PluginSpec.Behavior(ANVILMembraneOrientation),
-    'g3d': PluginSpec.Behavior(G3DFormat),
-    'model-export': PluginSpec.Behavior(ModelExport),
-    'mp4-export': PluginSpec.Behavior(Mp4Export),
-    'geo-export': PluginSpec.Behavior(GeometryExport),
-    'ma-quality-assessment': PluginSpec.Behavior(MAQualityAssessment),
-};
-
-const DefaultViewerOptions = {
-    customFormats: CustomFormats as [string, DataFormatProvider][],
-    extensions: ObjectKeys(Extensions),
-    layoutIsExpanded: true,
-    layoutShowControls: true,
-    layoutShowRemoteState: true,
-    layoutControlsDisplay: 'reactive' as PluginLayoutControlsDisplay,
-    layoutShowSequence: true,
-    layoutShowLog: true,
-    layoutShowLeftPanel: true,
-    collapseLeftPanel: false,
-    collapseRightPanel: false,
-    disableAntialiasing: PluginConfig.General.DisableAntialiasing.defaultValue,
-    pixelScale: PluginConfig.General.PixelScale.defaultValue,
-    pickScale: PluginConfig.General.PickScale.defaultValue,
-    pickPadding: PluginConfig.General.PickPadding.defaultValue,
-    enableWboit: PluginConfig.General.EnableWboit.defaultValue,
-    preferWebgl1: PluginConfig.General.PreferWebGl1.defaultValue,
-
-    viewportShowExpand: PluginConfig.Viewport.ShowExpand.defaultValue,
-    viewportShowControls: PluginConfig.Viewport.ShowControls.defaultValue,
-    viewportShowSettings: PluginConfig.Viewport.ShowSettings.defaultValue,
-    viewportShowSelectionMode: PluginConfig.Viewport.ShowSelectionMode.defaultValue,
-    viewportShowAnimation: PluginConfig.Viewport.ShowAnimation.defaultValue,
-    pluginStateServer: PluginConfig.State.DefaultServer.defaultValue,
-    volumeStreamingServer: PluginConfig.VolumeStreaming.DefaultServer.defaultValue,
-    volumeStreamingDisabled: !PluginConfig.VolumeStreaming.Enabled.defaultValue,
-    pdbProvider: PluginConfig.Download.DefaultPdbProvider.defaultValue,
-    emdbProvider: PluginConfig.Download.DefaultEmdbProvider.defaultValue,
-};
-type ViewerOptions = typeof DefaultViewerOptions;
-
-export class Viewer {
-    constructor(public plugin: PluginUIContext) {
-    }
-
-    static async create(elementOrId: string | HTMLElement, options: Partial<ViewerOptions> = {}) {
-        const o = { ...DefaultViewerOptions, ...options };
-        const defaultSpec = DefaultPluginUISpec();
-
-        const spec: PluginUISpec = {
-            actions: defaultSpec.actions,
-            behaviors: [
-                ...defaultSpec.behaviors,
-                ...o.extensions.map(e => Extensions[e]),
-            ],
-            animations: [...defaultSpec.animations || []],
-            customParamEditors: defaultSpec.customParamEditors,
-            customFormats: o?.customFormats,
-            layout: {
-                initial: {
-                    isExpanded: o.layoutIsExpanded,
-                    showControls: o.layoutShowControls,
-                    controlsDisplay: o.layoutControlsDisplay,
-                    regionState: {
-                        bottom: 'full',
-                        left: o.collapseLeftPanel ? 'collapsed' : 'full',
-                        right: o.collapseRightPanel ? 'hidden' : 'full',
-                        top: 'full',
-                    }
-                },
-            },
-            components: {
-                ...defaultSpec.components,
-                controls: {
-                    ...defaultSpec.components?.controls,
-                    top: o.layoutShowSequence ? undefined : 'none',
-                    bottom: o.layoutShowLog ? undefined : 'none',
-                    left: o.layoutShowLeftPanel ? undefined : 'none',
-                },
-                remoteState: o.layoutShowRemoteState ? 'default' : 'none',
-            },
-            config: [
-                [PluginConfig.General.DisableAntialiasing, o.disableAntialiasing],
-                [PluginConfig.General.PixelScale, o.pixelScale],
-                [PluginConfig.General.PickScale, o.pickScale],
-                [PluginConfig.General.PickPadding, o.pickPadding],
-                [PluginConfig.General.EnableWboit, o.enableWboit],
-                [PluginConfig.General.PreferWebGl1, o.preferWebgl1],
-                [PluginConfig.Viewport.ShowExpand, o.viewportShowExpand],
-                [PluginConfig.Viewport.ShowControls, o.viewportShowControls],
-                [PluginConfig.Viewport.ShowSettings, o.viewportShowSettings],
-                [PluginConfig.Viewport.ShowSelectionMode, o.viewportShowSelectionMode],
-                [PluginConfig.Viewport.ShowAnimation, o.viewportShowAnimation],
-                [PluginConfig.State.DefaultServer, o.pluginStateServer],
-                [PluginConfig.State.CurrentServer, o.pluginStateServer],
-                [PluginConfig.VolumeStreaming.DefaultServer, o.volumeStreamingServer],
-                [PluginConfig.VolumeStreaming.Enabled, !o.volumeStreamingDisabled],
-                [PluginConfig.Download.DefaultPdbProvider, o.pdbProvider],
-                [PluginConfig.Download.DefaultEmdbProvider, o.emdbProvider],
-                [PluginConfig.Structure.DefaultRepresentationPreset, ViewerAutoPreset.id],
-            ]
-        };
-
-        const element = typeof elementOrId === 'string'
-            ? document.getElementById(elementOrId)
-            : elementOrId;
-        if (!element) throw new Error(`Could not get element with id '${elementOrId}'`);
-        const plugin = await createPluginUI(element, spec, {
-            onBeforeUIRender: plugin => {
-                // the preset needs to be added before the UI renders otherwise
-                // "Download Structure" wont be able to pick it up
-                plugin.builders.structure.representation.registerPreset(ViewerAutoPreset);
-            }
-        });
-        return new Viewer(plugin);
-    }
-
-    setRemoteSnapshot(id: string) {
-        const url = `${this.plugin.config.get(PluginConfig.State.CurrentServer)}/get/${id}`;
-        return PluginCommands.State.Snapshots.Fetch(this.plugin, { url });
-    }
-
-    loadSnapshotFromUrl(url: string, type: PluginState.SnapshotType) {
-        return PluginCommands.State.Snapshots.OpenUrl(this.plugin, { url, type });
-    }
-
-    loadStructureFromUrl(url: string, format: BuiltInTrajectoryFormat = 'mmcif', isBinary = false, options?: LoadStructureOptions) {
-        const params = DownloadStructure.createDefaultParams(this.plugin.state.data.root.obj!, this.plugin);
-        return this.plugin.runTask(this.plugin.state.data.applyAction(DownloadStructure, {
-            source: {
-                name: 'url',
-                params: {
-                    url: Asset.Url(url),
-                    format: format as any,
-                    isBinary,
-                    options: { ...params.source.params.options, representationParams: options?.representationParams as any },
-                }
-            }
-        }));
-    }
-
-    async loadAllModelsOrAssemblyFromUrl(url: string, format: BuiltInTrajectoryFormat = 'mmcif', isBinary = false, options?: LoadStructureOptions) {
-        const plugin = this.plugin;
-
-        const data = await plugin.builders.data.download({ url, isBinary }, { state: { isGhost: true } });
-        const trajectory = await plugin.builders.structure.parseTrajectory(data, format);
-
-        await this.plugin.builders.structure.hierarchy.applyPreset(trajectory, 'all-models', { useDefaultIfSingleModel: true, representationPresetParams: options?.representationParams });
-    }
-
-    async loadStructureFromData(data: string | number[], format: BuiltInTrajectoryFormat, options?: { dataLabel?: string }) {
-        const _data = await this.plugin.builders.data.rawData({ data, label: options?.dataLabel });
-        const trajectory = await this.plugin.builders.structure.parseTrajectory(_data, format);
-        await this.plugin.builders.structure.hierarchy.applyPreset(trajectory, 'default');
-    }
-
-    loadPdb(pdb: string, options?: LoadStructureOptions) {
-        const params = DownloadStructure.createDefaultParams(this.plugin.state.data.root.obj!, this.plugin);
-        const provider = this.plugin.config.get(PluginConfig.Download.DefaultPdbProvider)!;
-        return this.plugin.runTask(this.plugin.state.data.applyAction(DownloadStructure, {
-            source: {
-                name: 'pdb' as const,
-                params: {
-                    provider: {
-                        id: pdb,
-                        server: {
-                            name: provider,
-                            params: PdbDownloadProvider[provider].defaultValue as any
-                        }
-                    },
-                    options: { ...params.source.params.options, representationParams: options?.representationParams as any },
-                }
-            }
-        }));
-    }
-
-    loadPdbDev(pdbDev: string) {
-        const params = DownloadStructure.createDefaultParams(this.plugin.state.data.root.obj!, this.plugin);
-        return this.plugin.runTask(this.plugin.state.data.applyAction(DownloadStructure, {
-            source: {
-                name: 'pdb-dev' as const,
-                params: {
-                    provider: {
-                        id: pdbDev,
-                        encoding: 'bcif',
-                    },
-                    options: params.source.params.options,
-                }
-            }
-        }));
-    }
-
-    loadEmdb(emdb: string, options?: { detail?: number }) {
-        const provider = this.plugin.config.get(PluginConfig.Download.DefaultEmdbProvider)!;
-        return this.plugin.runTask(this.plugin.state.data.applyAction(DownloadDensity, {
-            source: {
-                name: 'pdb-emd-ds' as const,
-                params: {
-                    provider: {
-                        id: emdb,
-                        server: provider,
-                    },
-                    detail: options?.detail ?? 3,
-                }
-            }
-        }));
-    }
-
-    loadAlphaFoldDb(afdb: string) {
-        const params = DownloadStructure.createDefaultParams(this.plugin.state.data.root.obj!, this.plugin);
-        return this.plugin.runTask(this.plugin.state.data.applyAction(DownloadStructure, {
-            source: {
-                name: 'alphafolddb' as const,
-                params: {
-                    id: afdb,
-                    options: {
-                        ...params.source.params.options,
-                        representation: 'preset-structure-representation-ma-quality-assessment-plddt'
-                    },
-                }
-            }
-        }));
-    }
-
-    loadModelArchive(id: string) {
-        const params = DownloadStructure.createDefaultParams(this.plugin.state.data.root.obj!, this.plugin);
-        return this.plugin.runTask(this.plugin.state.data.applyAction(DownloadStructure, {
-            source: {
-                name: 'modelarchive' as const,
-                params: {
-                    id,
-                    options: params.source.params.options,
-                }
-            }
-        }));
-    }
-
-    /**
-     * @example Load X-ray density from volume server
-        viewer.loadVolumeFromUrl({
-            url: 'https://www.ebi.ac.uk/pdbe/densities/x-ray/1tqn/cell?detail=3',
-            format: 'dscif',
-            isBinary: true
-        }, [{
-            type: 'relative',
-            value: 1.5,
-            color: 0x3362B2
-        }, {
-            type: 'relative',
-            value: 3,
-            color: 0x33BB33,
-            volumeIndex: 1
-        }, {
-            type: 'relative',
-            value: -3,
-            color: 0xBB3333,
-            volumeIndex: 1
-        }], {
-            entryId: ['2FO-FC', 'FO-FC'],
-            isLazy: true
-        });
-     * *********************
-     * @example Load EM density from volume server
-        viewer.loadVolumeFromUrl({
-            url: 'https://maps.rcsb.org/em/emd-30210/cell?detail=6',
-            format: 'dscif',
-            isBinary: true
-        }, [{
-            type: 'relative',
-            value: 1,
-            color: 0x3377aa
-        }], {
-            entryId: 'EMD-30210',
-            isLazy: true
-        });
-     */
-    async loadVolumeFromUrl({ url, format, isBinary }: { url: string, format: BuildInVolumeFormat, isBinary: boolean }, isovalues: VolumeIsovalueInfo[], options?: { entryId?: string | string[], isLazy?: boolean }) {
-        const plugin = this.plugin;
-
-        if (!plugin.dataFormats.get(format)) {
-            throw new Error(`Unknown density format: ${format}`);
-        }
-
-        if (options?.isLazy) {
-            const update = this.plugin.build();
-            update.toRoot().apply(StateTransforms.Data.LazyVolume, {
-                url,
-                format,
-                entryId: options?.entryId,
-                isBinary,
-                isovalues: isovalues.map(v => ({ alpha: 1, volumeIndex: 0, ...v }))
-            });
-            return update.commit();
-        }
-
-        return plugin.dataTransaction(async () => {
-            const data = await plugin.builders.data.download({ url, isBinary }, { state: { isGhost: true } });
-
-            const parsed = await plugin.dataFormats.get(format)!.parse(plugin, data, { entryId: options?.entryId });
-            const firstVolume = (parsed.volume || parsed.volumes[0]) as StateObjectSelector<PluginStateObject.Volume.Data>;
-            if (!firstVolume?.isOk) throw new Error('Failed to parse any volume.');
-
-            const repr = plugin.build();
-            for (const iso of isovalues) {
-                repr
-                    .to(parsed.volumes?.[iso.volumeIndex ?? 0] ?? parsed.volume)
-                    .apply(StateTransforms.Representation.VolumeRepresentation3D, createVolumeRepresentationParams(this.plugin, firstVolume.data!, {
-                        type: 'isosurface',
-                        typeParams: { alpha: iso.alpha ?? 1, isoValue: iso.type === 'absolute' ? { kind: 'absolute', absoluteValue: iso.value } : { kind: 'relative', relativeValue: iso.value } },
-                        color: 'uniform',
-                        colorParams: { value: iso.color }
-                    }));
-            }
-
-            await repr.commit();
-        });
-    }
-
-    /**
-     * @example
-     *  viewer.loadTrajectory({
-     *      model: { kind: 'model-url', url: 'villin.gro', format: 'gro' },
-     *      coordinates: { kind: 'coordinates-url', url: 'villin.xtc', format: 'xtc', isBinary: true },
-     *      preset: 'all-models' // or 'default'
-     *  });
-     */
-    async loadTrajectory(params: LoadTrajectoryParams) {
-        const plugin = this.plugin;
-
-        let model: StateObjectSelector, coords: StateObjectSelector;
-
-        if (params.model.kind === 'model-data' || params.model.kind === 'model-url') {
-            const data = params.model.kind === 'model-data'
-                ? await plugin.builders.data.rawData({ data: params.model.data, label: params.modelLabel })
-                : await plugin.builders.data.download({ url: params.model.url, isBinary: params.model.isBinary, label: params.modelLabel });
-
-            const trajectory = await plugin.builders.structure.parseTrajectory(data, params.model.format ?? 'mmcif');
-            model = await plugin.builders.structure.createModel(trajectory);
-        } else {
-            const data = params.model.kind === 'topology-data'
-                ? await plugin.builders.data.rawData({ data: params.model.data, label: params.modelLabel })
-                : await plugin.builders.data.download({ url: params.model.url, isBinary: params.model.isBinary, label: params.modelLabel });
-
-            const provider = plugin.dataFormats.get(params.model.format);
-            model = await provider!.parse(plugin, data);
-        }
-
-        {
-            const data = params.coordinates.kind === 'coordinates-data'
-                ? await plugin.builders.data.rawData({ data: params.coordinates.data, label: params.coordinatesLabel })
-                : await plugin.builders.data.download({ url: params.coordinates.url, isBinary: params.coordinates.isBinary, label: params.coordinatesLabel });
-
-            const provider = plugin.dataFormats.get(params.coordinates.format);
-            coords = await provider!.parse(plugin, data);
-        }
-
-        const trajectory = await plugin.build().toRoot()
-            .apply(TrajectoryFromModelAndCoordinates, {
-                modelRef: model.ref,
-                coordinatesRef: coords.ref
-            }, { dependsOn: [model.ref, coords.ref] })
-            .commit();
-
-        const preset = await plugin.builders.structure.hierarchy.applyPreset(trajectory, params.preset ?? 'default');
-
-        return { model, coords, preset };
-    }
-
-    handleResize() {
-        this.plugin.layout.events.updated.next(void 0);
-    }
-}
-
-export interface LoadStructureOptions {
-    representationParams?: StructureRepresentationPresetProvider.CommonParams
-}
-
-export interface VolumeIsovalueInfo {
-    type: 'absolute' | 'relative',
-    value: number,
-    color: Color,
-    alpha?: number,
-    volumeIndex?: number
-}
-
-export interface LoadTrajectoryParams {
-    model: { kind: 'model-url', url: string, format?: BuiltInTrajectoryFormat /* mmcif */, isBinary?: boolean }
-    | { kind: 'model-data', data: string | number[] | ArrayBuffer | Uint8Array, format?: BuiltInTrajectoryFormat /* mmcif */ }
-    | { kind: 'topology-url', url: string, format: BuildInStructureFormat, isBinary?: boolean }
-    | { kind: 'topology-data', data: string | number[] | ArrayBuffer | Uint8Array, format: BuildInStructureFormat },
-    modelLabel?: string,
-    coordinates: { kind: 'coordinates-url', url: string, format: BuildInStructureFormat, isBinary?: boolean }
-    | { kind: 'coordinates-data', data: string | number[] | ArrayBuffer | Uint8Array, format: BuildInStructureFormat },
-    coordinatesLabel?: string,
-    preset?: keyof PresetTrajectoryHierarchy
-}
-
-export const ViewerAutoPreset = StructureRepresentationPresetProvider({
-    id: 'preset-structure-representation-viewer-auto',
-    display: {
-        name: 'Automatic (w/ Annotation)', group: 'Annotation',
-        description: 'Show standard automatic representation but colored by quality assessment (if available in the model).'
-    },
-    isApplicable(a) {
-        return (
-            !!a.data.models.some(m => QualityAssessment.isApplicable(m, 'pLDDT')) ||
-            !!a.data.models.some(m => QualityAssessment.isApplicable(m, 'qmean'))
-        );
-    },
-    params: () => StructureRepresentationPresetProvider.CommonParams,
-    async apply(ref, params, plugin) {
-        const structureCell = StateObjectRef.resolveAndCheck(plugin.state.data, ref);
-        const structure = structureCell?.obj?.data;
-        if (!structureCell || !structure) return {};
-
-        if (!!structure.models.some(m => QualityAssessment.isApplicable(m, 'pLDDT'))) {
-            return await QualityAssessmentPLDDTPreset.apply(ref, params, plugin);
-        } else if (!!structure.models.some(m => QualityAssessment.isApplicable(m, 'qmean'))) {
-            return await QualityAssessmentQmeanPreset.apply(ref, params, plugin);
-        } else {
-            return await PresetStructureRepresentations.auto.apply(ref, params, plugin);
-        }
-    }
-});
+export * from './app';

src/extensions/anvil/representation.ts

@@ -43,9 +43,9 @@ export type BilayerPlanesProps = PD.Values<BilayerPlanesParams>
 const BilayerRimsParams = {
     ...Lines.Params,
     ...SharedParams,
-    lineSizeAttenuation: PD.Boolean(true),
-    linesSize: PD.Numeric(0.3, { min: 0.01, max: 50, step: 0.01 }),
-    dashedLines: PD.Boolean(true),
+    lineSizeAttenuation: PD.Boolean(false),
+    linesSize: PD.Numeric(0.5, { min: 0.01, max: 50, step: 0.01 }),
+    dashedLines: PD.Boolean(false),
 };
 export type BilayerRimsParams = typeof BilayerRimsParams
 export type BilayerRimsProps = PD.Values<BilayerRimsParams>

src/extensions/mp4-export/encoder.ts

@@ -73,7 +73,7 @@ export async function encodeMp4Animation<A extends PluginStateAnimation>(plugin:
         await plugin.managers.animation.play(params.animation.definition, params.animation.params);
         stoppedAnimation = false;
         for (let i = 0; i <= N; i++) {
-            await loop.tick(i * dt, { isSynchronous: true, manualDraw: true });
+            await loop.tick(i * dt, { isSynchronous: true, animation: { currentFrame: i, frameCount: N }, manualDraw: true });
 
             const image = params.pass.getImageData(width, height, normalizedViewport);
             encoder.addFrameRgba(image.data);

src/extensions/rcsb/graphql/types.ts

@@ -4,7 +4,7 @@ export type InputMaybe<T> = Maybe<T>;
 export type Exact<T extends { [key: string]: unknown }> = { [K in keyof T]: T[K] };
 export type MakeOptional<T, K extends keyof T> = Omit<T, K> & { [SubKey in K]?: Maybe<T[SubKey]> };
 export type MakeMaybe<T, K extends keyof T> = Omit<T, K> & { [SubKey in K]: Maybe<T[SubKey]> };
-// Generated on 2021-11-25T14:34:23-08:00
+// Generated on 2022-01-15T19:52:34-08:00
 
 /** All built-in and custom scalars, mapped to their actual values */
 export type Scalars = {
@@ -11113,11 +11113,11 @@ export type RcsbUniprotAlignments = {
 
 export type RcsbUniprotAlignmentsCoreEntityAlignments = {
   /** Aligned region */
-  readonly aligned_regions?: Maybe<ReadonlyArray<Maybe<CoreEntityAlignmentsAlignedRegions>>>;
+  readonly aligned_regions: ReadonlyArray<Maybe<CoreEntityAlignmentsAlignedRegions>>;
   /** core_entity identifiers */
   readonly core_entity_identifiers?: Maybe<CoreEntityAlignmentsCoreEntityIdentifiers>;
   /** Alignment scores */
-  readonly scores?: Maybe<CoreEntityAlignmentsScores>;
+  readonly scores: CoreEntityAlignmentsScores;
 };
 
 export type RcsbUniprotAnnotation = {

src/mol-canvas3d/canvas3d.ts

@@ -444,7 +444,7 @@ namespace Canvas3D {
             }
 
             draw();
-            if (!camera.transition.inTransition && !controls.props.spin && !webgl.isContextLost) {
+            if (!camera.transition.inTransition && !webgl.isContextLost) {
                 interactionHelper.tick(currentTime);
             }
         }

src/mol-io/reader/_spec/mol.spec.ts

@@ -1,5 +1,12 @@
+/**
+ * Copyright (c) 2019-2022 mol* contributors, licensed under MIT, See LICENSE file for more info.
+ *
+ * @author David Sehnal <david.sehnal@gmail.com>
+ * @author Alexander Rose <alexander.rose@weirdbyte.de>
+ * @author Panagiotis Tourlas <panagiot_tourlov@hotmail.com>
+ */
 
-import { parseMol } from '../mol/parser';
+import { parseMol, formalChargeMapper } from '../mol/parser';
 
 const MolString = `2244
   -OEChem-04072009073D
@@ -49,6 +56,48 @@ const MolString = `2244
  13 20  1  0  0  0  0
 M  END`;
 
+const MolStringWithAtomBlockCharge = `
+  Ketcher  1 72215442D 1   1.00000     0.00000     0
+
+  4  3  0  0  0  0            999 V2000
+    0.0000    0.0000    0.0000 C   0  1  0  0  0  0  0  0  0  0  0  0
+    0.8660    0.5000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
+   -0.8660    0.5000    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
+    0.0000   -1.0000    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
+  1  4  2  0  0  0  0
+  3  1  1  0  0  0  0
+  2  1  1  0  0  0  0
+M  END`;
+
+const MolStringWithPropertyBlockCharge = `
+  Ketcher  1 72215442D 1   1.00000     0.00000     0
+
+  4  3  0  0  0  0            999 V2000
+    0.0000    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
+    0.8660    0.5000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
+   -0.8660    0.5000    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
+    0.0000   -1.0000    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
+  1  4  2  0  0  0  0
+  3  1  1  0  0  0  0
+  2  1  1  0  0  0  0
+M  CHG  3   2  -1   3   1   4   1
+M  END`;
+
+const MolStringWithMultipleChargeLines = `
+  Ketcher  1 72215442D 1   1.00000     0.00000     0
+
+  4  3  0  0  0  0            999 V2000
+    0.0000    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
+    0.8660    0.5000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
+   -0.8660    0.5000    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
+    0.0000   -1.0000    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
+  1  4  2  0  0  0  0
+  3  1  1  0  0  0  0
+  2  1  1  0  0  0  0
+M  CHG  1   2  -1
+M  CHG  2   3   1   4   1
+M  END`;
+
 describe('mol reader', () => {
     it('basic', async () => {
         const parsed = await parseMol(MolString).run();
@@ -70,4 +119,63 @@ describe('mol reader', () => {
         expect(bonds.atomIdxB.value(20)).toBe(20);
         expect(bonds.order.value(20)).toBe(1);
     });
+    it('property block charges', async () => {
+        const parsed = await parseMol(MolStringWithPropertyBlockCharge).run();
+        if (parsed.isError) {
+            throw new Error(parsed.message);
+        }
+        const { formalCharges } = parsed.result;
+
+        expect(formalCharges.atomIdx.rowCount).toBe(3);
+        expect(formalCharges.charge.rowCount).toBe(3);
+
+        expect(formalCharges.atomIdx.value(0)).toBe(2);
+        expect(formalCharges.atomIdx.value(1)).toBe(3);
+
+        expect(formalCharges.charge.value(0)).toBe(-1);
+        expect(formalCharges.charge.value(1)).toBe(1);
+    });
+    it('multiple charge lines', async () => {
+        const parsed = await parseMol(MolStringWithMultipleChargeLines).run();
+        if (parsed.isError) {
+            throw new Error(parsed.message);
+        }
+        const { formalCharges } = parsed.result;
+
+        expect(formalCharges.atomIdx.rowCount).toBe(3);
+        expect(formalCharges.charge.rowCount).toBe(3);
+
+        expect(formalCharges.atomIdx.value(0)).toBe(2);
+        expect(formalCharges.atomIdx.value(1)).toBe(3);
+
+        expect(formalCharges.charge.value(0)).toBe(-1);
+        expect(formalCharges.charge.value(1)).toBe(1);
+    });
+
+    it('atom block charge mapping', async () => {
+        expect(formalChargeMapper(7)).toBe(-3);
+        expect(formalChargeMapper(6)).toBe(-2);
+        expect(formalChargeMapper(5)).toBe(-1);
+        expect(formalChargeMapper(0)).toBe(0);
+        expect(formalChargeMapper(3)).toBe(1);
+        expect(formalChargeMapper(2)).toBe(2);
+        expect(formalChargeMapper(1)).toBe(3);
+        expect(formalChargeMapper(4)).toBe(0);
+    });
+    it('atom block charges', async () => {
+        const parsed = await parseMol(MolStringWithAtomBlockCharge).run();
+        if (parsed.isError) {
+            throw new Error(parsed.message);
+        }
+        const { atoms, formalCharges } = parsed.result;
+
+        /* No property block charges */
+        expect(formalCharges.atomIdx.rowCount).toBe(0);
+        expect(formalCharges.charge.rowCount).toBe(0);
+
+        expect(atoms.formal_charge.value(0)).toBe(1);
+        expect(atoms.formal_charge.value(1)).toBe(0);
+        expect(atoms.formal_charge.value(2)).toBe(0);
+        expect(atoms.formal_charge.value(3)).toBe(0);
+    });
 });

src/mol-io/reader/_spec/mol2.spec.ts

@@ -244,6 +244,84 @@ GASTEIGER
     25    13    23    1
     26    13    24    1`;
 
+const Mol2StringCrysin = `@<TRIPOS>MOLECULE
+1144204
+    12    11     2     0     0
+SMALL
+USER_CHARGES
+****
+Generated from the CSD
+
+@<TRIPOS>ATOM
+     1 Cl1      0.0925   3.6184   1.9845   Cl        1 RES1  -1.0000
+     2 C1      -4.7391   0.3350   0.4215   C.ar      2 RES2   0.0000
+     3 C2      -3.4121   0.2604   0.9351   C.ar      2 RES2   0.0000
+     4 C3      -2.9169   1.2555   1.7726   C.ar      2 RES2   0.0000
+     5 C4      -3.7118   2.3440   2.1099   C.ar      2 RES2   0.0000
+     6 C5      -5.0314   2.4052   1.6209   C.ar      2 RES2   0.0000
+     7 C6      -5.5372   1.4057   0.7962   C.ar      2 RES2   0.0000
+     8 C7      -6.9925   1.4547   0.3334   C.3       2 RES2   0.0000
+     9 C8      -7.8537   0.5554   1.1859   C.3       2 RES2   0.0000
+    10 N1      -9.3089   0.7134   0.8192   N.3       2 RES2   1.0000
+    11 O1      -2.6613  -0.8147   0.5707   O.3       2 RES2   0.0000
+    12 O2      -1.6204   1.0919   2.2584   O.3       2 RES2   0.0000
+@<TRIPOS>BOND
+     1     2     3   ar
+     2     3     4   ar
+     3     4     5   ar
+     4     5     6   ar
+     5     6     7   ar
+     6     7     2   ar
+     7     8     7    1
+     8     9     8    1
+     9    10     9    1
+    10    11     3    1
+    11    12     4    1
+@<TRIPOS>SUBSTRUCTURE
+     1 RES1        1 GROUP             0 ****  ****    0
+     2 RES2        2 GROUP             0 ****  ****    0
+@<TRIPOS>CRYSIN
+   10.5150   11.1300    7.9380   90.0000   90.0000   90.0000    29     5
+@<TRIPOS>MOLECULE
+   1144204
+    12    11     2     0     0
+SMALL
+USER_CHARGES
+****
+Generated from the CSD
+
+@<TRIPOS>ATOM
+     1 Cl1      0.0925   3.6184   1.9845   Cl        1 RES1  -1.0000
+     2 C1      -4.7391   0.3350   0.4215   C.ar      2 RES2   0.0000
+     3 C2      -3.4121   0.2604   0.9351   C.ar      2 RES2   0.0000
+     4 C3      -2.9169   1.2555   1.7726   C.ar      2 RES2   0.0000
+     5 C4      -3.7118   2.3440   2.1099   C.ar      2 RES2   0.0000
+     6 C5      -5.0314   2.4052   1.6209   C.ar      2 RES2   0.0000
+     7 C6      -5.5372   1.4057   0.7962   C.ar      2 RES2   0.0000
+     8 C7      -6.9925   1.4547   0.3334   C.3       2 RES2   0.0000
+     9 C8      -7.8537   0.5554   1.1859   C.3       2 RES2   0.0000
+    10 N1      -9.3089   0.7134   0.8192   N.3       2 RES2   1.0000
+    11 O1      -2.6613  -0.8147   0.5707   O.3       2 RES2   0.0000
+    12 O2      -1.6204   1.0919   2.2584   O.3       2 RES2   0.0000
+@<TRIPOS>BOND
+     1     2     3   ar
+     2     3     4   ar
+     3     4     5   ar
+     4     5     6   ar
+     5     6     7   ar
+     6     7     2   ar
+     7     8     7    1
+     8     9     8    1
+     9    10     9    1
+    10    11     3    1
+    11    12     4    1
+@<TRIPOS>SUBSTRUCTURE
+     1 RES1        1 GROUP             0 ****  ****    0
+     2 RES2        2 GROUP             0 ****  ****    0
+@<TRIPOS>CRYSIN
+   10.5150   11.1300    7.9380   90.0000   90.0000   90.0000    29     5
+`;
+
 describe('mol2 reader', () => {
     it('basic', async () => {
         const parsed = await parseMol2(Mol2String, '').run();
@@ -397,4 +475,29 @@ describe('mol2 reader', () => {
         // optional bond fields
         expect(bonds.status_bits.value(0)).toBe('');
     });
+
+    it('crysin', async () => {
+        const parsed = await parseMol2(Mol2StringCrysin, '').run();
+        if (parsed.isError) {
+            throw new Error(parsed.message);
+        }
+        const mol2File = parsed.result;
+
+        // number of structures
+        expect(mol2File.structures.length).toBe(2);
+
+        // crysin fields
+        for (const data of mol2File.structures) {
+            expect(data.crysin).toEqual({
+                a: 10.5150,
+                b: 11.1300,
+                c: 7.9380,
+                alpha: 90.0,
+                beta: 90.0,
+                gamma: 90.0,
+                spaceGroup: 29,
+                setting: 5
+            });
+        }
+    });
 });

src/mol-io/reader/_spec/sdf.spec.ts

@@ -1,3 +1,10 @@
+/**
+ * Copyright (c) 2020-2022 mol* contributors, licensed under MIT, See LICENSE file for more info.
+ *
+ * @author Sebastian Bittrich <sebastian.bittrich@rcsb.org>
+ * @author David Sehnal <david.sehnal@gmail.com>
+ * @author Panagiotis Tourlas <panagiot_tourlov@hotmail.com>
+ */
 
 import { parseSdf } from '../sdf/parser';
 
@@ -458,6 +465,38 @@ describe('sdf reader', () => {
         expect(compound3.dataItems.data.value(21)).toBe('2\n5\n10');
     });
 
+    it('charge parsing in V2000', async () => {
+        const parsed = await parseSdf(SdfString).run();
+        if (parsed.isError) {
+            throw new Error(parsed.message);
+        }
+        const compound1 = parsed.result.compounds[0];
+        const compound2 = parsed.result.compounds[1];
+        const compound3 = parsed.result.compounds[2];
+
+        const formalCharges1 = {
+            atomIdx: compound1.molFile.formalCharges.atomIdx,
+            charge: compound1.molFile.formalCharges.charge
+        };
+        const formalCharges2 = {
+            atomIdx: compound2.molFile.formalCharges.atomIdx,
+            charge: compound2.molFile.formalCharges.charge
+        };
+        const formalCharges3 = {
+            atomIdx: compound3.molFile.formalCharges.atomIdx,
+            charge: compound3.molFile.formalCharges.charge
+        };
+
+        expect(formalCharges1.atomIdx.rowCount).toBe(3);
+        expect(formalCharges2.atomIdx.rowCount).toBe(3);
+        expect(formalCharges3.atomIdx.rowCount).toBe(0);
+
+        expect(formalCharges1.charge.rowCount === formalCharges1.atomIdx.rowCount).toBe(true);
+        expect(formalCharges2.charge.rowCount === formalCharges2.atomIdx.rowCount).toBe(true);
+        expect(formalCharges3.charge.rowCount === formalCharges3.atomIdx.rowCount).toBe(true);
+    });
+
+
     it('v3000', async () => {
         const parsed = await parseSdf(V3000SdfString).run();
         if (parsed.isError) {
@@ -486,6 +525,11 @@ describe('sdf reader', () => {
         expect(compound1.molFile.bonds.atomIdxB.value(10)).toBe(9);
         expect(compound1.molFile.bonds.order.value(10)).toBe(2);
 
+        expect(compound1.molFile.formalCharges.atomIdx.rowCount).toBe(13);
+        for (let i = 0; i < compound1.molFile.atoms.count; i++) {
+            expect(compound1.molFile.formalCharges.charge.value(i)).toBe(0);
+        }
+
         expect(compound1.dataItems.dataHeader.rowCount).toBe(2);
         expect(compound1.dataItems.data.rowCount).toBe(2);
 

src/mol-io/reader/cif/schema/bird.ts

@@ -1,7 +1,7 @@
 /**
  * Copyright (c) 2017-2020 mol* contributors, licensed under MIT, See LICENSE file for more info.
  *
- * Code-generated 'BIRD' schema file. Dictionary versions: mmCIF 5.352, IHM 1.17, CARB draft.
+ * Code-generated 'BIRD' schema file. Dictionary versions: mmCIF 5.354, IHM 1.17, MA 1.3.3.
  *
  * @author molstar/ciftools package
  */

src/mol-io/reader/cif/schema/ccd.ts

@@ -1,7 +1,7 @@
 /**
  * Copyright (c) 2017-2020 mol* contributors, licensed under MIT, See LICENSE file for more info.
  *
- * Code-generated 'CCD' schema file. Dictionary versions: mmCIF 5.352, IHM 1.17, CARB draft.
+ * Code-generated 'CCD' schema file. Dictionary versions: mmCIF 5.354, IHM 1.17, MA 1.3.3.
  *
  * @author molstar/ciftools package
  */

src/mol-io/reader/cif/schema/mmcif.ts

@@ -1,7 +1,7 @@
 /**
  * Copyright (c) 2017-2020 mol* contributors, licensed under MIT, See LICENSE file for more info.
  *
- * Code-generated 'mmCIF' schema file. Dictionary versions: mmCIF 5.353, IHM 1.17, MA 1.3.3.
+ * Code-generated 'mmCIF' schema file. Dictionary versions: mmCIF 5.354, IHM 1.17, MA 1.3.3.
  *
  * @author molstar/ciftools package
  */
@@ -682,7 +682,7 @@ export const mmCIF_Schema = {
         /**
          * An abbreviation that identifies the database.
          */
-        database_id: Aliased<'CAS' | 'CSD' | 'EMDB' | 'ICSD' | 'MDF' | 'NDB' | 'NBS' | 'PDB' | 'PDF' | 'RCSB' | 'EBI' | 'PDBE' | 'BMRB' | 'WWPDB' | 'PDB_ACC'>(str),
+        database_id: Aliased<'AFDB' | 'CAS' | 'CSD' | 'EMDB' | 'ICSD' | 'MA' | 'MDF' | 'MODBASE' | 'NDB' | 'NBS' | 'PDB' | 'PDF' | 'RCSB' | 'SMR' | 'EBI' | 'PDBE' | 'BMRB' | 'WWPDB' | 'PDB_ACC'>(str),
         /**
          * The code assigned by the database identified in
          * _database_2.database_id.

src/mol-io/reader/mol/parser.ts

@@ -1,7 +1,8 @@
 /**
- * Copyright (c) 2020 mol* contributors, licensed under MIT, See LICENSE file for more info.
+ * Copyright (c) 2020-2022 mol* contributors, licensed under MIT, See LICENSE file for more info.
  *
  * @author David Sehnal <david.sehnal@gmail.com>
+ * @author Panagiotis Tourlas <panagiot_tourlov@hotmail.com>
  */
 
 import { Column } from '../../../mol-data/db';
@@ -10,6 +11,7 @@ import { TokenColumnProvider as TokenColumn } from '../common/text/column/token'
 import { TokenBuilder, Tokenizer } from '../common/text/tokenizer';
 import { ReaderResult as Result } from '../result';
 
+
 /** Subset of the MolFile V2000 format */
 export interface MolFile {
     readonly title: string,
@@ -20,7 +22,8 @@ export interface MolFile {
         readonly x: Column<number>,
         readonly y: Column<number>,
         readonly z: Column<number>,
-        readonly type_symbol: Column<string>
+        readonly type_symbol: Column<string>,
+        readonly formal_charge: Column<number>
     },
     readonly bonds: {
         readonly count: number
@@ -28,6 +31,57 @@ export interface MolFile {
         readonly atomIdxB: Column<number>,
         readonly order: Column<number>
     }
+    readonly formalCharges: {
+        readonly atomIdx: Column<number>;
+        readonly charge: Column<number>;
+    }
+}
+
+/*
+    The atom lines in a .mol file have the following structure:
+
+    xxxxx.xxxxyyyyy.yyyyzzzzz.zzzz aaaddcccssshhhbbbvvvHHHrrriiimmmnnneee
+    ---------------------------------------------------------------------
+
+    Below is a breakdown of each component and its start/end indices:
+
+    xxxxx.xxxx  (X COORDINATE, 1-10)
+    yyyyy.yyyy  (Y COORDINATE, 10-20)
+    zzzzz.zzzz  (Z COORDINATE, 20-30)
+    _           (30 IS EMPTY)
+    aaa         (ATOM SYMBOL, 31-34)
+    dd          (MASS DIFF, 34-36)
+    ccc         (FORMAL CHARGE, 36-39)
+    sss         (ATOM STEREO PARITY, 39-42)
+    hhh         (HYDROGEN COUNT+1, 42-45)
+    bbb         (STEREO CARE BOX, 45-48)
+    vvv         (VALENCE, 48-51)
+    HHH         (H0 DESIGNATOR, 51-54)
+    rrr         (UNUSED, 54-57)
+    iii         (UNUSED, 57-60)
+    mmm         (ATOM-ATOM MAPPING NUMBER, 60-63)
+    nnn         (INVERSION/RETENTION FLAG, 63-66)
+    eee         (EXACT CHANGE FLAG, 66-69)
+*/
+
+/**
+ * @param key - The value found at the atom block.
+ * @returns The actual formal charge based on the mapping.
+ */
+export function formalChargeMapper(key: number) {
+    switch (key) {
+        case 7: return -3;
+        case 6: return -2;
+        case 5: return -1;
+        case 0: return 0;
+        case 3: return 1;
+        case 2: return 2;
+        case 1: return 3;
+        case 4: return 0;
+        default:
+            console.error(`Value ${key} is outside the 0-7 range, defaulting to 0.`);
+            return 0;
+    }
 }
 
 export function handleAtoms(tokenizer: Tokenizer, count: number): MolFile['atoms'] {
@@ -35,6 +89,7 @@ export function handleAtoms(tokenizer: Tokenizer, count: number): MolFile['atoms
     const y = TokenBuilder.create(tokenizer.data, count * 2);
     const z = TokenBuilder.create(tokenizer.data, count * 2);
     const type_symbol = TokenBuilder.create(tokenizer.data, count * 2);
+    const formal_charge = TokenBuilder.create(tokenizer.data, count * 2);
 
     for (let i = 0; i < count; ++i) {
         Tokenizer.markLine(tokenizer);
@@ -47,6 +102,8 @@ export function handleAtoms(tokenizer: Tokenizer, count: number): MolFile['atoms
         TokenBuilder.addUnchecked(z, tokenizer.tokenStart, tokenizer.tokenEnd);
         Tokenizer.trim(tokenizer, s + 31, s + 34);
         TokenBuilder.addUnchecked(type_symbol, tokenizer.tokenStart, tokenizer.tokenEnd);
+        Tokenizer.trim(tokenizer, s + 36, s + 39);
+        TokenBuilder.addUnchecked(formal_charge, tokenizer.tokenStart, tokenizer.tokenEnd);
         tokenizer.position = position;
     }
 
@@ -55,7 +112,8 @@ export function handleAtoms(tokenizer: Tokenizer, count: number): MolFile['atoms
         x: TokenColumn(x)(Column.Schema.float),
         y: TokenColumn(y)(Column.Schema.float),
         z: TokenColumn(z)(Column.Schema.float),
-        type_symbol: TokenColumn(type_symbol)(Column.Schema.str)
+        type_symbol: TokenColumn(type_symbol)(Column.Schema.str),
+        formal_charge: TokenColumn(formal_charge)(Column.Schema.int)
     };
 }
 
@@ -84,6 +142,76 @@ export function handleBonds(tokenizer: Tokenizer, count: number): MolFile['bonds
     };
 }
 
+interface FormalChargesRawData {
+    atomIdx: Array<number>;
+    charge: Array<number>;
+}
+export function handleFormalCharges(tokenizer: Tokenizer, lineStart: number, formalCharges: FormalChargesRawData) {
+
+    Tokenizer.trim(tokenizer, lineStart + 6, lineStart + 9);
+    const numOfCharges = parseInt(Tokenizer.getTokenString(tokenizer));
+    for (let i = 0; i < numOfCharges; ++i) {
+        /*
+        M  CHG  3   1  -1   2   0   2  -1
+                |   |   |   |   |
+                |   |   |   |   |__charge2 (etc.)
+                |   |   |   |
+                |   |   |   |__atomIdx2
+                |   |   |
+                |   |   |__charge1
+                |   |
+                |   |__atomIdx1 (cursor at position 12)
+                |
+                |___numOfCharges
+        */
+        const offset = 9 + (i * 8);
+
+        Tokenizer.trim(tokenizer, lineStart + offset, lineStart + offset + 4);
+        const _atomIdx = Tokenizer.getTokenString(tokenizer);
+        formalCharges.atomIdx.push(+_atomIdx);
+        Tokenizer.trim(tokenizer, lineStart + offset + 4, lineStart + offset + 8);
+        const _charge = Tokenizer.getTokenString(tokenizer);
+        formalCharges.charge.push(+_charge);
+    }
+    /* Once the line is read, move to the next one. */
+    Tokenizer.eatLine(tokenizer);
+}
+
+/** Call an appropriate handler based on the property type.
+ * (For now it only calls the formal charge handler, additional handlers can
+ * be added for other properties.)
+ */
+export function handlePropertiesBlock(tokenizer: Tokenizer): MolFile['formalCharges'] {
+
+    const _atomIdx: Array<number> = [];
+    const _charge: Array<number> = [];
+    const _formalCharges: FormalChargesRawData = { atomIdx: _atomIdx, charge: _charge };
+
+    while (tokenizer.position < tokenizer.length) {
+        const { position: s } = tokenizer;
+
+        Tokenizer.trim(tokenizer, s + 3, s + 6);
+        const propertyType = Tokenizer.getTokenString(tokenizer);
+
+        if (propertyType === 'END') break;
+        Tokenizer.eatLine(tokenizer);
+
+        switch (propertyType) {
+            case 'CHG':
+                handleFormalCharges(tokenizer, s, _formalCharges);
+                break;
+            default:
+                break;
+        }
+    }
+
+    const formalCharges: MolFile['formalCharges'] = {
+        atomIdx: Column.ofIntArray(_formalCharges.atomIdx),
+        charge: Column.ofIntArray(_formalCharges.charge)
+    };
+    return formalCharges;
+}
+
 function parseInternal(data: string): Result<MolFile> {
     const tokenizer = Tokenizer(data);
 
@@ -98,12 +226,15 @@ function parseInternal(data: string): Result<MolFile> {
     const atoms = handleAtoms(tokenizer, atomCount);
     const bonds = handleBonds(tokenizer, bondCount);
 
+    const formalCharges = handlePropertiesBlock(tokenizer);
+
     const result: MolFile = {
         title,
         program,
         comment,
         atoms,
-        bonds
+        bonds,
+        formalCharges,
     };
     return Result.success(result);
 }

src/mol-io/reader/mol2/parser.ts

@@ -1,5 +1,5 @@
 /**
- * Copyright (c) 2017-2020 mol* contributors, licensed under MIT, See LICENSE file for more info.
+ * Copyright (c) 2017-2022 mol* contributors, licensed under MIT, See LICENSE file for more info.
  *
  * @author Zepei Xu <xuzepei19950617@gmail.com>
  * @author Alexander Rose <alexander.rose@weirdbyte.de>
@@ -259,6 +259,36 @@ async function handleBonds(state: State): Promise<Schema.Mol2Bonds> {
     return ret;
 }
 
+function handleCrysin(state: State) {
+    const { tokenizer } = state;
+
+    while (tokenizer.position < tokenizer.data.length) {
+        const l = getTokenString(tokenizer);
+        if (l === '@<TRIPOS>MOLECULE') {
+            return;
+        } else if (l === '@<TRIPOS>CRYSIN') {
+            break;
+        } else {
+            markLine(tokenizer);
+        }
+    }
+
+    if (tokenizer.position >= tokenizer.data.length) return;
+
+    markLine(tokenizer);
+    const values = getTokenString(tokenizer).trim().split(reWhitespace);
+    return {
+        a: parseFloat(values[0]),
+        b: parseFloat(values[1]),
+        c: parseFloat(values[2]),
+        alpha: parseFloat(values[3]),
+        beta: parseFloat(values[4]),
+        gamma: parseFloat(values[5]),
+        spaceGroup: parseInt(values[6], 10),
+        setting: parseInt(values[7], 10),
+    };
+}
+
 async function parseInternal(ctx: RuntimeContext, data: string, name: string): Promise<Result<Schema.Mol2File>> {
     const tokenizer = Tokenizer(data);
 
@@ -269,7 +299,8 @@ async function parseInternal(ctx: RuntimeContext, data: string, name: string): P
         handleMolecule(state);
         const atoms = await handleAtoms(state);
         const bonds = await handleBonds(state);
-        structures.push({ molecule: state.molecule, atoms, bonds });
+        const crysin = handleCrysin(state);
+        structures.push({ molecule: state.molecule, atoms, bonds, crysin });
         skipWhitespace(tokenizer);
         while (getTokenString(tokenizer) !== '@<TRIPOS>MOLECULE' && tokenizer.position < tokenizer.data.length) {
             markLine(tokenizer);

src/mol-io/reader/mol2/schema.ts

@@ -1,5 +1,5 @@
 /**
- * Copyright (c) 2017 mol* contributors, licensed under MIT, See LICENSE file for more info.
+ * Copyright (c) 2017-2022 mol* contributors, licensed under MIT, See LICENSE file for more info.
  *
  * @author Alexander Rose <alexander.rose@weirdbyte.de>
  */
@@ -11,6 +11,7 @@ import { Column } from '../../../mol-data/db';
 // @<TRIPOS>MOLECULE
 // @<TRIPOS>ATOM
 // @<TRIPOS>BOND
+// @<TRIPOS>CRYSIN
 //
 // note that the format is not a fixed column format but white space separated
 
@@ -56,10 +57,22 @@ export interface Mol2Bonds {
     status_bits: Column<string>
 }
 
+export interface Mol2Crysin {
+    a: number
+    b: number
+    c: number
+    alpha: number
+    beta: number
+    gamma: number
+    spaceGroup: number
+    setting: number
+}
+
 export interface Mol2Structure {
     molecule: Readonly<Mol2Molecule>,
     atoms: Readonly<Mol2Atoms>,
     bonds: Readonly<Mol2Bonds>
+    crysin?: Readonly<Mol2Crysin>
 }
 
 export interface Mol2File {

src/mol-io/reader/sdf/parser-v3-util.ts

@@ -1,3 +1,10 @@
+/**
+ * Copyright (c) 2021-2022 mol* contributors, licensed under MIT, See LICENSE file for more info.
+ *
+ * @author Jason Pattle <jpattle@exscientia.co.uk>
+ * @author Panagiotis Tourlas <panagiot_tourlov@hotmail.com>
+ */
+
 import { Column } from '../../../mol-data/db';
 import { MolFile } from '../mol/parser';
 import { Tokenizer, TokenBuilder, Tokens } from '../common/text/tokenizer';
@@ -61,6 +68,9 @@ export function handleAtomsV3(
         y: TokenColumn(y)(Column.Schema.float),
         z: TokenColumn(z)(Column.Schema.float),
         type_symbol: TokenColumn(type_symbol)(Column.Schema.str),
+        /* No support for formal charge parsing in V3000 molfiles at the moment,
+        so all charges default to 0.*/
+        formal_charge: Column.ofConst(0, atomCount, Column.Schema.int)
     };
 }
 

src/mol-io/reader/sdf/parser.ts

@@ -1,12 +1,14 @@
 /**
- * Copyright (c) 2020-2021 mol* contributors, licensed under MIT, See LICENSE file for more info.
+ * Copyright (c) 2020-2022 mol* contributors, licensed under MIT, See LICENSE file for more info.
  *
  * @author Sebastian Bittrich <sebastian.bittrich@rcsb.org>
  * @author Alexander Rose <alexander.rose@weirdbyte.de>
+ * @author Jason Pattle <jpattle@exscientia.co.uk>
+ * @author Panagiotis Tourlas <panagiot_tourlov@hotmail.com>
  */
 
 import { Column } from '../../../mol-data/db';
-import { MolFile, handleAtoms, handleBonds } from '../mol/parser';
+import { MolFile, handleAtoms, handleBonds, handlePropertiesBlock } from '../mol/parser';
 import { Task } from '../../../mol-task';
 import { ReaderResult as Result } from '../result';
 import { Tokenizer, TokenBuilder } from '../common/text/tokenizer';
@@ -29,6 +31,7 @@ export interface SdfFile {
 
 
 const delimiter = '$$$$';
+
 function handleDataItems(tokenizer: Tokenizer): { dataHeader: Column<string>, data: Column<string> } {
     const dataHeader = TokenBuilder.create(tokenizer.data, 32);
     const data = TokenBuilder.create(tokenizer.data, 32);
@@ -93,12 +96,20 @@ function handleMolFile(tokenizer: Tokenizer) {
         return;
     }
 
+    /* No support for formal charge parsing in V3000 molfiles at the moment,
+    so all charges default to 0.*/
+    const nullFormalCharges: MolFile['formalCharges'] = {
+        atomIdx: Column.ofConst(0, atomCount, Column.Schema.int),
+        charge: Column.ofConst(0, atomCount, Column.Schema.int)
+    };
+
     const atoms = molIsV3 ? handleAtomsV3(tokenizer, atomCount) : handleAtoms(tokenizer, atomCount);
     const bonds = molIsV3 ? handleBondsV3(tokenizer, bondCount) : handleBonds(tokenizer, bondCount);
+    const formalCharges = molIsV3 ? nullFormalCharges : handlePropertiesBlock(tokenizer);
     const dataItems = handleDataItems(tokenizer);
 
     return {
-        molFile: { title, program, comment, atoms, bonds },
+        molFile: { title, program, comment, atoms, bonds, formalCharges },
         dataItems
     };
 }

src/mol-model-formats/structure/mol.ts

@@ -1,12 +1,13 @@
 /**
- * Copyright (c) 2019-2020 mol* contributors, licensed under MIT, See LICENSE file for more info.
+ * Copyright (c) 2019-2022 mol* contributors, licensed under MIT, See LICENSE file for more info.
  *
  * @author David Sehnal <david.sehnal@gmail.com>
  * @author Alexander Rose <alexander.rose@weirdbyte.de>
+ * @author Panagiotis Tourlas <panagiot_tourlov@hotmail.com>
  */
 
 import { Column, Table } from '../../mol-data/db';
-import { MolFile } from '../../mol-io/reader/mol/parser';
+import { MolFile, formalChargeMapper } from '../../mol-io/reader/mol/parser';
 import { MoleculeType } from '../../mol-model/structure/model/types';
 import { RuntimeContext, Task } from '../../mol-task';
 import { createModels } from './basic/parser';
@@ -18,13 +19,24 @@ import { IndexPairBonds } from './property/bonds/index-pair';
 import { Trajectory } from '../../mol-model/structure';
 
 export async function getMolModels(mol: MolFile, format: ModelFormat<any> | undefined, ctx: RuntimeContext) {
-    const { atoms, bonds } = mol;
+    const { atoms, bonds, formalCharges } = mol;
 
     const MOL = Column.ofConst('MOL', mol.atoms.count, Column.Schema.str);
     const A = Column.ofConst('A', mol.atoms.count, Column.Schema.str);
     const type_symbol = Column.asArrayColumn(atoms.type_symbol);
     const seq_id = Column.ofConst(1, atoms.count, Column.Schema.int);
 
+    const computedFormalCharges = new Int32Array(mol.atoms.count);
+    if (formalCharges.atomIdx.rowCount > 0) {
+        for (let i = 0; i < formalCharges.atomIdx.rowCount; i++) {
+            computedFormalCharges[formalCharges.atomIdx.value(i) - 1] = formalCharges.charge.value(i);
+        }
+    } else {
+        for (let i = 0; i < mol.atoms.count; i++) {
+            computedFormalCharges[i] = formalChargeMapper(atoms.formal_charge.value(i));
+        }
+    }
+
     const atom_site = Table.ofPartialColumns(BasicSchema.atom_site, {
         auth_asym_id: A,
         auth_atom_id: type_symbol,
@@ -45,6 +57,7 @@ export async function getMolModels(mol: MolFile, format: ModelFormat<any> | unde
         type_symbol,
 
         pdbx_PDB_model_num: Column.ofConst(1, atoms.count, Column.Schema.int),
+        pdbx_formal_charge: Column.ofIntArray(computedFormalCharges)
     }, atoms.count);
 
     const entityBuilder = new EntityBuilder();

src/mol-model-formats/structure/mol2.ts

@@ -1,11 +1,11 @@
 /**
- * Copyright (c) 2020 mol* contributors, licensed under MIT, See LICENSE file for more info.
+ * Copyright (c) 2020-2022 mol* contributors, licensed under MIT, See LICENSE file for more info.
  *
  * @author Alexander Rose <alexander.rose@weirdbyte.de>
  */
 
 import { Column, Table } from '../../mol-data/db';
-import { Model } from '../../mol-model/structure/model';
+import { Model, Symmetry } from '../../mol-model/structure/model';
 import { BondType, MoleculeType } from '../../mol-model/structure/model/types';
 import { RuntimeContext, Task } from '../../mol-task';
 import { createModels } from './basic/parser';
@@ -14,22 +14,34 @@ import { ComponentBuilder } from './common/component';
 import { EntityBuilder } from './common/entity';
 import { ModelFormat } from '../format';
 import { IndexPairBonds } from './property/bonds/index-pair';
-import { Mol2File } from '../../mol-io/reader/mol2/schema';
+import { Mol2Crysin, Mol2File } from '../../mol-io/reader/mol2/schema';
 import { AtomPartialCharge } from './property/partial-charge';
 import { Trajectory, ArrayTrajectory } from '../../mol-model/structure';
 import { guessElementSymbolString } from './util';
+import { ModelSymmetry } from './property/symmetry';
+import { Spacegroup, SpacegroupCell } from '../../mol-math/geometry';
+import { Vec3 } from '../../mol-math/linear-algebra';
 
 async function getModels(mol2: Mol2File, ctx: RuntimeContext) {
     const models: Model[] = [];
 
     for (let i = 0, il = mol2.structures.length; i < il; ++i) {
-        const { atoms, bonds, molecule } = mol2.structures[i];
+        const { molecule, atoms, bonds, crysin } = mol2.structures[i];
 
         const A = Column.ofConst('A', atoms.count, Column.Schema.str);
 
         const type_symbol = new Array<string>(atoms.count);
+        let hasAtomType = false;
         for (let i = 0; i < atoms.count; ++i) {
-            type_symbol[i] = guessElementSymbolString(atoms.atom_name.value(i));
+            if (atoms.atom_type.value(i).includes('.')) {
+                hasAtomType = true;
+                break;
+            }
+        }
+        for (let i = 0; i < atoms.count; ++i) {
+            type_symbol[i] = hasAtomType
+                ? atoms.atom_type.value(i).split('.')[0].toUpperCase()
+                : guessElementSymbolString(atoms.atom_name.value(i));
         }
 
         const atom_site = Table.ofPartialColumns(BasicSchema.atom_site, {
@@ -74,6 +86,7 @@ async function getModels(mol2: Mol2File, ctx: RuntimeContext) {
         if (_models.frameCount > 0) {
             const indexA = Column.ofIntArray(Column.mapToArray(bonds.origin_atom_id, x => x - 1, Int32Array));
             const indexB = Column.ofIntArray(Column.mapToArray(bonds.target_atom_id, x => x - 1, Int32Array));
+            const key = bonds.bond_id;
             const order = Column.ofIntArray(Column.mapToArray(bonds.bond_type, x => {
                 switch (x) {
                     case 'ar': // aromatic
@@ -100,7 +113,7 @@ async function getModels(mol2: Mol2File, ctx: RuntimeContext) {
                         return BondType.Flag.Covalent;
                 }
             }, Int8Array));
-            const pairBonds = IndexPairBonds.fromData({ pairs: { indexA, indexB, order, flag }, count: atoms.count });
+            const pairBonds = IndexPairBonds.fromData({ pairs: { key, indexA, indexB, order, flag }, count: atoms.count });
 
             const first = _models.representative;
             IndexPairBonds.Provider.set(first, pairBonds);
@@ -110,6 +123,11 @@ async function getModels(mol2: Mol2File, ctx: RuntimeContext) {
                 type: molecule.charge_type
             });
 
+            if (crysin) {
+                const symmetry = getSymmetry(crysin);
+                if (symmetry) ModelSymmetry.Provider.set(first, symmetry);
+            }
+
             models.push(first);
         }
     }
@@ -117,6 +135,24 @@ async function getModels(mol2: Mol2File, ctx: RuntimeContext) {
     return new ArrayTrajectory(models);
 }
 
+function getSymmetry(crysin: Mol2Crysin): Symmetry | undefined {
+    // TODO handle `crysin.setting`
+    if (crysin.setting !== 1) return;
+
+    const spaceCell = SpacegroupCell.create(
+        crysin.spaceGroup,
+        Vec3.create(crysin.a, crysin.b, crysin.c),
+        Vec3.scale(Vec3(), Vec3.create(crysin.alpha, crysin.beta, crysin.gamma), Math.PI / 180)
+    );
+
+    return {
+        spacegroup: Spacegroup.create(spaceCell),
+        assemblies: [],
+        isNonStandardCrystalFrame: false,
+        ncsOperators: []
+    };
+}
+
 //
 
 export { Mol2Format };

src/mol-model-formats/structure/property/bonds/index-pair.ts

@@ -1,5 +1,5 @@
 /**
- * Copyright (c) 2019-2021 Mol* contributors, licensed under MIT, See LICENSE file for more info.
+ * Copyright (c) 2019-2022 Mol* contributors, licensed under MIT, See LICENSE file for more info.
  *
  * @author Alexander Rose <alexander.rose@weirdbyte.de>
  */
@@ -10,9 +10,9 @@ import { Column } from '../../../../mol-data/db';
 import { FormatPropertyProvider } from '../../common/property';
 import { BondType } from '../../../../mol-model/structure/model/types';
 import { ElementIndex } from '../../../../mol-model/structure';
-import { DefaultBondMaxRadius } from '../../../../mol-model/structure/structure/unit/bonds/common';
 
 export type IndexPairsProps = {
+    readonly key: ArrayLike<number>
     readonly order: ArrayLike<number>
     readonly distance: ArrayLike<number>
     readonly flag: ArrayLike<BondType.Flag>
@@ -22,17 +22,19 @@ export type IndexPairBonds = { bonds: IndexPairs, maxDistance: number }
 
 function getGraph(indexA: ArrayLike<ElementIndex>, indexB: ArrayLike<ElementIndex>, props: Partial<IndexPairsProps>, count: number): IndexPairs {
     const builder = new IntAdjacencyGraph.EdgeBuilder(count, indexA, indexB);
+    const key = new Int32Array(builder.slotCount);
     const order = new Int8Array(builder.slotCount);
     const distance = new Array(builder.slotCount);
     const flag = new Array(builder.slotCount);
     for (let i = 0, _i = builder.edgeCount; i < _i; i++) {
         builder.addNextEdge();
+        builder.assignProperty(key, props.key ? props.key[i] : -1);
         builder.assignProperty(order, props.order ? props.order[i] : 1);
         builder.assignProperty(distance, props.distance ? props.distance[i] : -1);
         builder.assignProperty(flag, props.flag ? props.flag[i] : BondType.Flag.Covalent);
     }
 
-    return builder.createGraph({ order, distance, flag });
+    return builder.createGraph({ key, order, distance, flag });
 }
 
 export namespace IndexPairBonds {
@@ -45,15 +47,33 @@ export namespace IndexPairBonds {
     export type Data = {
         pairs: {
             indexA: Column<number>,
-            indexB: Column<number>
+            indexB: Column<number>,
+            key?: Column<number>,
             order?: Column<number>,
+            /**
+             * Useful for bonds in periodic cells. That is, only bonds within the given
+             * distance are added. This allows for bond between periodic image but
+             * avoids unwanted bonds with wrong distances. If negative, test using the
+             * `maxDistance` option from `Props`.
+             */
             distance?: Column<number>,
             flag?: Column<BondType.Flag>,
         },
         count: number
     }
 
-    export const DefaultProps = { maxDistance: DefaultBondMaxRadius };
+    export const DefaultProps = {
+        /**
+         * If negative, test using element-based threshold, otherwise distance in Angstrom.
+         *
+         * This option exists to handle bonds in periodic cells. For systems that are
+         * made from beads (as opposed to atomic elements), set to a specific distance.
+         *
+         * Note that `Data` has a `distance` field which allows specifying a distance
+         * for each bond individually which takes precedence over this option.
+         */
+        maxDistance: -1
+    };
     export type Props = typeof DefaultProps
 
     export function fromData(data: Data, props: Partial<Props> = {}): IndexPairBonds {
@@ -61,11 +81,12 @@ export namespace IndexPairBonds {
         const { pairs, count } = data;
         const indexA = pairs.indexA.toArray() as ArrayLike<ElementIndex>;
         const indexB = pairs.indexB.toArray() as ArrayLike<ElementIndex>;
+        const key = pairs.key && pairs.key.toArray();
         const order = pairs.order && pairs.order.toArray();
         const distance = pairs.distance && pairs.distance.toArray();
         const flag = pairs.flag && pairs.flag.toArray();
         return {
-            bonds: getGraph(indexA, indexB, { order, distance, flag }, count),
+            bonds: getGraph(indexA, indexB, { key, order, distance, flag }, count),
             maxDistance: p.maxDistance
         };
     }

src/mol-model/structure/structure/element/stats.ts

@@ -72,6 +72,7 @@ export namespace Stats {
             }
         } else if (size === 1) {
             if (Unit.Traits.is(unit.traits, Unit.Trait.MultiChain)) {
+                // handled in `handleUnitChainsSimple`
                 return;
             } else {
                 stats.elementCount += 1;
@@ -193,6 +194,12 @@ export namespace Stats {
                 if (stats.chainCount === 1) {
                     Location.set(stats.firstChainLoc, structure, unit, offsets[cI]);
                 }
+            } else if (size === 1) {
+                // need to handle here, skipped in `handleElement`
+                stats.elementCount += 1;
+                if (stats.elementCount === 1) {
+                    Location.set(stats.firstElementLoc, structure, unit, eI);
+                }
             }
         }
     }

src/mol-model/structure/structure/symmetry.ts

@@ -184,16 +184,13 @@ function getOperatorsForRange(symmetry: Symmetry, ijkMin: Vec3, ijkMax: Vec3, mo
         operators[0] = Spacegroup.getSymmetryOperator(spacegroup, 0, 0, 0, 0);
     }
 
-    const { toFractional } = spacegroup.cell;
-    const ref = Vec3.transformMat4(Vec3(), modelCenter, toFractional);
-
     for (let op = 0; op < spacegroup.operators.length; op++) {
         for (let i = ijkMin[0]; i <= ijkMax[0]; i++) {
             for (let j = ijkMin[1]; j <= ijkMax[1]; j++) {
                 for (let k = ijkMin[2]; k <= ijkMax[2]; k++) {
                     // check if we have added identity as the 1st operator.
                     if (!ncsCount && op === 0 && i === 0 && j === 0 && k === 0) continue;
-                    operators.push(...getOperatorsForIndex(symmetry, op, i, j, k, ref));
+                    operators.push(...getOperatorsForIndex(symmetry, op, i, j, k, modelCenter));
                 }
             }
         }

src/mol-model/structure/structure/unit/bonds/common.ts

@@ -1,5 +1,5 @@
 /**
- * Copyright (c) 2017-2021 Mol* contributors, licensed under MIT, See LICENSE file for more info.
+ * Copyright (c) 2017-2022 Mol* contributors, licensed under MIT, See LICENSE file for more info.
  *
  * @author David Sehnal <david.sehnal@gmail.com>
  * @author Alexander Rose <alexander.rose@weirdbyte.de>
@@ -110,6 +110,15 @@ export function getElementThreshold(i: number) {
     return r;
 }
 
+export function getPairingThreshold(elementIndexA: number, elementIndexB: number, thresholdA: number, thresholdB: number) {
+    const thresholdAB = getElementPairThreshold(elementIndexA, elementIndexB);
+    return thresholdAB > 0
+        ? thresholdAB
+        : elementIndexB < 0
+            ? thresholdA
+            : (thresholdA + thresholdB) / 1.95; // not sure if avg or min but max is too big
+}
+
 const H_ID = __ElementIndex['H']!;
 export function isHydrogen(i: number) {
     return i === H_ID;

src/mol-model/structure/structure/unit/bonds/inter-compute.ts

@@ -1,5 +1,5 @@
 /**
- * Copyright (c) 2017-2021 Mol* contributors, licensed under MIT, See LICENSE file for more info.
+ * Copyright (c) 2017-2022 Mol* contributors, licensed under MIT, See LICENSE file for more info.
  *
  * @author David Sehnal <david.sehnal@gmail.com>
  * @author Alexander Rose <alexander.rose@weirdbyte.de>
@@ -8,7 +8,7 @@
 import { BondType, MoleculeType } from '../../../model/types';
 import { Structure } from '../../structure';
 import { Unit } from '../../unit';
-import { getElementIdx, getElementPairThreshold, getElementThreshold, isHydrogen, BondComputationProps, MetalsSet, DefaultBondComputationProps } from './common';
+import { getElementIdx, getElementThreshold, isHydrogen, BondComputationProps, MetalsSet, DefaultBondComputationProps, getPairingThreshold } from './common';
 import { InterUnitBonds, InterUnitEdgeProps } from './data';
 import { SortedArray } from '../../../../../mol-data/int';
 import { Vec3, Mat4 } from '../../../../../mol-math/linear-algebra';
@@ -82,11 +82,31 @@ function findPairBonds(unitA: Unit.Atomic, unitB: Unit.Atomic, props: BondComput
 
                 const _bI = SortedArray.indexOf(unitB.elements, bI) as StructureElement.UnitIndex;
                 if (_bI < 0) continue;
-                if (type_symbolA.value(aI) === 'H' && type_symbolB.value(bI) === 'H') continue;
+
+                const aeI = getElementIdx(type_symbolA.value(aI));
+                const beI = getElementIdx(type_symbolA.value(bI));
 
                 const d = distance[i];
                 const dist = getDistance(unitA, aI, unitB, bI);
-                if ((d !== -1 && equalEps(dist, d, 0.5)) || dist < maxDistance) {
+
+                let add = false;
+                if (d >= 0) {
+                    add = equalEps(dist, d, 0.3);
+                } else if (maxDistance >= 0) {
+                    add = dist < maxDistance;
+                } else {
+                    const pairingThreshold = getPairingThreshold(
+                        aeI, beI, getElementThreshold(aeI), getElementThreshold(beI)
+                    );
+                    add = dist < pairingThreshold;
+
+                    if (isHydrogen(aeI) && isHydrogen(beI)) {
+                        // TODO handle molecular hydrogen
+                        add = false;
+                    }
+                }
+
+                if (add) {
                     builder.add(_aI, _bI, { order: order[i], flag: flag[i] });
                 }
             }
@@ -155,13 +175,7 @@ function findPairBonds(unitA: Unit.Atomic, unitB: Unit.Atomic, props: BondComput
             const dist = Math.sqrt(squaredDistances[ni]);
             if (dist === 0) continue;
 
-            const thresholdAB = getElementPairThreshold(aeI, beI);
-            const pairingThreshold = thresholdAB > 0
-                ? thresholdAB
-                : beI < 0
-                    ? thresholdA
-                    : (thresholdA + getElementThreshold(beI)) / 1.95; // not sure if avg or min but max is too big
-
+            const pairingThreshold = getPairingThreshold(aeI, beI, thresholdA, getElementThreshold(beI));
             if (dist <= pairingThreshold) {
                 const atomIdB = label_atom_idB.value(bI);
                 const compIdB = label_comp_idB.value(residueIndexB[bI]);

src/mol-model/structure/structure/unit/bonds/intra-compute.ts

@@ -1,5 +1,5 @@
 /**
- * Copyright (c) 2017-2021 Mol* contributors, licensed under MIT, See LICENSE file for more info.
+ * Copyright (c) 2017-2022 Mol* contributors, licensed under MIT, See LICENSE file for more info.
  *
  * @author David Sehnal <david.sehnal@gmail.com>
  * @author Alexander Rose <alexander.rose@weirdbyte.de>
@@ -9,7 +9,7 @@ import { BondType } from '../../../model/types';
 import { IntraUnitBonds } from './data';
 import { Unit } from '../../unit';
 import { IntAdjacencyGraph } from '../../../../../mol-math/graph';
-import { BondComputationProps, getElementIdx, MetalsSet, getElementThreshold, isHydrogen, getElementPairThreshold, DefaultBondComputationProps } from './common';
+import { BondComputationProps, getElementIdx, MetalsSet, getElementThreshold, isHydrogen, DefaultBondComputationProps, getPairingThreshold } from './common';
 import { SortedArray } from '../../../../../mol-data/int';
 import { getIntraBondOrderFromTable } from '../../../model/properties/atomic/bonds';
 import { StructureElement } from '../../element';
@@ -62,7 +62,8 @@ function findIndexPairBonds(unit: Unit.Atomic) {
 
     for (let _aI = 0 as StructureElement.UnitIndex; _aI < atomCount; _aI++) {
         const aI = atoms[_aI];
-        const isHa = type_symbol.value(aI) === 'H';
+        const aeI = getElementIdx(type_symbol.value(aI));
+        const isHa = isHydrogen(aeI);
 
         const srcA = sourceIndex.value(aI);
 
@@ -72,11 +73,30 @@ function findIndexPairBonds(unit: Unit.Atomic) {
 
             const _bI = SortedArray.indexOf(unit.elements, bI) as StructureElement.UnitIndex;
             if (_bI < 0) continue;
-            if (isHa && type_symbol.value(bI) === 'H') continue;
+
+            const beI = getElementIdx(type_symbol.value(bI));
 
             const d = distance[i];
             const dist = getDistance(unit, aI, bI);
-            if ((d !== -1 && equalEps(dist, d, 0.5)) || dist < maxDistance) {
+
+            let add = false;
+            if (d >= 0) {
+                add = equalEps(dist, d, 0.3);
+            } else if (maxDistance >= 0) {
+                add = dist < maxDistance;
+            } else {
+                const pairingThreshold = getPairingThreshold(
+                    aeI, beI, getElementThreshold(aeI), getElementThreshold(beI)
+                );
+                add = dist < pairingThreshold;
+
+                if (isHa && isHydrogen(beI)) {
+                    // TODO handle molecular hydrogen
+                    add = false;
+                }
+            }
+
+            if (add) {
                 atomA[atomA.length] = _aI;
                 atomB[atomB.length] = _bI;
                 orders[orders.length] = order[i];
@@ -214,13 +234,7 @@ function findBonds(unit: Unit.Atomic, props: BondComputationProps): IntraUnitBon
             const dist = Math.sqrt(squaredDistances[ni]);
             if (dist === 0) continue;
 
-            const thresholdAB = getElementPairThreshold(aeI, beI);
-            const pairingThreshold = thresholdAB > 0
-                ? thresholdAB
-                : beI < 0
-                    ? thresholdA
-                    : (thresholdA + getElementThreshold(beI)) / 1.95; // not sure if avg or min but max is too big
-
+            const pairingThreshold = getPairingThreshold(aeI, beI, thresholdA, getElementThreshold(beI));
             if (dist <= pairingThreshold) {
                 atomA[atomA.length] = _aI;
                 atomB[atomB.length] = _bI;

src/mol-plugin-state/animation/built-in/camera-spin.ts

@@ -39,13 +39,9 @@ export const AnimateCameraSpin = PluginStateAnimation.create({
             return { kind: 'finished' };
         }
 
-        const phase = clamp(t.current / ctx.params.durationInMs, 0, 1);
-
-        if (phase >= 0.99999) {
-            ctx.plugin.canvas3d?.requestCameraReset({ snapshot, durationMs: 0 });
-            return { kind: 'finished' };
-        }
-
+        const phase = t.animation
+            ? t.animation?.currentFrame / (t.animation.frameCount + 1)
+            : clamp(t.current / ctx.params.durationInMs, 0, 1);
         const angle = 2 * Math.PI * phase * ctx.params.speed * (ctx.params.direction === 'ccw' ? -1 : 1);
 
         Vec3.sub(_dir, snapshot.position, snapshot.target);
@@ -55,6 +51,10 @@ export const AnimateCameraSpin = PluginStateAnimation.create({
         const position = Vec3.add(Vec3(), snapshot.target, _dir);
         ctx.plugin.canvas3d?.requestCameraReset({ snapshot: { ...snapshot, position }, durationMs: 0 });
 
+        if (phase >= 0.99999) {
+            return { kind: 'finished' };
+        }
+
         return { kind: 'next', state: animState };
     }
 });

src/mol-plugin-state/animation/model.ts

@@ -51,7 +51,8 @@ namespace PluginStateAnimation {
 
     export interface Time {
         lastApplied: number,
-        current: number
+        current: number,
+        animation?: { currentFrame: number, frameCount: number }
     }
 
     export type ApplyResult<S> = { kind: 'finished' } | { kind: 'skip' } | { kind: 'next', state: S }

src/mol-plugin-state/builder/structure/representation-preset.ts

@@ -1,5 +1,5 @@
 /**
- * Copyright (c) 2019-2021 mol* contributors, licensed under MIT, See LICENSE file for more info.
+ * Copyright (c) 2019-2022 mol* contributors, licensed under MIT, See LICENSE file for more info.
  *
  * @author David Sehnal <david.sehnal@gmail.com>
  * @author Alexander Rose <alexander.rose@weirdbyte.de>
@@ -24,6 +24,8 @@ import { IndexPairBonds } from '../../../mol-model-formats/structure/property/bo
 import { StructConn } from '../../../mol-model-formats/structure/property/bonds/struct_conn';
 import { StructureRepresentationRegistry } from '../../../mol-repr/structure/registry';
 import { assertUnreachable } from '../../../mol-util/type-helpers';
+import { Color } from '../../../mol-util/color';
+import { PostprocessingParams } from '../../../mol-canvas3d/passes/postprocessing';
 
 export interface StructureRepresentationPresetProvider<P = any, S extends _Result = _Result> extends PresetProvider<PluginStateObject.Molecule.Structure, P, S> { }
 export function StructureRepresentationPresetProvider<P, S extends _Result>(repr: StructureRepresentationPresetProvider<P, S>) { return repr; }
@@ -98,6 +100,15 @@ type CommonParams = StructureRepresentationPresetProvider.CommonParams
 const reprBuilder = StructureRepresentationPresetProvider.reprBuilder;
 const updateFocusRepr = StructureRepresentationPresetProvider.updateFocusRepr;
 
+function resetPostprocessingProps(plugin: PluginContext) {
+    if (plugin.canvas3d) {
+        const p = PD.getDefaultValues(PostprocessingParams);
+        plugin.canvas3d.setProps({
+            postprocessing: { outline: p.outline, occlusion: p.occlusion }
+        });
+    }
+}
+
 const auto = StructureRepresentationPresetProvider({
     id: 'preset-structure-representation-auto',
     display: {
@@ -137,6 +148,7 @@ const empty = StructureRepresentationPresetProvider({
     id: 'preset-structure-representation-empty',
     display: { name: 'Empty', description: 'Removes all existing representations.' },
     async apply(ref, params, plugin) {
+        resetPostprocessingProps(plugin);
         return { };
     }
 });
@@ -191,6 +203,8 @@ const polymerAndLigand = StructureRepresentationPresetProvider({
         await update.commit({ revertOnError: false });
         await updateFocusRepr(plugin, structure, params.theme?.focus?.name, params.theme?.focus?.params);
 
+        resetPostprocessingProps(plugin);
+
         return { components, representations };
     }
 });
@@ -230,6 +244,8 @@ const proteinAndNucleic = StructureRepresentationPresetProvider({
         await update.commit({ revertOnError: true });
         await updateFocusRepr(plugin, structure, params.theme?.focus?.name, params.theme?.focus?.params);
 
+        resetPostprocessingProps(plugin);
+
         return { components, representations };
     }
 });
@@ -282,6 +298,8 @@ const coarseSurface = StructureRepresentationPresetProvider({
         await update.commit({ revertOnError: true });
         await updateFocusRepr(plugin, structure, params.theme?.focus?.name, params.theme?.focus?.params);
 
+        resetPostprocessingProps(plugin);
+
         return { components, representations };
     }
 });
@@ -315,6 +333,8 @@ const polymerCartoon = StructureRepresentationPresetProvider({
         await update.commit({ revertOnError: true });
         await updateFocusRepr(plugin, structure, params.theme?.focus?.name, params.theme?.focus?.params);
 
+        resetPostprocessingProps(plugin);
+
         return { components, representations };
     }
 });
@@ -381,6 +401,56 @@ const atomicDetail = StructureRepresentationPresetProvider({
         await update.commit({ revertOnError: true });
         await updateFocusRepr(plugin, structure, params.theme?.focus?.name ?? color, params.theme?.focus?.params ?? colorParams);
 
+        resetPostprocessingProps(plugin);
+
+        return { components, representations };
+    }
+});
+
+const illustrative = StructureRepresentationPresetProvider({
+    id: 'preset-structure-representation-illustrative',
+    display: {
+        name: 'Illustrative', group: 'Miscellaneous',
+        description: '...'
+    },
+    params: () => ({
+        ...CommonParams,
+        showCarbohydrateSymbol: PD.Boolean(false)
+    }),
+    async apply(ref, params, plugin) {
+        const structureCell = StateObjectRef.resolveAndCheck(plugin.state.data, ref);
+        if (!structureCell) return {};
+
+        const components = {
+            all: await presetStaticComponent(plugin, structureCell, 'all'),
+            branched: undefined
+        };
+
+        const structure = structureCell.obj!.data;
+
+        const { update, builder, typeParams, color } = reprBuilder(plugin, params, structure);
+
+        const representations = {
+            all: builder.buildRepresentation(update, components.all, { type: 'spacefill', typeParams: { ...typeParams, ignoreLight: true }, color: 'illustrative' }, { tag: 'all' }),
+        };
+        await update.commit({ revertOnError: true });
+        await updateFocusRepr(plugin, structure, params.theme?.focus?.name ?? color, params.theme?.focus?.params);
+
+        if (plugin.canvas3d) {
+            plugin.canvas3d.setProps({
+                postprocessing: {
+                    outline: {
+                        name: 'on',
+                        params: { scale: 1, color: Color(0x000000), threshold: 0.25 }
+                    },
+                    occlusion: {
+                        name: 'on',
+                        params: { bias: 0.9, blurKernelSize: 15, radius: 5, samples: 32 }
+                    },
+                }
+            });
+        }
+
         return { components, representations };
     }
 });
@@ -400,6 +470,7 @@ export const PresetStructureRepresentations = {
     'polymer-cartoon': polymerCartoon,
     'polymer-and-ligand': polymerAndLigand,
     'protein-and-nucleic': proteinAndNucleic,
-    'coarse-surface': coarseSurface
+    'coarse-surface': coarseSurface,
+    'illustrative': illustrative,
 };
 export type PresetStructureRepresentations = typeof PresetStructureRepresentations;

src/mol-plugin-state/manager/animation.ts

@@ -99,12 +99,12 @@ class PluginAnimationManager extends StatefulPluginComponent<PluginAnimationMana
         await this.start();
     }
 
-    async tick(t: number, isSynchronous?: boolean) {
+    async tick(t: number, isSynchronous?: boolean, animation?: PluginAnimationManager.AnimationInfo) {
         this.currentTime = t;
         if (this.isStopped) return;
 
-        if (isSynchronous) {
-            await this.applyFrame();
+        if (isSynchronous || animation) {
+            await this.applyFrame(animation);
         } else {
             this.applyAsync();
         }
@@ -165,12 +165,12 @@ class PluginAnimationManager extends StatefulPluginComponent<PluginAnimationMana
         }
     }
 
-    private async applyFrame() {
+    private async applyFrame(animation?: PluginAnimationManager.AnimationInfo) {
         const t = this.currentTime;
         if (this._current.startedTime < 0) this._current.startedTime = t;
         const newState = await this._current.anim.apply(
             this._current.state,
-            { lastApplied: this._current.lastTime, current: t - this._current.startedTime },
+            { lastApplied: this._current.lastTime, current: t - this._current.startedTime, animation },
             { params: this._current.paramValues, plugin: this.context });
 
         if (newState.kind === 'finished') {
@@ -228,6 +228,11 @@ class PluginAnimationManager extends StatefulPluginComponent<PluginAnimationMana
 }
 
 namespace PluginAnimationManager {
+    export interface AnimationInfo {
+        currentFrame: number,
+        frameCount: number
+    }
+
     export interface Current {
         anim: PluginStateAnimation
         params: PD.Params,

src/mol-plugin/animation-loop.ts

@@ -6,6 +6,7 @@
 
 import { PluginContext } from './context';
 import { now } from '../mol-util/now';
+import { PluginAnimationManager } from '../mol-plugin-state/manager/animation';
 
 export class PluginAnimationLoop {
     private currentFrame: any = void 0;
@@ -15,8 +16,8 @@ export class PluginAnimationLoop {
         return this._isAnimating;
     }
 
-    async tick(t: number, options?: { isSynchronous?: boolean, manualDraw?: boolean }) {
-        await this.plugin.managers.animation.tick(t, options?.isSynchronous);
+    async tick(t: number, options?: { isSynchronous?: boolean, manualDraw?: boolean, animation?: PluginAnimationManager.AnimationInfo }) {
+        await this.plugin.managers.animation.tick(t, options?.isSynchronous, options?.animation);
         this.plugin.canvas3d?.tick(t as now.Timestamp, options);
     }
 

src/mol-theme/color/illustrative.ts

@@ -1,5 +1,5 @@
 /**
- * Copyright (c) 2019-2020 mol* contributors, licensed under MIT, See LICENSE file for more info.
+ * Copyright (c) 2019-2022 mol* contributors, licensed under MIT, See LICENSE file for more info.
  *
  * @author Alexander Rose <alexander.rose@weirdbyte.de>
  */
@@ -12,24 +12,42 @@ import { ColorTheme } from '../color';
 import { ParamDefinition as PD } from '../../mol-util/param-definition';
 import { ThemeDataContext } from '../theme';
 import { ChainIdColorTheme, ChainIdColorThemeParams } from './chain-id';
+import { UniformColorTheme, UniformColorThemeParams } from './uniform';
+import { assertUnreachable } from '../../mol-util/type-helpers';
+import { EntityIdColorTheme, EntityIdColorThemeParams } from './entity-id';
+import { MoleculeTypeColorTheme, MoleculeTypeColorThemeParams } from './molecule-type';
+import { EntitySourceColorTheme, EntitySourceColorThemeParams } from './entity-source';
 
 const DefaultIllustrativeColor = Color(0xEEEEEE);
-const Description = `Assigns an illustrative color that gives every chain a unique color with lighter carbons (inspired by David Goodsell's Molecule of the Month style).`;
+const Description = `Assigns an illustrative color that gives every chain a color based on the choosen style but with lighter carbons (inspired by David Goodsell's Molecule of the Month style).`;
 
 export const IllustrativeColorThemeParams = {
-    ...ChainIdColorThemeParams,
+    style: PD.MappedStatic('entity-id', {
+        uniform: PD.Group(UniformColorThemeParams),
+        'chain-id': PD.Group(ChainIdColorThemeParams),
+        'entity-id': PD.Group(EntityIdColorThemeParams),
+        'entity-source': PD.Group(EntitySourceColorThemeParams),
+        'molecule-type': PD.Group(MoleculeTypeColorThemeParams),
+    }),
     carbonLightness: PD.Numeric(0.8, { min: -6, max: 6, step: 0.1 })
 };
 export type IllustrativeColorThemeParams = typeof IllustrativeColorThemeParams
 export function getIllustrativeColorThemeParams(ctx: ThemeDataContext) {
-    return IllustrativeColorThemeParams; // TODO return copy
+    const params = PD.clone(IllustrativeColorThemeParams);
+    return params;
 }
 
 export function IllustrativeColorTheme(ctx: ThemeDataContext, props: PD.Values<IllustrativeColorThemeParams>): ColorTheme<IllustrativeColorThemeParams> {
-    const { color: chainIdColor, legend } = ChainIdColorTheme(ctx, props);
+    const { color: styleColor, legend } =
+        props.style.name === 'uniform' ? UniformColorTheme(ctx, props.style.params) :
+            props.style.name === 'chain-id' ? ChainIdColorTheme(ctx, props.style.params) :
+                props.style.name === 'entity-id' ? EntityIdColorTheme(ctx, props.style.params) :
+                    props.style.name === 'entity-source' ? EntitySourceColorTheme(ctx, props.style.params) :
+                        props.style.name === 'molecule-type' ? MoleculeTypeColorTheme(ctx, props.style.params) :
+                            assertUnreachable(props.style);
 
     function illustrativeColor(location: Location, typeSymbol: ElementSymbol) {
-        const baseColor = chainIdColor(location, false);
+        const baseColor = styleColor(location, false);
         return typeSymbol === 'C' ? Color.lighten(baseColor, props.carbonLightness) : baseColor;
     }
 

src/mol-theme/color/molecule-type.ts

@@ -1,10 +1,10 @@
 /**
- * Copyright (c) 2018-2019 mol* contributors, licensed under MIT, See LICENSE file for more info.
+ * Copyright (c) 2018-2022 mol* contributors, licensed under MIT, See LICENSE file for more info.
  *
  * @author Alexander Rose <alexander.rose@weirdbyte.de>
  */
 
-import { Color, ColorMap } from '../../mol-util/color';
+import { Color } from '../../mol-util/color';
 import { StructureElement, Unit, Bond, ElementIndex } from '../../mol-model/structure';
 import { Location } from '../../mol-model/location';
 import { ColorTheme } from '../color';
@@ -13,53 +13,55 @@ import { getElementMoleculeType } from '../../mol-model/structure/util';
 import { ParamDefinition as PD } from '../../mol-util/param-definition';
 import { ThemeDataContext } from '../theme';
 import { TableLegend } from '../../mol-util/legend';
-import { getAdjustedColorMap } from '../../mol-util/color/color';
-
-export const MoleculeTypeColors = ColorMap({
-    water: 0x386cb0,
-    ion: 0xf0027f,
-    protein: 0xbeaed4,
-    RNA: 0xfdc086,
-    DNA: 0xbf5b17,
-    PNA: 0x42A49A,
-    saccharide: 0x7fc97f,
-});
-export type MoleculeTypeColors = typeof MoleculeTypeColors
 
 const DefaultMoleculeTypeColor = Color(0xffff99);
 const Description = 'Assigns a color based on the molecule type of a residue.';
 
 export const MoleculeTypeColorThemeParams = {
     saturation: PD.Numeric(0, { min: -6, max: 6, step: 0.1 }),
-    lightness: PD.Numeric(0, { min: -6, max: 6, step: 0.1 })
+    lightness: PD.Numeric(0, { min: -6, max: 6, step: 0.1 }),
+    colors: PD.Group({
+        water: PD.Color(Color(0x386cb0)),
+        ion: PD.Color(Color(0xf0027f)),
+        protein: PD.Color(Color(0xbeaed4)),
+        rna: PD.Color(Color(0xfdc086)),
+        dna: PD.Color(Color(0xbf5b17)),
+        pna: PD.Color(Color(0x42A49A)),
+        saccharide: PD.Color(Color(0x7fc97f)),
+        lipid: PD.Color(Color(0xcccccc)),
+    })
 };
 export type MoleculeTypeColorThemeParams = typeof MoleculeTypeColorThemeParams
 export function getMoleculeTypeColorThemeParams(ctx: ThemeDataContext) {
     return MoleculeTypeColorThemeParams; // TODO return copy
 }
 
-export function moleculeTypeColor(colorMap: MoleculeTypeColors, unit: Unit, element: ElementIndex): Color {
+type MoleculeTypeColorThemeProps = PD.Values<MoleculeTypeColorThemeParams>;
+export function moleculeTypeColor(props: MoleculeTypeColorThemeProps, unit: Unit, element: ElementIndex): Color {
+    let c = DefaultMoleculeTypeColor;
     const moleculeType = getElementMoleculeType(unit, element);
     switch (moleculeType) {
-        case MoleculeType.Water: return colorMap.water;
-        case MoleculeType.Ion: return colorMap.ion;
-        case MoleculeType.Protein: return colorMap.protein;
-        case MoleculeType.RNA: return colorMap.RNA;
-        case MoleculeType.DNA: return colorMap.DNA;
-        case MoleculeType.PNA: return colorMap.PNA;
-        case MoleculeType.Saccharide: return colorMap.saccharide;
+        case MoleculeType.Water: c = props.colors.water; break;
+        case MoleculeType.Ion: c = props.colors.ion; break;
+        case MoleculeType.Protein: c = props.colors.protein; break;
+        case MoleculeType.RNA: c = props.colors.rna; break;
+        case MoleculeType.DNA: c = props.colors.dna; break;
+        case MoleculeType.PNA: c = props.colors.pna; break;
+        case MoleculeType.Saccharide: c = props.colors.saccharide; break;
+        case MoleculeType.Lipid: c = props.colors.lipid; break;
     }
-    return DefaultMoleculeTypeColor;
+    c = Color.saturate(c, props.saturation);
+    c = Color.darken(c, -props.lightness);
+    return c;
 }
 
 export function MoleculeTypeColorTheme(ctx: ThemeDataContext, props: PD.Values<MoleculeTypeColorThemeParams>): ColorTheme<MoleculeTypeColorThemeParams> {
-    const colorMap = getAdjustedColorMap(MoleculeTypeColors, props.saturation, props.lightness);
 
     function color(location: Location): Color {
         if (StructureElement.Location.is(location)) {
-            return moleculeTypeColor(colorMap, location.unit, location.element);
+            return moleculeTypeColor(props, location.unit, location.element);
         } else if (Bond.isLocation(location)) {
-            return moleculeTypeColor(colorMap, location.aUnit, location.aUnit.elements[location.aIndex]);
+            return moleculeTypeColor(props, location.aUnit, location.aUnit.elements[location.aIndex]);
         }
         return DefaultMoleculeTypeColor;
     }
@@ -70,8 +72,8 @@ export function MoleculeTypeColorTheme(ctx: ThemeDataContext, props: PD.Values<M
         color,
         props,
         description: Description,
-        legend: TableLegend(Object.keys(MoleculeTypeColors).map(name => {
-            return [name, (MoleculeTypeColors as any)[name] as Color] as [string, Color];
+        legend: TableLegend(Object.keys(props.colors).map(name => {
+            return [name, (props.colors as any)[name] as Color] as [string, Color];
         }).concat([['Other/unknown', DefaultMoleculeTypeColor]]))
     };
 }